Learn More
1-Fluoro-2-nitrobenzene, 99%
CAS: 1493-27-2 | C6H4FNO2 | 141.1 g/mol
Supplier: Thermo Scientific Chemicals 119480500
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| 1-Fluoro-2-nitrobenzene | |
| 98.5 | |
| -9°C to 6°C | |
| 1.3350g/mL | |
| 94°C | |
| 98.5% min. (GC) | |
| C6H4FNO2 | |
| FC6H4NO2 | |
| 50 mL | |
| 1.335 | |
| Solubility in water: immiscible | |
| C1=CC=C(C(=C1)[N+](=O)[O-])F | |
| 141.1 | |
| 141.1 | |
| Liquid |
| 1493-27-2 | |
| 100.0 | |
| Brown to Yellow | |
| 215°C | |
| Authentic | |
| Glass bottle | |
| 1.5307 to 1.5327 | |
| MFCD00007048 | |
| 05, 241 | |
| 2-fluoronitrobenzene, o-fluoronitrobenzene, o-nitrofluorobenzene, 2-nitrofluorobenzene, benzene, 1-fluoro-2-nitro, benzene, o-nitrofluoro, 2-fluoro-1-nitrobenzene, fluoronitrobenzene, 1-fluoro-2-nitro-benzene, benzene, fluoronitro | |
| PWKNBLFSJAVFAB-UHFFFAOYSA-N | |
| 1-fluoro-2-nitrobenzene | |
| 73895 | |
| 99% |
Chemical Identifiers
| 1493-27-2 | |
| 141.1 | |
| PWKNBLFSJAVFAB-UHFFFAOYSA-N | |
| 73895 | |
| C1=CC=C(C(=C1)[N+](=O)[O-])F |
| C6H4FNO2 | |
| MFCD00007048 | |
| 2-fluoronitrobenzene, o-fluoronitrobenzene, o-nitrofluorobenzene, 2-nitrofluorobenzene, benzene, 1-fluoro-2-nitro, benzene, o-nitrofluoro, 2-fluoro-1-nitrobenzene, fluoronitrobenzene, 1-fluoro-2-nitro-benzene, benzene, fluoronitro | |
| 1-fluoro-2-nitrobenzene |
Safety and Handling
GHS H Statement
Toxic if swallowed.
Fatal in contact with skin.
Causes serious eye irritation.
May cause damage to organs through prolonged or repeated exposure.
Causes skin irritation.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
IF ON SKIN: Wash with plenty of soap and water.
Immediately call a POISON CENTER or doctor/physician.
If skin irritation occurs: Get medical
GHS Signal Word: Danger
EINECSNumber : 216-088-
RUO – Research Use Only