missing translation for 'onlineSavingsMsg'
Learn More
Learn More
2,6-Dinitro-p-cresol (wetted with ca. 20% Water) (unit weight on dry weight basis) 98.0+%, TCI America™
Supplier: TCI America D216625G
Description
Greener Choice Claims
- Environmental benefits include:
- Renewable Energy
Specifications
| 2,6-Dinitro-p-cresol (wetted with ca. 20% Water) (unit weight on dry weight basis) | |
| 80°C | |
| MFCD00007121 | |
| 2811 | |
| HOYRZHJJAHRMLL-UHFFFAOYSA-N | |
| 4-methyl-2,6-dinitrophenol | |
| 11872 | |
| ≥98.0% (T) |
| 609-93-8 | |
| C7H6N2O5 | |
| 25 g | |
| 2,6-dinitro-p-cresol, 4-methyl-2,6-dinitrophenol, victoria orange, victoria yellow, dinitro-p-cresol, 2,6-dinitro-4-methylphenol, dnpc, phenol, 4-methyl-2,6-dinitro, p-cresol, 2,6-dinitro, unii-l572bvh6nf | |
| CC1=CC(=C(O)C(=C1)[N+]([O-])=O)[N+]([O-])=O | |
| 198.13 | |
| 198.13 | |
| Crystalline Powder |
Chemical Identifiers
| 609-93-8 | |
| 198.13 | |
| HOYRZHJJAHRMLL-UHFFFAOYSA-N | |
| 11872 | |
| CC1=CC(=C(O)C(=C1)[N+]([O-])=O)[N+]([O-])=O |
| C7H6N2O5 | |
| MFCD00007121 | |
| 2,6-dinitro-p-cresol, 4-methyl-2,6-dinitrophenol, victoria orange, victoria yellow, dinitro-p-cresol, 2,6-dinitro-4-methylphenol, dnpc, phenol, 4-methyl-2,6-dinitro, p-cresol, 2,6-dinitro, unii-l572bvh6nfShow More | |
| 4-methyl-2,6-dinitrophenol |
Safety and Handling
EINECSNumber : (3)-3692
RTECSNumber : GO9800000
TSCA : Yes