Learn More
1,3-Dioxolane, 99.8%, anhydrous, stabilized with 75 ppm BHT, AcroSeal™
CAS: 646-06-0 | C3H6O2 | 74.08 g/mol
$74.79 - $405.20
Chemical Identifiers
| CAS | 646-06-0 |
|---|---|
| Molecular Formula | C3H6O2 |
| Molecular Weight (g/mol) | 74.08 |
| InChI Key | WNXJIVFYUVYPPR-UHFFFAOYSA-N |
| Synonym | dioxolane, glycolformal, formal glycol, 1,3-dioxolan, 1,3-dioxacyclopentane, 1,3-dioxalane, ethylene glycol formal, glycol methylene ether, glycol formal, dioxolan czech |
| PubChem CID | 31404 |
| ChEBI | CHEBI:34247 |
| IUPAC Name | 2,6-ditert-butyl-4-methylphenol |
| SMILES | CC1=CC(=C(C(=C1)C(C)(C)C)O)C(C)(C)C |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC431561000
|
Thermo Scientific Chemicals
431561000 |
100 mL | AcroSeal™ Glass Bottle |
Each for $74.79
|
|
||||
|
AC431560010
|
Thermo Scientific Chemicals
431560010 |
1 L | AcroSeal™ Glass Bottle |
Each for $405.20
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Suitable for battery materials development.
Chemical Identifiers
| 646-06-0 | |
| 74.08 | |
| dioxolane, glycolformal, formal glycol, 1,3-dioxolan, 1,3-dioxacyclopentane, 1,3-dioxalane, ethylene glycol formal, glycol methylene ether, glycol formal, dioxolan czech | |
| CHEBI:34247 | |
| CC1=CC(=C(C(=C1)C(C)(C)C)O)C(C)(C)C |
| C3H6O2 | |
| WNXJIVFYUVYPPR-UHFFFAOYSA-N | |
| 31404 | |
| 2,6-ditert-butyl-4-methylphenol |
Specifications
| 646-06-0,128-37-0 | |
| 100.0 | |
| 1.0600g/mL | |
| −6°C | |
| Authentic | |
| AcroSeal™ Glass Bottle | |
| 1.3990 to 1.4010 | |
| 0.0005% max. | |
| dioxolane, glycolformal, formal glycol, 1,3-dioxolan, 1,3-dioxacyclopentane, 1,3-dioxalane, ethylene glycol formal, glycol methylene ether, glycol formal, dioxolan czech | |
| WNXJIVFYUVYPPR-UHFFFAOYSA-N | |
| 2,6-ditert-butyl-4-methylphenol | |
| 75ppm (BHT) | |
| 0.66 mPa.s (20°C) | |
| 74.08 | |
| Liquid |
| 99.75 | |
| -95°C | |
| 74.0°C to 75.0°C | |
| 0.0005% max | |
| 99.75% min. (GC) | |
| C3H6O2 | |
| 100 mL | |
| 1.06 | |
| Solubility in water: soluble. Other solubilities: soluble in alcohol,ether and acetone | |
| CC1=CC(=C(C(=C1)C(C)(C)C)O)C(C)(C)C | |
| 74.08 | |
| 31404 | |
| CHEBI:34247 | |
| 99.8% | |
| 1, 3-Dioxolane, Stabilized |
Safety and Handling
GHS H Statement
Highly flammable liquid and vapor.
Causes serious eye irritation.
GHS P Statement
Keep away from heat/sparks/open flames/hot surfaces.
- No smoking.
IF ON SKIN (or hair): Take off immediately all contaminated clothing.
Rinse skin with water/shower.
Wear eye protection/face protection.
Wash f
GHS Signal Word: Danger
EINECSNumber : 211-463-5
RUO – Research Use Only