Learn More
1-Fluoro-4-nitrobenzene, 99%
CAS: 350-46-9 | C6H4FNO2 | 141.1 g/mol
$119.97 - $497.63
Chemical Identifiers
| CAS | 350-46-9 |
|---|---|
| Molecular Formula | C6H4FNO2 |
| Molecular Weight (g/mol) | 141.1 |
| MDL Number | MFCD00007282 |
| InChI Key | WFQDTOYDVUWQMS-UHFFFAOYSA-N |
| Synonym | 4-fluoronitrobenzene, p-fluoronitrobenzene, p-nitrofluorobenzene, benzene, 1-fluoro-4-nitro, 4-nitrofluorobenzene, 1-nitro-4-fluorobenzene, 4-fluoro-1-nitrobenzene, 1-fluoro-4-nitro-benzene, unii-a2m2fh7xhh, p-fluoro nitrobenzene |
| PubChem CID | 9590 |
| IUPAC Name | 1-fluoro-4-nitrobenzene |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])F |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC119491000
|
Thermo Scientific Chemicals
119491000 |
100 g | Glass bottle |
Each for $119.97
|
|
||||
|
AC119495000
|
Thermo Scientific Chemicals
119495000 |
500 g | Glass bottle |
Each for $497.63
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 350-46-9 | |
| 141.1 | |
| WFQDTOYDVUWQMS-UHFFFAOYSA-N | |
| 9590 | |
| C1=CC(=CC=C1[N+](=O)[O-])F |
| C6H4FNO2 | |
| MFCD00007282 | |
| 4-fluoronitrobenzene, p-fluoronitrobenzene, p-nitrofluorobenzene, benzene, 1-fluoro-4-nitro, 4-nitrofluorobenzene, 1-nitro-4-fluorobenzene, 4-fluoro-1-nitrobenzene, 1-fluoro-4-nitro-benzene, unii-a2m2fh7xhh, p-fluoro nitrobenzene | |
| 1-fluoro-4-nitrobenzene |
Specifications
| 350-46-9 | |
| 100.0 | |
| Brown to Yellow | |
| 205°C | |
| Authentic | |
| Glass bottle | |
| 1.5302 to 1.5322 | |
| MFCD00007282 | |
| 05, 241 | |
| 4-fluoronitrobenzene, p-fluoronitrobenzene, p-nitrofluorobenzene, benzene, 1-fluoro-4-nitro, 4-nitrofluorobenzene, 1-nitro-4-fluorobenzene, 4-fluoro-1-nitrobenzene, 1-fluoro-4-nitro-benzene, unii-a2m2fh7xhh, p-fluoro nitrobenzene | |
| WFQDTOYDVUWQMS-UHFFFAOYSA-N | |
| 1-fluoro-4-nitrobenzene | |
| 9590 | |
| 99% | |
| 1-Fluoro-4-nitrobenzene, 99% |
| 98.5 | |
| 27°C | |
| 1.3300g/mL | |
| 83°C | |
| 98.5% min. (GC) | |
| C6H4FNO2 | |
| FC6H4NO2 | |
| 100 g | |
| 1.33 | |
| Solubility in water: insoluble. Other solubilities: soluble in alcohol,ether,xylene and acetone | |
| C1=CC(=CC=C1[N+](=O)[O-])F | |
| 141.1 | |
| 141.1 | |
| Liquid After Melting |
Safety and Handling
GHS H Statement
Harmful if swallowed.
Harmful in contact with skin.
Harmful if inhaled.
May cause damage to organs through prolonged or repeated exposure.
Causes skin irritation.
Causes serious eye irritation.
M
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
IF ON SKIN: Wash with plenty of soap and water.
IF SWALLOWED: Call a POISON CENTER or doctor/physician if you feel unwell.
Do not breathe dus
GHS Signal Word: Warning
EINECSNumber : 206-502-8
RTECSNumber : DA1400000
TSCA : TSCA
RUO – Research Use Only