Learn More
1,4-Naphthoquinone, 99%, contains up to 6% water
CAS: 130-15-4 | C10H6O2 | 158.16 g/mol
$96.72 - $211.98
Chemical Identifiers
| CAS | 130-15-4 |
|---|---|
| Molecular Formula | C10H6O2 |
| Molecular Weight (g/mol) | 158.16 |
| MDL Number | MFCD00001676 |
| InChI Key | FRASJONUBLZVQX-UHFFFAOYSA-N |
| Synonym | 1,4-naphthoquinone, 1,4-naphthalenedione, p-naphthoquinone, naphthoquinone, alpha-naphthoquinone, 1,4-naphthylquinone, usaf cy-10, 1,4-dihydronaphthalene-1,4-dione, 1,4-dihydro-1,4-diketonaphthalene, 1,4-naftochinon |
| PubChem CID | 8530 |
| ChEBI | CHEBI:27418 |
| IUPAC Name | naphthalene-1,4-dione |
| SMILES | C1=CC=C2C(=O)C=CC(=O)C2=C1 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC166711000
|
Thermo Scientific Chemicals
166711000 |
100 g | Plastic bottle |
Each for $96.72
|
|
||||
|
AC166715000
|
Thermo Scientific Chemicals
166715000 |
500 g | Plastic bottle |
Each for $211.98
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 130-15-4 | |
| 158.16 | |
| FRASJONUBLZVQX-UHFFFAOYSA-N | |
| 8530 | |
| naphthalene-1,4-dione |
| C10H6O2 | |
| MFCD00001676 | |
| 1,4-naphthoquinone, 1,4-naphthalenedione, p-naphthoquinone, naphthoquinone, alpha-naphthoquinone, 1,4-naphthylquinone, usaf cy-10, 1,4-dihydronaphthalene-1,4-dione, 1,4-dihydro-1,4-diketonaphthalene, 1,4-naftochinon | |
| CHEBI:27418 | |
| C1=CC=C2C(=O)C=CC(=O)C2=C1 |
Specifications
| 130-15-4,7732-18-5 | |
| 100.0 | |
| Khaki | |
| Authentic | |
| Plastic bottle | |
| MFCD00001676 | |
| 07, 724 | |
| 15, 6480 | |
| Solubility in water: insoluble. Other solubilities: soluble in alkali hydroxide solutions,freely soluble in hot alcohol,ether,benzene,,chloroform,carbon bisulfide and acetic acid | |
| C1=CC=C2C(=O)C=CC(=O)C2=C1 | |
| 158.16 | |
| CHEBI:27418 | |
| 99% | |
| 1, 4-Naphthoquinone, 99% |
| 98.5 | |
| 128.5°C | |
| 141°C | |
| 99% | |
| C10H6O2 | |
| 100 g | |
| 01,714 | |
| 1,4-naphthoquinone, 1,4-naphthalenedione, p-naphthoquinone, naphthoquinone, alpha-naphthoquinone, 1,4-naphthylquinone, usaf cy-10, 1,4-dihydronaphthalene-1,4-dione, 1,4-dihydro-1,4-diketonaphthalene, 1,4-naftochinon | |
| FRASJONUBLZVQX-UHFFFAOYSA-N | |
| naphthalene-1,4-dione | |
| 8530 | |
| 158.16 | |
| Powder |
Safety and Handling
GHS H Statement
Fatal if inhaled.
May cause an allergic skin reaction.
Toxic in contact with skin.
Causes severe skin burns and eye damage.
Toxic if swallowed.
Very toxic to aquatic life.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
IF ON SKIN: Gently wash with plenty of soap and water.
IF INHALED: Remove victim to fresh air and keep at rest in a position comfortable for breat
GHS Signal Word: Danger
EINECSNumber : 204-977-6
RTECSNumber : QL7175000
TSCA : TSCA
RUO – Research Use Only