Learn More
1-Chloro-4-nitrobenzene, 99%
CAS: 100-00-5 | C6H4ClNO2 | 157.56 g/mol
Supplier: Thermo Scientific Chemicals 109630010
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| 1-Chloro-4-nitrobenzene | |
| 100-00-5 | |
| 100.0 | |
| Yellow | |
| 242.0°C | |
| Authentic | |
| Plastic bottle | |
| ClC6H4NO2 | |
| 1 kg | |
| 1.298 | |
| 4-chloronitrobenzene, p-chloronitrobenzene, p-nitrochlorobenzene, benzene, 1-chloro-4-nitro, 4-nitrochlorobenzene, pncb, 4-chloro-1-nitrobenzene, p-nitrophenyl chloride, p-nitrochlorobenzol, p-nitroclorobenzene | |
| CZGCEKJOLUNIFY-UHFFFAOYSA-N | |
| 1-chloro-4-nitrobenzene | |
| 7474 | |
| 157.56 | |
| Crystals or Flakes |
| 99% | |
| 98.5 | |
| 81.0°C to 84.0°C | |
| 1.2980g/mL | |
| 127°C | |
| 98.5% min. (GC) | |
| C6H4ClNO2 | |
| MFCD00007285 | |
| 05, 243 | |
| 15, 2153 | |
| Solubility in water: insoluble.,soluble in organic solvents | |
| C1=CC(=CC=C1[N+](=O)[O-])Cl | |
| 157.56 | |
| CHEBI:34399 | |
| 99% |
Chemical Identifiers
| 100-00-5 | |
| 157.56 | |
| CZGCEKJOLUNIFY-UHFFFAOYSA-N | |
| 7474 | |
| 1-chloro-4-nitrobenzene |
| C6H4ClNO2 | |
| MFCD00007285 | |
| 4-chloronitrobenzene, p-chloronitrobenzene, p-nitrochlorobenzene, benzene, 1-chloro-4-nitro, 4-nitrochlorobenzene, pncb, 4-chloro-1-nitrobenzene, p-nitrophenyl chloride, p-nitrochlorobenzol, p-nitroclorobenzene | |
| CHEBI:34399 | |
| C1=CC(=CC=C1[N+](=O)[O-])Cl |
Safety and Handling
GHS H Statement
Suspected of causing cancer.
Suspected of causing genetic defects.
Toxic if swallowed.
Toxic in contact with skin.
Toxic if inhaled.
May cause damage to organs through prolonged or repeated exposure.<b
GHS P Statement
IF SWALLOWED: Immediately call a POISON CENTER or doctor/physician.
IF ON SKIN: Wash with plenty of soap and water.
IF INHALED: Remove to fresh air and keep at rest in a position comfortable for breathing.
Call a POI
GHS Signal Word: Danger
EINECSNumber : 202-809-6
RTECSNumber : CZ1050000
TSCA : TSCA
RUO – Research Use Only