missing translation for 'onlineSavingsMsg'
Learn More
Learn More
2,4-Dinitrophenylhydrazine, Spectrum™ Chemical
DI149, 119-26-6, C6H6N4O4
Supplier: Spectrum Chemical Mfg Cor DI14950KGBL
Description
Spectrum™ Chemical 2,4-Dinitrophenylhydrazine is a chemical compound that is usually supplied as a wet red-to-orange solid that is shock sensitive. It is used in Brady′s test to detect the carbonyl functionality of an aldehyde or ketone functional group.Specifications
| 119-26-6 | |
| Fiber Drum | |
| 50 kg | |
| HORQAOAYAYGIBM-UHFFFAOYSA-N | |
| (2,4-dinitrophenyl)hydrazine | |
| 65 to 70% | |
| Crystalline Powder or Lumps |
| 100% | |
| C6H6N4O4 | |
| UN1325 | |
| NNC1=CC=C(C=C1[N+]([O-])=O)[N+]([O-])=O | |
| 198.14 | |
| Reagent |
Chemical Identifiers
| 119-26-6 | |
| 198.14 | |
| (2,4-dinitrophenyl)hydrazine |
| C6H6N4O4 | |
| HORQAOAYAYGIBM-UHFFFAOYSA-N | |
| NNC1=CC=C(C=C1[N+]([O-])=O)[N+]([O-])=O |