missing translation for 'onlineSavingsMsg'
Learn More
Learn More
2-(Chloromethyl)-5-phenyl-1,3,4-oxadiazole, 97%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 438280010
| Quantity | 1g |
|---|
Chemical Identifiers
| 33575-83-6 | |
| 194.62 | |
| AGLNTFQAHIRTFA-UHFFFAOYSA-N | |
| 314941 | |
| ClCC1=NN=C(O1)C1=CC=CC=C1 |
| C9H7ClN2O | |
| MFCD00466332 | |
| 2-chloromethyl-5-phenyl-1,3,4-oxadiazole, 2-chloromethyl-5-phenyl-1,3,4 oxadiazole, 5-chloromethyl-2-phenyl-1,3,4-oxadiazole, 1,3,4-oxadiazole, 2-chloromethyl-5-phenyl, enamine_005035, chloromethylphenyloxadiazole, 1,3,4-oxadiazole,2-chloromethyl-5-phenyl, 5-chloromethyl-1,3,4-oxadiazol-2-yl benzene | |
| 2-(chloromethyl)-5-phenyl-1,3,4-oxadiazole |
Specifications
| 2-(chloromethyl)-5-phenyl-1, 3, 4-oxadiazole | |
| 96.0 | |
| Authentic | |
| Glass Bottle | |
| MFCD00466332 | |
| 2-chloromethyl-5-phenyl-1,3,4-oxadiazole, 2-chloromethyl-5-phenyl-1,3,4 oxadiazole, 5-chloromethyl-2-phenyl-1,3,4-oxadiazole, 1,3,4-oxadiazole, 2-chloromethyl-5-phenyl, enamine_005035, chloromethylphenyloxadiazole, 1,3,4-oxadiazole,2-chloromethyl-5-phenyl, 5-chloromethyl-1,3,4-oxadiazol-2-yl benzene | |
| ClCC1=NN=C(O1)C1=CC=CC=C1 | |
| 194.62 | |
| 194.62 |
| 33575-83-6 | |
| 100.0 | |
| 96% min. (GC) | |
| C9H7ClN2O | |
| 1g | |
| AGLNTFQAHIRTFA-UHFFFAOYSA-N | |
| 2-(chloromethyl)-5-phenyl-1,3,4-oxadiazole | |
| 314941 | |
| 97% |
Safety and Handling
GHS H Statement
Harmful if swallowed.
Harmful in contact with skin.
Causes skin irritation.
Causes serious eye irritation.
May cause respiratory irritation.
GHS P Statement
Wear protective gloves/eye protection/face protection.
IF ON SKIN: Wash with plenty of soap and water.
IF INHALED: If breathing is difficult,remove to fresh air and keep at rest in a position comfortable for breathing.
GHS Signal Word: Warning