Learn More
2-Ethylhexyl acrylate, 99+%, stabilized
CAS: 103-11-7 | C11H20O2 | 184.28 g/mol
$83.14 - $231.02
Chemical Identifiers
| CAS | 103-11-7 |
|---|---|
| Molecular Formula | C11H20O2 |
| Molecular Weight (g/mol) | 184.28 |
| MDL Number | MFCD00009495 |
| InChI Key | GOXQRTZXKQZDDN-UHFFFAOYSA-N |
| Synonym | 2-ethylhexyl acrylate, 2-propenoic acid, 2-ethylhexyl ester, 2-ethyl-1-hexyl acrylate, 2-ethylhexyl 2-propenoate, acrylic acid, 2-ethylhexyl ester, 2-ethylhexylacrylate, acrylic acid 2-ethylhexyl ester, 1-hexanol, 2-ethyl-, acrylate, ccris 3430, 2-ethylhexylester kyseliny akrylove |
| PubChem CID | 7636 |
| ChEBI | CHEBI:82465 |
| IUPAC Name | 2-ethylhexyl prop-2-enoate |
| SMILES | CCCCC(CC)COC(=O)C=C |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC410110250
|
Thermo Scientific Chemicals
410110250 |
25 g | Glass bottle |
Each for $83.14
|
|
||||
|
AC410110010
|
Thermo Scientific Chemicals
410110010 |
1 kg | Glass bottle |
Each for $95.04
|
|
||||
|
AC410110025
|
Thermo Scientific Chemicals
410110025 |
2.5 kg | Plastic drum |
Each for $231.02
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 103-11-7 | |
| 184.28 | |
| GOXQRTZXKQZDDN-UHFFFAOYSA-N | |
| 7636 | |
| 2-ethylhexyl prop-2-enoate |
| C11H20O2 | |
| MFCD00009495 | |
| 2-ethylhexyl acrylate, 2-propenoic acid, 2-ethylhexyl ester, 2-ethyl-1-hexyl acrylate, 2-ethylhexyl 2-propenoate, acrylic acid, 2-ethylhexyl ester, 2-ethylhexylacrylate, acrylic acid 2-ethylhexyl ester, 1-hexanol, 2-ethyl-, acrylate, ccris 3430, 2-ethylhexylester kyseliny akrylove | |
| CHEBI:82465 | |
| CCCCC(CC)COC(=O)C=C |
Specifications
| 103-11-7 , 150-76-5 | |
| 99.0 | |
| -90.0°C | |
| 215.0°C to 219.0°C | |
| Authentic | |
| Glass bottle | |
| 1.4340 to 1.4360 | |
| MFCD00009495 | |
| 0.88 | |
| Solubility in water: insoluble | |
| CCCCC(CC)COC(=O)C=C | |
| 184.28 | |
| 7636 | |
| CHEBI:82465 | |
| 99+% | |
| 2-Ethylhexyl acrylate |
| 0.01% max. (as acrylic acid) | |
| 100.0 | |
| 0.8800g/mL | |
| 86°C | |
| 99% min. (GC) | |
| C11H20O2 | |
| CH2=CHCOOCH2CH(CH2CH3)(CH2)3CH3 | |
| 25 g | |
| 2-ethylhexyl acrylate, 2-propenoic acid, 2-ethylhexyl ester, 2-ethyl-1-hexyl acrylate, 2-ethylhexyl 2-propenoate, acrylic acid, 2-ethylhexyl ester, 2-ethylhexylacrylate, acrylic acid 2-ethylhexyl ester, 1-hexanol, 2-ethyl-, acrylate, ccris 3430, 2-ethylhexylester kyseliny akrylove | |
| GOXQRTZXKQZDDN-UHFFFAOYSA-N | |
| 2-ethylhexyl prop-2-enoate | |
| 10 to 20ppm MEHQ | |
| 1.7 mPa.s (20°C) | |
| 184.28 | |
| Liquid |
Safety and Handling
GHS H Statement
May cause respiratory irritation.
Causes skin irritation.
May cause an allergic skin reaction.
Harmful to aquatic life with long lasting effects.
GHS P Statement
Wear protective gloves/protective clothing.
IF ON SKIN: Wash with plenty of soap and water.
If skin irritation or rash occurs: Get medical advice/attention.
IF INHALED: Remove to fresh air and keep at rest in a posit
GHS Signal Word: Warning
EINECSNumber : 203-080-7
RUO – Research Use Only