Learn More
1-Adamantanemethylamine, 98%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 177420010
| Quantity | 1g |
|---|---|
| Packaging | Glass bottle |
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Chemical Identifiers
| 17768-41-1 | |
| 166.29 | |
| XSOHXMFFSKTSIT-UHFFFAOYSA-O | |
| 86625 | |
| [NH3+]CC12CC3CC(CC(C3)C1)C2 |
| C11H20N | |
| MFCD00074750 | |
| 1-adamantanemethylamine, adamantan-1-ylmethanamine, 1-aminomethyl adamantane, 1-aminomethyladamantane, 1-aminomethyl-adamantane, 1-1-adamantyl methanamine, 1-adamantan-1-ylmethanamine, c-adamantan-1-yl-methylamine, 1-adamantanemethyl amine, tricyclo 3.3.1.13,7 dec-1-ylmethylamine | |
| 1-adamantylmethanamine |
Specifications
| 1-Adamantanemethylamine | |
| 97.5 | |
| 0.9300g/mL | |
| 92°C | |
| 98% | |
| C11H20N | |
| 1g | |
| 0.93 | |
| XSOHXMFFSKTSIT-UHFFFAOYSA-O | |
| 1-adamantylmethanamine | |
| 86625 | |
| 98% |
| 17768-41-1 | |
| 100.0 | |
| 83.0°C to 85.0°C (0.3mmHg) | |
| Authentic | |
| Glass bottle | |
| 1.5127 to 1.5147 | |
| MFCD00074750 | |
| 1-adamantanemethylamine, adamantan-1-ylmethanamine, 1-aminomethyl adamantane, 1-aminomethyladamantane, 1-aminomethyl-adamantane, 1-1-adamantyl methanamine, 1-adamantan-1-ylmethanamine, c-adamantan-1-yl-methylamine, 1-adamantanemethyl amine, tricyclo 3.3.1.13,7 dec-1-ylmethylamine | |
| [NH3+]CC12CC3CC(CC(C3)C1)C2 | |
| 166.29 | |
| 165.28 |
Safety and Handling
GHS H Statement
Causes severe skin burns and eye damage.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
IF SWALLOWED: Rinse mouth.
Do NOT induce vomiting.
IF ON SKIN (or hair): Take off immediately all contaminated clothing.
Rinse skin with wat
GHS Signal Word: Danger
EINECSNumber : 241-752-1