missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
2-Phenylphenol 99.0+%, TCI America™
$40.94 - $148.56
Chemical Identifiers
| CAS | 90-43-7 |
|---|---|
| Molecular Formula | C12H10O |
| Molecular Weight (g/mol) | 170.211 |
| MDL Number | MFCD00002208 |
| InChI Key | LLEMOWNGBBNAJR-UHFFFAOYSA-N |
| Synonym | 1,1'-biphenyl-2-ol, 2-biphenylol, 2-hydroxybiphenyl, 2-hydroxydiphenyl, biphenyl-2-ol, biphenylol, o-hydroxybiphenyl, o-hydroxydiphenyl, o-phenylphenol, phenylphenol |
| PubChem CID | 7017 |
| ChEBI | CHEBI:17043 |
| IUPAC Name | 2-phenylphenol |
| SMILES | C1=CC=C(C=C1)C2=CC=CC=C2O |
Chemical Identifiers
| 90-43-7 | |
| 170.211 | |
| LLEMOWNGBBNAJR-UHFFFAOYSA-N | |
| 7017 | |
| 2-phenylphenol |
| C12H10O | |
| MFCD00002208 | |
| 1,1'-biphenyl-2-ol, 2-biphenylol, 2-hydroxybiphenyl, 2-hydroxydiphenyl, biphenyl-2-ol, biphenylol, o-hydroxybiphenyl, o-hydroxydiphenyl, o-phenylphenol, phenylphenol | |
| CHEBI:17043 | |
| C1=CC=C(C=C1)C2=CC=CC=C2O |
Specifications
| White | |
| 25g | |
| 90-43-7 | |
| MFCD00002208 | |
| 1,1'-biphenyl-2-ol, 2-biphenylol, 2-hydroxybiphenyl, 2-hydroxydiphenyl, biphenyl-2-ol, biphenylol, o-hydroxybiphenyl, o-hydroxydiphenyl, o-phenylphenol, phenylphenol | |
| C1=CC=C(C=C1)C2=CC=CC=C2O | |
| 170.211 | |
| CHEBI:17043 | |
| Crystal-Powder at 20°C | |
| 2-Phenylphenol |
| 59°C | |
| 11.2 to 11.6 (1% H2O soln.) | |
| C12H10O | |
| 3077 | |
| LLEMOWNGBBNAJR-UHFFFAOYSA-N | |
| 2-phenylphenol | |
| 7017 | |
| 170.21 | |
| ≥99.0% (GC) |
Safety and Handling
EINECSNumber : (4)-0019
RTECSNumber : DV5775000
TSCA : Yes