missing translation for 'onlineSavingsMsg'
Learn More
Learn More
2-Methyl-5-nitrobenzoic acid, 99+%, Thermo Scientific™
$168.80 - $168.80
Chemical Identifiers
| CAS | 1975-52-6 |
|---|---|
| Molecular Formula | C8H7NO4 |
| Molecular Weight (g/mol) | 181.15 |
| MDL Number | MFCD00007371 |
| InChI Key | DJRFJAVPROZZFL-UHFFFAOYSA-N |
| Synonym | 2-methyl-5-nitrobenzoic acid, 5-nitro-o-toluic acid, benzoic acid, 2-methyl-5-nitro, 2-methyl-5-nitro-benzoic acid, 5-nitro-2-methylbenzoic acid, rarechem al bo 0285, 5-nitro-2-methyl benzoic acid, 2-methyl-5-nitro benzoic acid, pubchem2244 |
| PubChem CID | 519683 |
| SMILES | CC1=C(C=C(C=C1)[N+](=O)[O-])C(=O)O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC276570050
|
Thermo Scientific Chemicals
276570050 |
5 g | Glass bottle |
N/A
|
|
||||
Chemical Identifiers
| 1975-52-6 | |
| 181.15 | |
| DJRFJAVPROZZFL-UHFFFAOYSA-N | |
| 519683 |
| C8H7NO4 | |
| MFCD00007371 | |
| 2-methyl-5-nitrobenzoic acid, 5-nitro-o-toluic acid, benzoic acid, 2-methyl-5-nitro, 2-methyl-5-nitro-benzoic acid, 5-nitro-2-methylbenzoic acid, rarechem al bo 0285, 5-nitro-2-methyl benzoic acid, 2-methyl-5-nitro benzoic acid, pubchem2244 | |
| CC1=C(C=C(C=C1)[N+](=O)[O-])C(=O)O |
Specifications
| 1975-52-6 | |
| 100.0 | |
| Yellow to Beige | |
| 99+% | |
| C8H7NO4 | |
| MFCD00007371 | |
| 09, 471 | |
| Solubility in water: insoluble | |
| CC1=C(C=C(C=C1)[N+](=O)[O-])C(=O)O | |
| 519683 | |
| 99+% | |
| 2-Methyl-5-nitrobenzoic acid |
| 99.0 | |
| 176°C to 180°C | |
| Authentic | |
| Glass bottle | |
| CH3C6H3(NO2)CO2H | |
| 5 g | |
| 2-methyl-5-nitrobenzoic acid, 5-nitro-o-toluic acid, benzoic acid, 2-methyl-5-nitro, 2-methyl-5-nitro-benzoic acid, 5-nitro-2-methylbenzoic acid, rarechem al bo 0285, 5-nitro-2-methyl benzoic acid, 2-methyl-5-nitro benzoic acid, pubchem2244 | |
| DJRFJAVPROZZFL-UHFFFAOYSA-N | |
| 181.15 | |
| 181.15 | |
| Crystalline Powder |
Safety and Handling
GHS H Statement
Causes skin irritation.
Causes serious eye irritation.
May cause respiratory irritation.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
IF ON SKIN: Wash with plenty of soap and water.
Avoid breathing dust/fume/gas/mist/vapors/spray.
IF IN EYES: Rinse cautiously with water for
GHS Signal Word: Warning
EINECSNumber : 217-829-
RUO – Research Use Only