missing translation for 'onlineSavingsMsg'
Learn More
Learn More
1-Chloro-4-nitrobenzene, 99%
CAS: 100-00-5 | C6H4ClNO2 | 157.56 g/mol
$53.57 - $176.87
Chemical Identifiers
| CAS | 100-00-5 |
|---|---|
| Molecular Formula | C6H4ClNO2 |
| Molecular Weight (g/mol) | 157.56 |
| MDL Number | MFCD00007285 |
| InChI Key | CZGCEKJOLUNIFY-UHFFFAOYSA-N |
| Synonym | 4-chloronitrobenzene, p-chloronitrobenzene, p-nitrochlorobenzene, benzene, 1-chloro-4-nitro, 4-nitrochlorobenzene, pncb, 4-chloro-1-nitrobenzene, p-nitrophenyl chloride, p-nitrochlorobenzol, p-nitroclorobenzene |
| PubChem CID | 7474 |
| ChEBI | CHEBI:34399 |
| IUPAC Name | 1-chloro-4-nitrobenzene |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])Cl |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC109631000
|
Thermo Scientific Chemicals
109631000 |
100 g | Plastic bottle |
Each for $53.57
|
|
||||
|
AC109630010
|
Thermo Scientific Chemicals
109630010 |
1 kg | Plastic bottle |
Each for $176.87
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 100-00-5 | |
| 157.56 | |
| CZGCEKJOLUNIFY-UHFFFAOYSA-N | |
| 7474 | |
| 1-chloro-4-nitrobenzene |
| C6H4ClNO2 | |
| MFCD00007285 | |
| 4-chloronitrobenzene, p-chloronitrobenzene, p-nitrochlorobenzene, benzene, 1-chloro-4-nitro, 4-nitrochlorobenzene, pncb, 4-chloro-1-nitrobenzene, p-nitrophenyl chloride, p-nitrochlorobenzol, p-nitroclorobenzene | |
| CHEBI:34399 | |
| C1=CC(=CC=C1[N+](=O)[O-])Cl |
Specifications
| 100-00-5 | |
| 100.0 | |
| Yellow | |
| 242.0°C | |
| Authentic | |
| Plastic bottle | |
| ClC6H4NO2 | |
| 100 g | |
| 1.298 | |
| 4-chloronitrobenzene, p-chloronitrobenzene, p-nitrochlorobenzene, benzene, 1-chloro-4-nitro, 4-nitrochlorobenzene, pncb, 4-chloro-1-nitrobenzene, p-nitrophenyl chloride, p-nitrochlorobenzol, p-nitroclorobenzene | |
| CZGCEKJOLUNIFY-UHFFFAOYSA-N | |
| 1-chloro-4-nitrobenzene | |
| 7474 | |
| 157.56 | |
| Crystals or Flakes |
| 98.5 | |
| 81.0°C to 84.0°C | |
| 1.2980g/mL | |
| 127°C | |
| 98.5% min. (GC) | |
| C6H4ClNO2 | |
| MFCD00007285 | |
| 05, 243 | |
| 15, 2153 | |
| Solubility in water: insoluble.,soluble in organic solvents | |
| C1=CC(=CC=C1[N+](=O)[O-])Cl | |
| 157.56 | |
| CHEBI:34399 | |
| 99% | |
| 1-Chloro-4-nitrobenzene, 99% |
Safety and Handling
GHS H Statement
Suspected of causing cancer.
Suspected of causing genetic defects.
Toxic if swallowed.
Toxic in contact with skin.
Toxic if inhaled.
May cause damage to organs through prolonged or repeated exposure.<b
GHS P Statement
IF SWALLOWED: Immediately call a POISON CENTER or doctor/physician.
IF ON SKIN: Wash with plenty of soap and water.
IF INHALED: Remove to fresh air and keep at rest in a position comfortable for breathing.
Call a POI
GHS Signal Word: Danger
EINECSNumber : 202-809-6
RTECSNumber : CZ1050000
TSCA : TSCA
RUO – Research Use Only