Learn More
2,3,4,5,6-Pentafluorostyrene, 97%, stabilized
CAS: 653-34-9 | C8H3F5 | 194.1 g/mol
Supplier: Thermo Scientific Chemicals 188470050
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| 2,3,4,5,6-Pentafluorostyrene | |
| 653-34-9,123-31-9 | |
| 100.0 | |
| 1.4060g/mL | |
| 34°C | |
| 96% min. (GC) | |
| C8H3F5 | |
| C6F5CH=CH2 | |
| 5 g | |
| 2,3,4,5,6-pentafluorostyrene, pentafluorostyrene, benzene, ethenylpentafluoro, 1,2,3,4,5-pentafluoro-6-vinyl-benzene, 2',3',4',5',6'-pentafluorostyrene, 2-2,3,4,5,6-pentafluorophenyl ethyl, vinylpentafluorobenzene, acmc-1avmt, styrene, 2,3,4,5,6-pentafluoro, 1,2,3,4,5-pentafluoro-6-vinylbenzene | |
| C=CC1=C(C(=C(C(=C1F)F)F)F)F | |
| 194.1 | |
| 69556 | |
| 97% |
| 97% | |
| 96.0 | |
| Colorless to Yellow | |
| 62.0°C to 63.0°C (50.0 mmHg) | |
| Authentic | |
| Glass bottle | |
| 1.4445 to 1.4465 | |
| MFCD00000300 | |
| 1.406 | |
| LVJZCPNIJXVIAT-UHFFFAOYSA-N | |
| 1-ethenyl-2,3,4,5,6-pentafluorobenzene | |
| 0.01% tert.-butylcatechol | |
| 194.1 | |
| Liquid |
Chemical Identifiers
| 653-34-9 | |
| 194.1 | |
| LVJZCPNIJXVIAT-UHFFFAOYSA-N | |
| 69556 | |
| C=CC1=C(C(=C(C(=C1F)F)F)F)F |
| C8H3F5 | |
| MFCD00000300 | |
| 2,3,4,5,6-pentafluorostyrene, pentafluorostyrene, benzene, ethenylpentafluoro, 1,2,3,4,5-pentafluoro-6-vinyl-benzene, 2',3',4',5',6'-pentafluorostyrene, 2-2,3,4,5,6-pentafluorophenyl ethyl, vinylpentafluorobenzene, acmc-1avmt, styrene, 2,3,4,5,6-pentafluoro, 1,2,3,4,5-pentafluoro-6-vinylbenzene | |
| 1-ethenyl-2,3,4,5,6-pentafluorobenzene |
Safety and Handling
GHS H Statement
Flammable liquid and vapor.
GHS P Statement
Keep away from heat/sparks/open flames/hot surfaces.
- No smoking.
IF ON SKIN (or hair): Take off immediately all contaminated clothing.
Rinse skin with water/shower.
Store in a well-ventilated place.
Keep contai
GHS Signal Word: Warning
EINECSNumber : 211-500-5
TSCA : TSCA
RUO – Research Use Only