Learn More
2-Phenyl-5-oxazolone, 97%
CAS: 1199-01-5 | C9H7NO2 | 161.16 g/mol
Supplier: Thermo Scientific Chemicals L0019403
Description
2-Phenyl-5-oxazolone is a reagent used as a masked glycine equivalent and for the formation of heterocyclic structures, it can be used to produce 4-benzylidene-2-phenyl-4H-oxazol-5-one.
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Applications2-Phenyl-5-oxazolone is a reagent used as a masked glycine equivalent and for the formation of heterocyclic structures, it can be used to produce 4-benzylidene-2-phenyl-4H-oxazol-5-one.
Solubility
Soluble in most common organic solvents.
Notes
Air Sensitive. Protect from heat. Store away from oxidizing agents.
Specifications
| 2-Phenyl-5-oxazolone | |
| 89°C to 92°C | |
| MFCD00014517 | |
| 128465 | |
| 2-phenyloxazol-5 4h-one, phenyloxazolone, 2-phenyl-5-oxazolone, 2-phenyloxazolone, 2-phenyloxazolin-5-one, 5 4h-oxazolone, 2-phenyl, 2-phenyl-5 4h-oxazolone, 2-phenyl-1,3-oxazol-5 4h-one, 2-phenyl-4h-oxazol-5-one, 2-oxazolin-5-one, 2-phenyl | |
| QKCKCXFWENOGER-UHFFFAOYSA-N | |
| 2-phenyl-4H-1,3-oxazol-5-one | |
| 65073 | |
| 161.16 |
| 1199-01-5 | |
| C9H7NO2 | |
| 1 g | |
| Air sensitive | |
| Soluble in most common organic solvents. | |
| C1C(=O)OC(=N1)C2=CC=CC=C2 | |
| 161.16 | |
| CHEBI:60296 | |
| 97% |
Chemical Identifiers
| 1199-01-5 | |
| 161.16 | |
| QKCKCXFWENOGER-UHFFFAOYSA-N | |
| 65073 | |
| 2-phenyl-4H-1,3-oxazol-5-one |
| C9H7NO2 | |
| MFCD00014517 | |
| 2-phenyloxazol-5 4h-one, phenyloxazolone, 2-phenyl-5-oxazolone, 2-phenyloxazolone, 2-phenyloxazolin-5-one, 5 4h-oxazolone, 2-phenyl, 2-phenyl-5 4h-oxazolone, 2-phenyl-1,3-oxazol-5 4h-one, 2-phenyl-4h-oxazol-5-one, 2-oxazolin-5-one, 2-phenyl | |
| CHEBI:60296 | |
| C1C(=O)OC(=N1)C2=CC=CC=C2 |
Safety and Handling
EINECSNumber : 214-840-2
TSCA : Yes
Recommended Storage : Keep cold
RUO – Research Use Only