missing translation for 'onlineSavingsMsg'
Learn More
Learn More
1,3,5-Triisopropylbenzene, 95%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 171221000
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| 1, 3, 5-Triisopropylbenzene | |
| 717-74-8 | |
| 100.0 | |
| 232°C to 236°C | |
| Authentic | |
| Glass bottle | |
| 1.4874 to 1.4894 | |
| MFCD00008890 | |
| 05, 458 | |
| 1,3,5-triisopropylbenzene, 2,4,6-triisopropylbenzene, benzene, 1,3,5-tris 1-methylethyl, 1,3,5-tris propan-2-yl benzene, unii-fr9y346wpb, benzene, 1,3,5-triisopropyl, fr9y346wpb, benzene, tris 1-methylethyl, pubchem13720, 1,5-triisopropylbenzene | |
| CC(C)C1=CC(=CC(=C1)C(C)C)C(C)C | |
| 204.35 | |
| 204.35 |
| 97% | |
| 94.0 | |
| 0.8400g/mL | |
| 86°C | |
| 94% min. (GC) | |
| C15H24 | |
| C6H3[CH(CH3)2]3 | |
| 100mL | |
| 0.84 | |
| VUMCUSHVMYIRMB-UHFFFAOYSA-N | |
| 1,3,5-tri(propan-2-yl)benzene | |
| 12860 | |
| 95% |
Chemical Identifiers
| 717-74-8 | |
| 204.35 | |
| VUMCUSHVMYIRMB-UHFFFAOYSA-N | |
| 12860 | |
| CC(C)C1=CC(=CC(=C1)C(C)C)C(C)C |
| C15H24 | |
| MFCD00008890 | |
| 1,3,5-triisopropylbenzene, 2,4,6-triisopropylbenzene, benzene, 1,3,5-tris 1-methylethyl, 1,3,5-tris propan-2-yl benzene, unii-fr9y346wpb, benzene, 1,3,5-triisopropyl, fr9y346wpb, benzene, tris 1-methylethyl, pubchem13720, 1,5-triisopropylbenzene | |
| 1,3,5-tri(propan-2-yl)benzene |
Safety and Handling
EINECSNumber : 211-941-3
TSCA : TSCA
RUO â Research Use Only