missing translation for 'onlineSavingsMsg'
Learn More
Learn More
2-Nitrobenzonitrile, 98%, Thermo Scientific™
Chemical Identifiers
| CAS | 612-24-8 |
|---|---|
| Molecular Formula | C7H4N2O2 |
| Molecular Weight (g/mol) | 148.12 |
| MDL Number | MFCD00007044 |
| InChI Key | SWBDKCMOLSUXRH-UHFFFAOYSA-N |
| Synonym | o-nitrobenzonitrile, o-cyanonitrobenzene, benzonitrile, o-nitro, benzonitrile, 2-nitro, 2-cyanonitrobenzene, nitrobenzonitrile, unii-drc6u29fci, ccris 2326, 1-nitro-2-cyanobenzene, 2-nitrobenzenecarbonitrile |
| PubChem CID | 11922 |
| IUPAC Name | 2-nitrobenzonitrile |
| SMILES | [O-][N+](=O)C1=CC=CC=C1C#N |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC128470100
|
Thermo Scientific Chemicals
128470100 |
10g | Glass bottle |
N/A
|
N/A | ||||
| Please call Customer Service at 1-800-234-7437 or send an email to help@thermofisher.com for assistance. | |||||||||
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Chemical Identifiers
| 612-24-8 | |
| 148.12 | |
| SWBDKCMOLSUXRH-UHFFFAOYSA-N | |
| 11922 | |
| [O-][N+](=O)C1=CC=CC=C1C#N |
| C7H4N2O2 | |
| MFCD00007044 | |
| o-nitrobenzonitrile, o-cyanonitrobenzene, benzonitrile, o-nitro, benzonitrile, 2-nitro, 2-cyanonitrobenzene, nitrobenzonitrile, unii-drc6u29fci, ccris 2326, 1-nitro-2-cyanobenzene, 2-nitrobenzenecarbonitrile | |
| 2-nitrobenzonitrile |
Specifications
| 612-24-8 | |
| 100.0 | |
| Authentic | |
| Glass bottle | |
| O2NC6H4CN | |
| 10g | |
| o-nitrobenzonitrile, o-cyanonitrobenzene, benzonitrile, o-nitro, benzonitrile, 2-nitro, 2-cyanonitrobenzene, nitrobenzonitrile, unii-drc6u29fci, ccris 2326, 1-nitro-2-cyanobenzene, 2-nitrobenzenecarbonitrile | |
| SWBDKCMOLSUXRH-UHFFFAOYSA-N | |
| 2-nitrobenzonitrile | |
| 11922 | |
| 98% |
| 97.5 | |
| 165.0°C (16.0 mmHg) | |
| 97.5% min. (GC) | |
| C7H4N2O2 | |
| MFCD00007044 | |
| 09,374 | |
| Solubility in water: insoluble | |
| [O-][N+](=O)C1=CC=CC=C1C#N | |
| 148.12 | |
| 148.12 | |
| 2-Nitrobenzonitrile |
Safety and Handling
GHS H Statement
Fatal if swallowed.
Toxic in contact with skin.
Toxic if inhaled.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
IF SWALLOWED: Immediately call a POISON CENTER or doctor/physician.
IF ON SKIN: Gently wash with plenty of soap and water.
IF INHALED: Remove
GHS Signal Word: Danger
EINECSNumber : 210-301-
RUO â Research Use Only