Learn More
2-Nitrobenzonitrile, 98%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 128470100
| Quantity | 10g |
|---|---|
| Packaging | Glass bottle |
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Chemical Identifiers
| C7H4N2O2 | |
| MFCD00007044 | |
| o-nitrobenzonitrile, o-cyanonitrobenzene, benzonitrile, o-nitro, benzonitrile, 2-nitro, 2-cyanonitrobenzene, nitrobenzonitrile, unii-drc6u29fci, ccris 2326, 1-nitro-2-cyanobenzene, 2-nitrobenzenecarbonitrile | |
| 2-nitrobenzonitrile |
Specifications
| 2-Nitrobenzonitrile | |
| 97.5 | |
| 165.0°C (16.0 mmHg) | |
| 97.5% min. (GC) | |
| C7H4N2O2 | |
| MFCD00007044 | |
| 09,374 | |
| Solubility in water: insoluble | |
| [O-][N+](=O)C1=CC=CC=C1C#N | |
| 148.12 | |
| 148.12 |
| 612-24-8 | |
| 100.0 | |
| Authentic | |
| Glass bottle | |
| O2NC6H4CN | |
| 10g | |
| o-nitrobenzonitrile, o-cyanonitrobenzene, benzonitrile, o-nitro, benzonitrile, 2-nitro, 2-cyanonitrobenzene, nitrobenzonitrile, unii-drc6u29fci, ccris 2326, 1-nitro-2-cyanobenzene, 2-nitrobenzenecarbonitrile | |
| SWBDKCMOLSUXRH-UHFFFAOYSA-N | |
| 2-nitrobenzonitrile | |
| 11922 | |
| 98% |
Safety and Handling
GHS H Statement
Fatal if swallowed.
Toxic in contact with skin.
Toxic if inhaled.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
IF SWALLOWED: Immediately call a POISON CENTER or doctor/physician.
IF ON SKIN: Gently wash with plenty of soap and water.
IF INHALED: Remove
GHS Signal Word: Danger
EINECSNumber : 210-301-