missing translation for 'onlineSavingsMsg'
Learn More
Learn More
1-O-n-Octyl-beta-D-glucopyranoside, 98%
CAS: 29836-26-8 | C14H28O6 | 292.37 g/mol
Supplier: Thermo Scientific Chemicals 230340250
| Quantity | 25 g |
|---|---|
| Packaging | Glass bottle |
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 29836-26-8 | |
| 292.37 | |
| HEGSGKPQLMEBJL-RKQHYHRCSA-N | |
| 62852 | |
| CCCCCCCCO[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| C14H28O6 | |
| MFCD00063288 | |
| octyl-beta-d-glucopyranoside, b-octylglucoside, octyl beta-d-glucopyranoside, octyl beta-d-glucoside, octyl glucoside, n-octyl-beta-d-glucoside, octyl b-d-glucopyranoside, 2r,3s,4s,5r,6r-2-hydroxymethyl-6-octyloxy tetrahydro-2h-pyran-3,4,5-triol, unii-v109wut6rl, n-octyl glucoside | |
| (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-octoxyoxane-3,4,5-triol |
Specifications
| 1-O-n-Octyl-β-D-glucopyranoside | |
| 97.5 | |
| 105°C | |
| Authentic | |
| Glass bottle | |
| 25 g | |
| 15, 6857 | |
| -32 | |
| (10% in water) Clear to slightly hazy colorless to light yellow | |
| CCCCCCCCO[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O | |
| 292.37 | |
| 292.36 | |
| Crystalline Powder and/or Chunks |
| 29836-26-8 | |
| 100.0 | |
| White | |
| 97.5% min. (ELSD) (HPLC) | |
| C14H28O6 | |
| MFCD00063288 | |
| − 32.00 (20.00°C c=5,water) | |
| octyl-beta-d-glucopyranoside, b-octylglucoside, octyl beta-d-glucopyranoside, octyl beta-d-glucoside, octyl glucoside, n-octyl-beta-d-glucoside, octyl b-d-glucopyranoside, 2r,3s,4s,5r,6r-2-hydroxymethyl-6-octyloxy tetrahydro-2h-pyran-3,4,5-triol, unii-v109wut6rl, n-octyl glucoside | |
| HEGSGKPQLMEBJL-RKQHYHRCSA-N | |
| (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-octoxyoxane-3,4,5-triol | |
| 62852 | |
| 98% |
Safety and Handling
EINECSNumber : 249-887-8