Learn More
1H,1H,2H-Perfluoro-1-hexene, 97%
CAS: 19430-93-4 | C6H3F9 | 246.076 g/mol
Supplier: Thermo Scientific Chemicals L1683422
Description
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| 1H,1H,2H-Perfluoro-1-hexene | |
| 1.457 | |
| None | |
| CF3(CF2)3CH=CH2 | |
| MFCD00042338 | |
| 1819716 | |
| GVEUEBXMTMZVSD-UHFFFAOYSA-N | |
| 3,3,4,4,5,5,6,6,6-nonafluorohex-1-ene | |
| 88054 | |
| 97% |
| 19430-93-4 | |
| 59°C to 60°C | |
| C6H3F9 | |
| 1.289 | |
| 100 g | |
| perfluorobutyl ethylene, 3,3,4,4,5,5,6,6,6-nonafluoro-1-hexene, perfluorobutylethylene, 1h,1h,2h-perfluoro-1-hexene, 1h,1h,2h-perfluorohexene, perfluorobutyl ethene, 1-hexene, 3,3,4,4,5,5,6,6,6-nonafluoro, 3,3,4,4,5,5,6,6,6-nonafluorohexene, perfluoro-n-butyl ethylene, 1h,1h,2h-perfluorohex-1-ene | |
| C=CC(C(C(C(F)(F)F)(F)F)(F)F)(F)F | |
| 246.076 | |
| 246.08 |
Chemical Identifiers
| 19430-93-4 | |
| 246.076 | |
| GVEUEBXMTMZVSD-UHFFFAOYSA-N | |
| 88054 | |
| C=CC(C(C(C(F)(F)F)(F)F)(F)F)(F)F |
| C6H3F9 | |
| MFCD00042338 | |
| perfluorobutyl ethylene, 3,3,4,4,5,5,6,6,6-nonafluoro-1-hexene, perfluorobutylethylene, 1h,1h,2h-perfluoro-1-hexene, 1h,1h,2h-perfluorohexene, perfluorobutyl ethene, 1-hexene, 3,3,4,4,5,5,6,6,6-nonafluoro, 3,3,4,4,5,5,6,6,6-nonafluorohexene, perfluoro-n-butyl ethylene, 1h,1h,2h-perfluorohex-1-ene | |
| 3,3,4,4,5,5,6,6,6-nonafluorohex-1-ene |
Safety and Handling
P210-P233-P240-P241-P242-P243-P280-P303+P361+P353-P370+P378q-P501c
H225
EINECSNumber : 243-053-7
TSCA : Yes
Recommended Storage : Ambient temperatures
RUO – Research Use Only