Organometallic Compounds
Filtered Search Results
Silicon(IV) 2-ethylhexanoate, nominally 75% in ethanol
CAS: 67939-81-5 Molecular Formula: C32H60O8Si Molecular Weight (g/mol): 600.909 MDL Number: MFCD00269842 InChI Key: UNKOLEUDCQIVBV-UHFFFAOYSA-N Synonym: silicon 2-ethylhexanoate,tetrakis 2-ethylhexanoic acid, tetraanhydride with silicic acid,2-ethylhexanoic acid tetraanhydride with silicic acid h4sio4,hexanoic acid, 2-ethyl-, 1,1',1,1'-tetraanhydride with silicic acid h4sio4,hexanoic acid, 2-ethyl-, tetraanhydride with silicic acid h4sio4,silicon 2-ethylhexanoate, min. 90,tris 2-ethylhexanoyloxy silyl 2-ethylhexanoate,silicon iv 2-ethylhexanoate in ethanol,silicic acid tetrakis 2-ethylhexanoic tetraanhydride,silicon iv 2-ethylhexanoate, nominally in ethanol PubChem CID: 106984 IUPAC Name: tris(2-ethylhexanoyloxy)silyl 2-ethylhexanoate SMILES: CCCCC(CC)C(=O)O[Si](OC(=O)C(CC)CCCC)(OC(=O)C(CC)CCCC)OC(=O)C(CC)CCCC
| PubChem CID | 106984 |
|---|---|
| CAS | 67939-81-5 |
| Molecular Weight (g/mol) | 600.909 |
| MDL Number | MFCD00269842 |
| SMILES | CCCCC(CC)C(=O)O[Si](OC(=O)C(CC)CCCC)(OC(=O)C(CC)CCCC)OC(=O)C(CC)CCCC |
| Synonym | silicon 2-ethylhexanoate,tetrakis 2-ethylhexanoic acid, tetraanhydride with silicic acid,2-ethylhexanoic acid tetraanhydride with silicic acid h4sio4,hexanoic acid, 2-ethyl-, 1,1',1,1'-tetraanhydride with silicic acid h4sio4,hexanoic acid, 2-ethyl-, tetraanhydride with silicic acid h4sio4,silicon 2-ethylhexanoate, min. 90,tris 2-ethylhexanoyloxy silyl 2-ethylhexanoate,silicon iv 2-ethylhexanoate in ethanol,silicic acid tetrakis 2-ethylhexanoic tetraanhydride,silicon iv 2-ethylhexanoate, nominally in ethanol |
| IUPAC Name | tris(2-ethylhexanoyloxy)silyl 2-ethylhexanoate |
| InChI Key | UNKOLEUDCQIVBV-UHFFFAOYSA-N |
| Molecular Formula | C32H60O8Si |
Copper(II) oxalate hemihydrate, 98%
CAS: 5893-66-3 Molecular Formula: C4H8Cu2O10 Molecular Weight (g/mol): 343.19 MDL Number: MFCD00150451 InChI Key: NNZNHNMQOYUANB-UHFFFAOYSA-N Synonym: cupric oxalate,copper oxalate hemihydrate PubChem CID: 122130000 IUPAC Name: copper;oxalic acid;hydrate SMILES: O.O.[Cu].[Cu].OC(=O)C(O)=O.OC(=O)C(O)=O
| PubChem CID | 122130000 |
|---|---|
| CAS | 5893-66-3 |
| Molecular Weight (g/mol) | 343.19 |
| MDL Number | MFCD00150451 |
| SMILES | O.O.[Cu].[Cu].OC(=O)C(O)=O.OC(=O)C(O)=O |
| Synonym | cupric oxalate,copper oxalate hemihydrate |
| IUPAC Name | copper;oxalic acid;hydrate |
| InChI Key | NNZNHNMQOYUANB-UHFFFAOYSA-N |
| Molecular Formula | C4H8Cu2O10 |
| CAS | 1184-54-9 |
|---|---|
| MDL Number | MFCD00015611 |
Chlorophyllin, coppered trisodium salt
CAS: 11006-34-1 Molecular Formula: C34H31CuN4Na3O6 MDL Number: MFCD00012149
| CAS | 11006-34-1 |
|---|---|
| MDL Number | MFCD00012149 |
| Molecular Formula | C34H31CuN4Na3O6 |
Copper(II) methacrylate, tech.
CAS: 19662-59-0 Molecular Formula: C4H5CuO2 Molecular Weight (g/mol): 148.63 MDL Number: MFCD00080547,MFCD00156451,MFCD00080547 InChI Key: BFHDHRZKYIRNRP-UHFFFAOYSA-M PubChem CID: 121233728 IUPAC Name: copper;2-methylprop-2-enoic acid;hydrate SMILES: [Cu++].CC(=C)C([O-])=O
| PubChem CID | 121233728 |
|---|---|
| CAS | 19662-59-0 |
| Molecular Weight (g/mol) | 148.63 |
| MDL Number | MFCD00080547,MFCD00156451,MFCD00080547 |
| SMILES | [Cu++].CC(=C)C([O-])=O |
| IUPAC Name | copper;2-methylprop-2-enoic acid;hydrate |
| InChI Key | BFHDHRZKYIRNRP-UHFFFAOYSA-M |
| Molecular Formula | C4H5CuO2 |
Tricyclohexyltin chloride, 97%
CAS: 3091-32-5 Molecular Formula: C18H33ClSn Molecular Weight (g/mol): 403.622 MDL Number: MFCD00003817 InChI Key: OJVZYIKTLISAIH-UHFFFAOYSA-M Synonym: tricyclohexyltin chloride,stannane, chlorotricyclohexyl,chlorotricyclohexyltin,chloro tricyclohexyl stannane,tin, chlorotricyclohexyl,tricyclohexyltinchloride,acmc-1ck6z,tricyclohexylchlorotin PubChem CID: 76539 IUPAC Name: chloro(tricyclohexyl)stannane SMILES: C1CCC(CC1)[Sn](C2CCCCC2)(C3CCCCC3)Cl
| PubChem CID | 76539 |
|---|---|
| CAS | 3091-32-5 |
| Molecular Weight (g/mol) | 403.622 |
| MDL Number | MFCD00003817 |
| SMILES | C1CCC(CC1)[Sn](C2CCCCC2)(C3CCCCC3)Cl |
| Synonym | tricyclohexyltin chloride,stannane, chlorotricyclohexyl,chlorotricyclohexyltin,chloro tricyclohexyl stannane,tin, chlorotricyclohexyl,tricyclohexyltinchloride,acmc-1ck6z,tricyclohexylchlorotin |
| IUPAC Name | chloro(tricyclohexyl)stannane |
| InChI Key | OJVZYIKTLISAIH-UHFFFAOYSA-M |
| Molecular Formula | C18H33ClSn |
Tri-n-butyltin iodide, tech. 90%, stab. with copper, Thermo Scientific™
CAS: 7342-47-4 Molecular Formula: C12H27ISn Molecular Weight (g/mol): 416.962 MDL Number: MFCD00074996 InChI Key: YHHVXVNXTMIXOL-UHFFFAOYSA-M Synonym: tributyltin iodide,iodotributylstannane,stannane, iodotributyl,iodotributyltin,stannane, tributyliodo,tri-n-butyl tin iodide,tin, tri-n-butyl-, iodide,bu3sni,tri-n-butyltin iodide,tributyl iodo stannane PubChem CID: 23765 IUPAC Name: tributyl(iodo)stannane SMILES: CCCC[Sn](CCCC)(CCCC)I
| PubChem CID | 23765 |
|---|---|
| CAS | 7342-47-4 |
| Molecular Weight (g/mol) | 416.962 |
| MDL Number | MFCD00074996 |
| SMILES | CCCC[Sn](CCCC)(CCCC)I |
| Synonym | tributyltin iodide,iodotributylstannane,stannane, iodotributyl,iodotributyltin,stannane, tributyliodo,tri-n-butyl tin iodide,tin, tri-n-butyl-, iodide,bu3sni,tri-n-butyltin iodide,tributyl iodo stannane |
| IUPAC Name | tributyl(iodo)stannane |
| InChI Key | YHHVXVNXTMIXOL-UHFFFAOYSA-M |
| Molecular Formula | C12H27ISn |
Diethylgermanium dichloride
CAS: 13314-52-8 Molecular Formula: C4H14Cl2Ge Molecular Weight (g/mol): 205.69 MDL Number: MFCD00013589 InChI Key: FVUWAWRMMUJVGO-UHFFFAOYSA-N Synonym: diethylgermanium dichloride,diethyldichlorogermane,diethyldichlorogermanium,dichloro diethyl germane,germane,dichlorodiethyl,acmc-1c1bs,diethylgermanium chloride,dichlorodiethylgermane PubChem CID: 83334 IUPAC Name: dichloro(diethyl)germane SMILES: Cl.Cl.CC[GeH2]CC
| PubChem CID | 83334 |
|---|---|
| CAS | 13314-52-8 |
| Molecular Weight (g/mol) | 205.69 |
| MDL Number | MFCD00013589 |
| SMILES | Cl.Cl.CC[GeH2]CC |
| Synonym | diethylgermanium dichloride,diethyldichlorogermane,diethyldichlorogermanium,dichloro diethyl germane,germane,dichlorodiethyl,acmc-1c1bs,diethylgermanium chloride,dichlorodiethylgermane |
| IUPAC Name | dichloro(diethyl)germane |
| InChI Key | FVUWAWRMMUJVGO-UHFFFAOYSA-N |
| Molecular Formula | C4H14Cl2Ge |
n-Butyltin trichloride, 96%
CAS: 1118-46-3 Molecular Formula: C4H9Cl3Sn Molecular Weight (g/mol): 282.176 MDL Number: MFCD00000515 InChI Key: YMLFYGFCXGNERH-UHFFFAOYSA-K Synonym: butyltin trichloride,stannane, butyltrichloro,monobutyltin trichloride,butyltrichlorotin,trichlorobutyltin,butyl trichloro stannane,n-butyltin trichloride,trichlorobutylstannane,stannane, trichlorobutyl,monotributyltin trichloride PubChem CID: 14236 IUPAC Name: butyl(trichloro)stannane SMILES: CCCC[Sn](Cl)(Cl)Cl
| PubChem CID | 14236 |
|---|---|
| CAS | 1118-46-3 |
| Molecular Weight (g/mol) | 282.176 |
| MDL Number | MFCD00000515 |
| SMILES | CCCC[Sn](Cl)(Cl)Cl |
| Synonym | butyltin trichloride,stannane, butyltrichloro,monobutyltin trichloride,butyltrichlorotin,trichlorobutyltin,butyl trichloro stannane,n-butyltin trichloride,trichlorobutylstannane,stannane, trichlorobutyl,monotributyltin trichloride |
| IUPAC Name | butyl(trichloro)stannane |
| InChI Key | YMLFYGFCXGNERH-UHFFFAOYSA-K |
| Molecular Formula | C4H9Cl3Sn |
Ethylaluminium dichloride, 1.8M solution in toluene, AcroSeal™
CAS: 563-43-9 Molecular Formula: C2H5AlCl2 Molecular Weight (g/mol): 126.94 MDL Number: MFCD00000457 InChI Key: UAIZDWNSWGTKFZ-UHFFFAOYSA-L Synonym: ethylaluminum dichloride,aluminum, dichloroethyl,dichloroethylaluminum,ethyldichloroaluminum,dichloromonoethylaluminum,ethylaluminium dichloride,dichloro ethyl alumane,ethyl aluminum dichloride,hsdb 317,dichloro ethyl aluminum IUPAC Name: dichloro(ethyl)alumane SMILES: CC[Al](Cl)Cl
| CAS | 563-43-9 |
|---|---|
| Molecular Weight (g/mol) | 126.94 |
| MDL Number | MFCD00000457 |
| SMILES | CC[Al](Cl)Cl |
| Synonym | ethylaluminum dichloride,aluminum, dichloroethyl,dichloroethylaluminum,ethyldichloroaluminum,dichloromonoethylaluminum,ethylaluminium dichloride,dichloro ethyl alumane,ethyl aluminum dichloride,hsdb 317,dichloro ethyl aluminum |
| IUPAC Name | dichloro(ethyl)alumane |
| InChI Key | UAIZDWNSWGTKFZ-UHFFFAOYSA-L |
| Molecular Formula | C2H5AlCl2 |
Tri-n-butyltin chloride, 95%, tech.
CAS: 1461-22-9 Molecular Formula: C12H27ClSn Molecular Weight (g/mol): 325.48 MDL Number: MFCD00000521 InChI Key: GCTFWCDSFPMHHS-UHFFFAOYSA-M Synonym: tributyltin chloride,chlorotributyltin,tri-n-butyltin chloride,tributylchlorotin,stannane, tributylchloro,chlorotri-n-butyltin,tri-n-butylchlorotin,tributyl chloro stannane,chlorotributylstannane,tributylstannyl chloride PubChem CID: 15096 ChEBI: CHEBI:79734 IUPAC Name: tributyl(chloro)stannane SMILES: CCCC[Sn](CCCC)(CCCC)Cl
| PubChem CID | 15096 |
|---|---|
| CAS | 1461-22-9 |
| Molecular Weight (g/mol) | 325.48 |
| ChEBI | CHEBI:79734 |
| MDL Number | MFCD00000521 |
| SMILES | CCCC[Sn](CCCC)(CCCC)Cl |
| Synonym | tributyltin chloride,chlorotributyltin,tri-n-butyltin chloride,tributylchlorotin,stannane, tributylchloro,chlorotri-n-butyltin,tri-n-butylchlorotin,tributyl chloro stannane,chlorotributylstannane,tributylstannyl chloride |
| IUPAC Name | tributyl(chloro)stannane |
| InChI Key | GCTFWCDSFPMHHS-UHFFFAOYSA-M |
| Molecular Formula | C12H27ClSn |
Methylgermanium trichloride, 97%
CAS: 993-10-2 Molecular Formula: CH9Cl3Ge Molecular Weight (g/mol): 200.06 MDL Number: MFCD00013585 InChI Key: NNMJXXWNUALEKD-UHFFFAOYSA-N Synonym: methyltrichlorogermane,trichloro methyl germane,methylgermanium trichloride,germanium methyl trichloride,germane, trichloromethyl,fefxfmqvsdtspa-uhfffaoysa,inchi=1/ch3cl3ge/c1-5 2,3 4/h1h3 PubChem CID: 70436 IUPAC Name: trichloro(methyl)germane SMILES: Cl.Cl.Cl.C[GeH3]
| PubChem CID | 70436 |
|---|---|
| CAS | 993-10-2 |
| Molecular Weight (g/mol) | 200.06 |
| MDL Number | MFCD00013585 |
| SMILES | Cl.Cl.Cl.C[GeH3] |
| Synonym | methyltrichlorogermane,trichloro methyl germane,methylgermanium trichloride,germanium methyl trichloride,germane, trichloromethyl,fefxfmqvsdtspa-uhfffaoysa,inchi=1/ch3cl3ge/c1-5 2,3 4/h1h3 |
| IUPAC Name | trichloro(methyl)germane |
| InChI Key | NNMJXXWNUALEKD-UHFFFAOYSA-N |
| Molecular Formula | CH9Cl3Ge |
Trimethyltin chloride, 99%
CAS: 1066-45-1 Molecular Formula: C3H11ClSn Molecular Weight (g/mol): 201.28 MDL Number: MFCD00000520 InChI Key: FVFGWISLDLUGHX-UHFFFAOYSA-N Synonym: trimethyltin chloride,stannane, chlorotrimethyl,chlorotrimethyltin,trimethylchlorotin,trimethylstannyl chloride,trimethylchlorostannane,chloro trimethyl stannane,m&t chemicals 1222-45,stannylium, trimethyl-, chloride,trimethyltinchloride PubChem CID: 14016 IUPAC Name: chloro(trimethyl)stannane SMILES: Cl.C[SnH](C)C
| PubChem CID | 14016 |
|---|---|
| CAS | 1066-45-1 |
| Molecular Weight (g/mol) | 201.28 |
| MDL Number | MFCD00000520 |
| SMILES | Cl.C[SnH](C)C |
| Synonym | trimethyltin chloride,stannane, chlorotrimethyl,chlorotrimethyltin,trimethylchlorotin,trimethylstannyl chloride,trimethylchlorostannane,chloro trimethyl stannane,m&t chemicals 1222-45,stannylium, trimethyl-, chloride,trimethyltinchloride |
| IUPAC Name | chloro(trimethyl)stannane |
| InChI Key | FVFGWISLDLUGHX-UHFFFAOYSA-N |
| Molecular Formula | C3H11ClSn |
Ethylaluminium sesquichloride, 0.4M solution in hexane, AcroSeal™
CAS: 12075-68-2 Molecular Formula: C6H15Al2Cl3 Molecular Weight (g/mol): 247.51 MDL Number: MFCD00044852 InChI Key: LDXMUMPEDOQULK-UHFFFAOYSA-K Synonym: ethylaluminum sesquichloride,ethylaluminium sesquichloride,sesquiethylaluminum chloride,easc,aluminum, trichlorotriethyldi,ethylaluminum sesquichioride,ethylaluminum sesquichloride solution,di-,i-chlorochlorotriethyldi-aluminum,chloro diethyl alumane; dichloro ethyl alumane PubChem CID: 25508 IUPAC Name: chloro(diethyl)alumane;dichloro(ethyl)alumane SMILES: CC[Al](CC)Cl.CC[Al](Cl)Cl
| PubChem CID | 25508 |
|---|---|
| CAS | 12075-68-2 |
| Molecular Weight (g/mol) | 247.51 |
| MDL Number | MFCD00044852 |
| SMILES | CC[Al](CC)Cl.CC[Al](Cl)Cl |
| Synonym | ethylaluminum sesquichloride,ethylaluminium sesquichloride,sesquiethylaluminum chloride,easc,aluminum, trichlorotriethyldi,ethylaluminum sesquichioride,ethylaluminum sesquichloride solution,di-,i-chlorochlorotriethyldi-aluminum,chloro diethyl alumane; dichloro ethyl alumane |
| IUPAC Name | chloro(diethyl)alumane;dichloro(ethyl)alumane |
| InChI Key | LDXMUMPEDOQULK-UHFFFAOYSA-K |
| Molecular Formula | C6H15Al2Cl3 |
Trimethyltin bromide, Thermo Scientific™
CAS: 1066-44-0 Molecular Formula: C3H11BrSn Molecular Weight (g/mol): 245.74 MDL Number: MFCD00000051 InChI Key: KNPKGRQZYPSMBF-UHFFFAOYSA-N Synonym: trimethyltin bromide,bromotrimethyltin,stannane, bromotrimethyl,trimethylstannyl bromide,trimethyltin bromide 6ci,me3snbr,tin, bromotrimethyl,acmc-20ajcw,bromo trimethyl stannane,ch3 3snbr PubChem CID: 14015 IUPAC Name: bromo(trimethyl)stannane SMILES: Br.C[SnH](C)C
| PubChem CID | 14015 |
|---|---|
| CAS | 1066-44-0 |
| Molecular Weight (g/mol) | 245.74 |
| MDL Number | MFCD00000051 |
| SMILES | Br.C[SnH](C)C |
| Synonym | trimethyltin bromide,bromotrimethyltin,stannane, bromotrimethyl,trimethylstannyl bromide,trimethyltin bromide 6ci,me3snbr,tin, bromotrimethyl,acmc-20ajcw,bromo trimethyl stannane,ch3 3snbr |
| IUPAC Name | bromo(trimethyl)stannane |
| InChI Key | KNPKGRQZYPSMBF-UHFFFAOYSA-N |
| Molecular Formula | C3H11BrSn |