missing translation for 'onlineSavingsMsg'
Learn More
Learn More
2-Hydroxy-1-(2-hydroxy-4-sulfo-1-naphthylazo)-3-naphthoic Acid (1:100 diluted with K2SO4), TCI America™
$67.11 - $115.57
Chemical Identifiers
| CAS | 3737-95-9 |
|---|---|
| Molecular Formula | C21H14N2O7S |
| Molecular Weight (g/mol) | 438.41 |
| MDL Number | MFCD00004078 |
| InChI Key | ULIVOAKVRBXKKS-PYCFMQQDSA-N |
| Synonym | calconcarboxylic acid, patton-reeder indicator, calconcarbonic acid, calcon 3-carboxylic acid, patton and reeder's indicator, 2-hydroxy-1-2-hydroxy-4-sulfo-1-napthylazo-3-naphthoic acid, 2,2'-dihydroxy-4'-sulpho-1,1'-azonaphthalene-3-carboxylic acid, 2-naphthalenecarboxylic acid, 3-hydroxy-4-2-hydroxy-4-sulfo-1-naphthalenyl azo, nn |
| PubChem CID | 5895210 |
| IUPAC Name | 3-hydroxy-4-[(2Z)-2-(2-oxo-4-sulfonaphthalen-1-ylidene)hydrazinyl]naphthalene-2-carboxylic acid |
| SMILES | C1=CC=C2C(=C1)C=C(C(=C2NN=C3C4=CC=CC=C4C(=CC3=O)S(=O)(=O)O)O)C(=O)O |
Chemical Identifiers
| 3737-95-9 | |
| 438.41 | |
| ULIVOAKVRBXKKS-PYCFMQQDSA-N | |
| 5895210 | |
| C1=CC=C2C(=C1)C=C(C(=C2NN=C3C4=CC=CC=C4C(=CC3=O)S(=O)(=O)O)O)C(=O)O |
| C21H14N2O7S | |
| MFCD00004078 | |
| calconcarboxylic acid, patton-reeder indicator, calconcarbonic acid, calcon 3-carboxylic acid, patton and reeder's indicator, 2-hydroxy-1-2-hydroxy-4-sulfo-1-napthylazo-3-naphthoic acid, 2,2'-dihydroxy-4'-sulpho-1,1'-azonaphthalene-3-carboxylic acid, 2-naphthalenecarboxylic acid, 3-hydroxy-4-2-hydroxy-4-sulfo-1-naphthalenyl azo, nn | |
| 3-hydroxy-4-[(2Z)-2-(2-oxo-4-sulfonaphthalen-1-ylidene)hydrazinyl]naphthalene-2-carboxylic acid |
Specifications
| 3737-95-9 | |
| C21H14N2O7S | |
| 1 g | |
| ULIVOAKVRBXKKS-PYCFMQQDSA-N | |
| 3-hydroxy-4-[(2Z)-2-(2-oxo-4-sulfonaphthalen-1-ylidene)hydrazinyl]naphthalene-2-carboxylic acid | |
| 5895210 | |
| Crystalline Powder |
| Blue-Purple | |
| MFCD00004078 | |
| calconcarboxylic acid, patton-reeder indicator, calconcarbonic acid, calcon 3-carboxylic acid, patton and reeder's indicator, 2-hydroxy-1-2-hydroxy-4-sulfo-1-napthylazo-3-naphthoic acid, 2,2'-dihydroxy-4'-sulpho-1,1'-azonaphthalene-3-carboxylic acid, 2-naphthalenecarboxylic acid, 3-hydroxy-4-2-hydroxy-4-sulfo-1-naphthalenyl azo, nn | |
| C1=CC=C2C(=C1)C=C(C(=C2NN=C3C4=CC=CC=C4C(=CC3=O)S(=O)(=O)O)O)C(=O)O | |
| 438.41 | |
| 438.41 | |
| 2-Hydroxy-1-(2-hydroxy-4-sulfo-1-naphthylazo)-3-naphthoic Acid (1:100 diluted with K2SO4) |
Safety and Handling
TSCA : Yes