Learn More
2-(Diphenylphosphino)benzoic Acid, 98%
CAS: 17261-28-8 | C19H15O2P | 306.30 g/mol
$137.93 - $137.93
Chemical Identifiers
| CAS | 17261-28-8 |
|---|---|
| Molecular Formula | C19H15O2P |
| Molecular Weight (g/mol) | 306.30 |
| MDL Number | MFCD00674024 |
| InChI Key | UYRPRYSDOVYCOU-UHFFFAOYSA-N |
| Synonym | 2-diphenylphosphino benzoic acid, 2-diphenylphosphinobenzoic acid, benzoic acid, 2-diphenylphosphino, o-diphenylphosphinobenozic acid, 2-carboxyphenyl diphenylphosphine, 2-diphenylphosphanyl benzoic acid, benzoic acid, diphenylphosphino, o-diphenylphosphino benzoic acid, dppbac, acmc-1bt7u |
| PubChem CID | 87021 |
| IUPAC Name | 2-diphenylphosphanylbenzoic acid |
| SMILES | OC(=O)C1=CC=CC=C1P(C1=CC=CC=C1)C1=CC=CC=C1 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC382930010
|
Thermo Scientific Chemicals
382930010 |
1 g | Glass bottle |
Each for $137.93
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 17261-28-8 | |
| 306.30 | |
| UYRPRYSDOVYCOU-UHFFFAOYSA-N | |
| 87021 | |
| OC(=O)C1=CC=CC=C1P(C1=CC=CC=C1)C1=CC=CC=C1 |
| C19H15O2P | |
| MFCD00674024 | |
| 2-diphenylphosphino benzoic acid, 2-diphenylphosphinobenzoic acid, benzoic acid, 2-diphenylphosphino, o-diphenylphosphinobenozic acid, 2-carboxyphenyl diphenylphosphine, 2-diphenylphosphanyl benzoic acid, benzoic acid, diphenylphosphino, o-diphenylphosphino benzoic acid, dppbac, acmc-1bt7u | |
| 2-diphenylphosphanylbenzoic acid |
Specifications
| 17261-28-8 | |
| 100.0 | |
| Yellow | |
| 98% | |
| C19H15O2P | |
| MFCD00674024 | |
| 2-diphenylphosphino benzoic acid, 2-diphenylphosphinobenzoic acid, benzoic acid, 2-diphenylphosphino, o-diphenylphosphinobenozic acid, 2-carboxyphenyl diphenylphosphine, 2-diphenylphosphanyl benzoic acid, benzoic acid, diphenylphosphino, o-diphenylphosphino benzoic acid, dppbac, acmc-1bt7u | |
| OC(=O)C1=CC=CC=C1P(C1=CC=CC=C1)C1=CC=CC=C1 | |
| 306.30 | |
| 306.3 | |
| Powder |
| 97.5 | |
| 177.0°C to 181.0°C | |
| Authentic | |
| Glass bottle | |
| (C6H5)2PC6H4COOH | |
| 1 g | |
| UYRPRYSDOVYCOU-UHFFFAOYSA-N | |
| 2-diphenylphosphanylbenzoic acid | |
| 87021 | |
| 98% | |
| 2-(Diphenylphosphino)benzoic acid |
Safety and Handling
GHS H Statement
Causes serious eye irritation.
Harmful if inhaled.
May cause respiratory irritation.
Causes skin irritation.
Harmful if swallowed.
GHS P Statement
IF INHALED: Remove victim to fresh air and keep at rest in a position comfortable for breathing.
Avoid breathing dust/fume/gas/mist/vapors/spray.
IF SWALLOWED: Call a POISON CENTER or doctor/physician if you feel unwell.
GHS Signal Word: Warning
EINECSNumber : 241-293-7
RUO – Research Use Only