missing translation for 'onlineSavingsMsg'
Learn More
Learn More
2,4,6-Trivinylboroxin - Pyridine Complex 98.0+%, TCI America™
Supplier: TCI America T24985G
Specifications
| 2,4,6-Trivinylboroxin - Pyridine Complex | |
| 51°C | |
| C11H14B3NO3 | |
| 5 g | |
| YLHJACXHRQQNQR-UHFFFAOYSA-N | |
| pyridine;2,4,6-tris(ethenyl)-1,3,5,2,4,6-trioxatriborinane | |
| 2734806 | |
| ≥98.0% (T) |
| 95010-17-6 | |
| White-Yellow | |
| MFCD03839440 | |
| 2,4,6-trivinyl-1,3,5,2,4,6-trioxatriborinane compound with pyridine 1:1, trivinylboroxin pyridine complex, vinylboronic anhydride pyridine complex, 2,4,6-trivinylcyclotriboroxane-pyridine, 2,4,6-trivinylcyclotriboroxane pyridine, vinylboronic anhydride pyridine, 2,4,6-trivinylcyclotriboroxane pyridine complex, 2,4,6-trivinylcyclotriboroxane-pyridine complex, boroxin, triethenyl-, compd. with pyridine 1:1, pyridine; triethenyl-1,3,5,2,4,6-trioxatriborinane | |
| B1(OB(OB(O1)C=C)C=C)C=C.C1=CC=NC=C1 | |
| 240.667 | |
| 240.67 | |
| Crystalline Powder |
Chemical Identifiers
| 95010-17-6 | |
| 240.667 | |
| YLHJACXHRQQNQR-UHFFFAOYSA-N | |
| 2734806 | |
| B1(OB(OB(O1)C=C)C=C)C=C.C1=CC=NC=C1 |
| C11H14B3NO3 | |
| MFCD03839440 | |
| 2,4,6-trivinyl-1,3,5,2,4,6-trioxatriborinane compound with pyridine 1:1, trivinylboroxin pyridine complex, vinylboronic anhydride pyridine complex, 2,4,6-trivinylcyclotriboroxane-pyridine, 2,4,6-trivinylcyclotriboroxane pyridine, vinylboronic anhydride pyridine, 2,4,6-trivinylcyclotriboroxane pyridine complex, 2,4,6-trivinylcyclotriboroxane-pyridine complex, boroxin, triethenyl-, compd. with pyridine 1:1, pyridine; triethenyl-1,3,5,2,4,6-trioxatriborinane | |
| pyridine;2,4,6-tris(ethenyl)-1,3,5,2,4,6-trioxatriborinane |
Safety and Handling
TSCA : No