missing translation for 'onlineSavingsMsg'
Learn More
Learn More
1-Naphthaleneacetic Acid, 97%, Spectrum™ Chemical
NA107, 86-87-3, C12H10O2
Supplier: Spectrum Chemical Mfg Cor NA1075KG
Description
Spectrum™ Chemical 1-Naphthaleneacetic Acid is an organic compound that is colorless and soluble in organic solvents. It is a synthetic plant hormone that is part of the auxin family and is found in most commercial horticultural plant rooting products and is used for rooting and propagation purposes.Specifications
| 86-87-3 | |
| Poly Pail | |
| MFCD00004046 | |
| PRPINYUDVPFIRX-UHFFFAOYSA-N | |
| 2-(naphthalen-1-yl)acetic acid | |
| 97% |
| 100% | |
| C12H10O2 | |
| 5 kg | |
| OC(=O)CC1=C2C=CC=CC2=CC=C1 | |
| 186.21 | |
| Reagent |
Chemical Identifiers
| 86-87-3 | |
| 186.21 | |
| PRPINYUDVPFIRX-UHFFFAOYSA-N | |
| OC(=O)CC1=C2C=CC=CC2=CC=C1 |
| C12H10O2 | |
| MFCD00004046 | |
| 2-(naphthalen-1-yl)acetic acid |