missing translation for 'onlineSavingsMsg'
Learn More
Learn More
1,1-Diphenylethylene (stabilized with HQ) 98.0+%, TCI America™
Supplier: TCI America D0886250G
Specifications
| 1,1-Diphenylethylene (stabilized with HQ) | |
| Yellow | |
| C14H12 | |
| 250 g | |
| ZMYIIHDQURVDRB-UHFFFAOYSA-N | |
| 1-phenylethenylbenzene | |
| 10740 | |
| ≥98.0% (GC) |
| 530-48-3 | |
| 277°C | |
| MFCD00008583 | |
| 1,1-diphenylethylene, ethene-1,1-diyldibenzene, 1,1-diphenylethene, benzene, 1,1'-ethenylidenebis, 1-phenylethenyl benzene, unii-bx0l5b6lll, as-diphenylethylene, .alpha.-phenylstyrene, 1-phenylvinyl benzene, bx0l5b6lll | |
| C=C(C1=CC=CC=C1)C2=CC=CC=C2 | |
| 180.25 | |
| 180.25 | |
| Liquid |
Chemical Identifiers
| 530-48-3 | |
| 180.25 | |
| ZMYIIHDQURVDRB-UHFFFAOYSA-N | |
| 10740 | |
| C=C(C1=CC=CC=C1)C2=CC=CC=C2 |
| C14H12 | |
| MFCD00008583 | |
| 1,1-diphenylethylene, ethene-1,1-diyldibenzene, 1,1-diphenylethene, benzene, 1,1'-ethenylidenebis, 1-phenylethenyl benzene, unii-bx0l5b6lll, as-diphenylethylene, .alpha.-phenylstyrene, 1-phenylvinyl benzene, bx0l5b6lll | |
| 1-phenylethenylbenzene |
Safety and Handling
TSCA : Yes
Recommended Storage : Refrigerator