Boronic acid derivatives
- (9)
- (2)
- (1)
- (1)
- (8)
- (5)
- (3)
- (1)
- (278)
- (5)
- (4)
- (1)
- (11)
- (48)
- (2)
- (30)
- (2)
- (3)
- (2)
- (11)
- (4)
- (4)
- (4)
- (1)
- (4)
- (193)
- (2)
- (1)
- (53)
- (18)
- (17)
- (1)
- (2)
- (3)
- (2)
- (4)
- (4)
- (3)
- (2)
Filtered Search Results
3-[2-(Dimethylamino)ethylcarbamoyl]benzeneboronic acid, 96%, Thermo Scientific Chemicals
CAS: 850567-31-6 Molecular Formula: C11H17BN2O3 Molecular Weight (g/mol): 236.078 MDL Number: MFCD04115706 InChI Key: WGZQGJKHTBTXLD-UHFFFAOYSA-N Synonym: 3-2-dimethylamino ethylcarbamoyl phenylboronic acid,3-2-dimethylamino ethyl carbamoyl phenyl boronic acid,3-2-dimethylaminoethylaminocarbonyl benzeneboronic acid,3-2-dimethylamino ethyl carbamoyl phenylboronic acid,acmc-209q0i,3-2-dimethylamino ethyl carbamoyl-phenyl boronic acid,3-2-dimethylamino ethyl carbamoyl phenyl boronicacid,3-2-n,n-dimethylaminoethylaminocarbonyl benzene boronic acid PubChem CID: 44119531 IUPAC Name: [3-[2-(dimethylamino)ethylcarbamoyl]phenyl]boronic acid SMILES: B(C1=CC(=CC=C1)C(=O)NCCN(C)C)(O)O
| PubChem CID | 44119531 |
|---|---|
| CAS | 850567-31-6 |
| Molecular Weight (g/mol) | 236.078 |
| MDL Number | MFCD04115706 |
| SMILES | B(C1=CC(=CC=C1)C(=O)NCCN(C)C)(O)O |
| Synonym | 3-2-dimethylamino ethylcarbamoyl phenylboronic acid,3-2-dimethylamino ethyl carbamoyl phenyl boronic acid,3-2-dimethylaminoethylaminocarbonyl benzeneboronic acid,3-2-dimethylamino ethyl carbamoyl phenylboronic acid,acmc-209q0i,3-2-dimethylamino ethyl carbamoyl-phenyl boronic acid,3-2-dimethylamino ethyl carbamoyl phenyl boronicacid,3-2-n,n-dimethylaminoethylaminocarbonyl benzene boronic acid |
| IUPAC Name | [3-[2-(dimethylamino)ethylcarbamoyl]phenyl]boronic acid |
| InChI Key | WGZQGJKHTBTXLD-UHFFFAOYSA-N |
| Molecular Formula | C11H17BN2O3 |
3-(2-Methoxycarbonylethyl)benzeneboronic acid, 97%
CAS: 833472-82-5 Molecular Formula: C10H13BO4 Molecular Weight (g/mol): 208.02 MDL Number: MFCD04115648 InChI Key: IPXZIWCEVNDHFD-UHFFFAOYSA-N Synonym: 3-2-methoxycarbonylethyl phenylboronic acid,methyl 3-3-boronophenyl propionate,3-3-methoxy-3-oxopropyl phenyl boronic acid,3-3-methoxy-3-oxopropyl phenylboronic acid,3-2-methoxycarbonylethyl phenyl boronic acid,acmc-209prx,benzenepropanoic acid,3-borono-, 1-methyl ester PubChem CID: 4993880 IUPAC Name: [3-(3-methoxy-3-oxopropyl)phenyl]boronic acid SMILES: COC(=O)CCC1=CC=CC(=C1)B(O)O
| PubChem CID | 4993880 |
|---|---|
| CAS | 833472-82-5 |
| Molecular Weight (g/mol) | 208.02 |
| MDL Number | MFCD04115648 |
| SMILES | COC(=O)CCC1=CC=CC(=C1)B(O)O |
| Synonym | 3-2-methoxycarbonylethyl phenylboronic acid,methyl 3-3-boronophenyl propionate,3-3-methoxy-3-oxopropyl phenyl boronic acid,3-3-methoxy-3-oxopropyl phenylboronic acid,3-2-methoxycarbonylethyl phenyl boronic acid,acmc-209prx,benzenepropanoic acid,3-borono-, 1-methyl ester |
| IUPAC Name | [3-(3-methoxy-3-oxopropyl)phenyl]boronic acid |
| InChI Key | IPXZIWCEVNDHFD-UHFFFAOYSA-N |
| Molecular Formula | C10H13BO4 |
3-Aminobenzeneboronic acid hemisulfate, 98+%
CAS: 66472-86-4 Molecular Formula: C12H18B2N2O8S Molecular Weight (g/mol): 371.96 MDL Number: MFCD00013111 InChI Key: UKTAURVTSWDIQR-UHFFFAOYSA-N Synonym: 3-aminophenyl boronic acid sulfate 2:1,3-aminobenzeneboronic acid hemisulfate salt,3-aminophenylboronic acid hemisulfate,3-aminobenzeneboronic acid hemisulfate,3-aminophenylboronic acid hemisulphate,4-aminophenylboronic acid hemisulfate,m-aminophenyl boronic acid, hemisulphate,boronic acid, 3-aminophenyl-, sulfate 2:1,3-aminophenyl boronic acid; sulfuric acid,bis m-aminophenylboronic acid ; sulfuric acid PubChem CID: 16211139 IUPAC Name: (3-aminophenyl)boronic acid;sulfuric acid SMILES: OS(O)(=O)=O.NC1=CC=CC(=C1)B(O)O.NC1=CC=CC(=C1)B(O)O
| PubChem CID | 16211139 |
|---|---|
| CAS | 66472-86-4 |
| Molecular Weight (g/mol) | 371.96 |
| MDL Number | MFCD00013111 |
| SMILES | OS(O)(=O)=O.NC1=CC=CC(=C1)B(O)O.NC1=CC=CC(=C1)B(O)O |
| Synonym | 3-aminophenyl boronic acid sulfate 2:1,3-aminobenzeneboronic acid hemisulfate salt,3-aminophenylboronic acid hemisulfate,3-aminobenzeneboronic acid hemisulfate,3-aminophenylboronic acid hemisulphate,4-aminophenylboronic acid hemisulfate,m-aminophenyl boronic acid, hemisulphate,boronic acid, 3-aminophenyl-, sulfate 2:1,3-aminophenyl boronic acid; sulfuric acid,bis m-aminophenylboronic acid ; sulfuric acid |
| IUPAC Name | (3-aminophenyl)boronic acid;sulfuric acid |
| InChI Key | UKTAURVTSWDIQR-UHFFFAOYSA-N |
| Molecular Formula | C12H18B2N2O8S |
3-Cyanobenzeneboronic acid, 98%
CAS: 150255-96-2 Molecular Formula: C7H6BNO2 Molecular Weight (g/mol): 146.94 MDL Number: MFCD01318967 InChI Key: XDBHWPLGGBLUHH-UHFFFAOYSA-N Synonym: 3-cyanophenyl boronic acid,3-cyanobenzeneboronic acid,3-boronobenzonitrile,3-dihydroxyboranyl benzonitrile,3-cyanobenzene boronic acid,3-cyano-phenyl-boronic acid,boronic acid, 3-cyanophenyl,pubchem1804,phenylboronic acid, 4 PubChem CID: 2734325 IUPAC Name: (3-cyanophenyl)boronic acid SMILES: OB(O)C1=CC=CC(=C1)C#N
| PubChem CID | 2734325 |
|---|---|
| CAS | 150255-96-2 |
| Molecular Weight (g/mol) | 146.94 |
| MDL Number | MFCD01318967 |
| SMILES | OB(O)C1=CC=CC(=C1)C#N |
| Synonym | 3-cyanophenyl boronic acid,3-cyanobenzeneboronic acid,3-boronobenzonitrile,3-dihydroxyboranyl benzonitrile,3-cyanobenzene boronic acid,3-cyano-phenyl-boronic acid,boronic acid, 3-cyanophenyl,pubchem1804,phenylboronic acid, 4 |
| IUPAC Name | (3-cyanophenyl)boronic acid |
| InChI Key | XDBHWPLGGBLUHH-UHFFFAOYSA-N |
| Molecular Formula | C7H6BNO2 |
Pyridine-2-boronic acid dimethyl ester, 95%, Thermo Scientific™
CAS: 136805-54-4 Molecular Formula: C7H10BNO2 Molecular Weight (g/mol): 150.972 MDL Number: MFCD03412109 InChI Key: ITSIDKYMJQVPQQ-UHFFFAOYSA-N Synonym: dimethyl pyridin-2-ylboronate,pyridine-2-boronic acid dimethyl ester,dimethyl pyridineboronate,pyridine-2-boronic acid, dimethyl ester,dimethoxy pyridin-2-yl borane,2-pyridylboronic acid, dimethyl ester,2-pyridineboronic acid dimethyl ester,akos brn-0425,2-dimethoxyboryl pyridine,acmc-209ca1 PubChem CID: 2763164 IUPAC Name: dimethoxy(pyridin-2-yl)borane SMILES: B(C1=CC=CC=N1)(OC)OC
| PubChem CID | 2763164 |
|---|---|
| CAS | 136805-54-4 |
| Molecular Weight (g/mol) | 150.972 |
| MDL Number | MFCD03412109 |
| SMILES | B(C1=CC=CC=N1)(OC)OC |
| Synonym | dimethyl pyridin-2-ylboronate,pyridine-2-boronic acid dimethyl ester,dimethyl pyridineboronate,pyridine-2-boronic acid, dimethyl ester,dimethoxy pyridin-2-yl borane,2-pyridylboronic acid, dimethyl ester,2-pyridineboronic acid dimethyl ester,akos brn-0425,2-dimethoxyboryl pyridine,acmc-209ca1 |
| IUPAC Name | dimethoxy(pyridin-2-yl)borane |
| InChI Key | ITSIDKYMJQVPQQ-UHFFFAOYSA-N |
| Molecular Formula | C7H10BNO2 |
3,5-Dimethylisoxazole-4-boronic acid pinacol ester, 97%
CAS: 832114-00-8 Molecular Formula: C11H18BNO3 Molecular Weight (g/mol): 223.079 MDL Number: MFCD05863910 InChI Key: CVLHETBAROWASE-UHFFFAOYSA-N Synonym: 3,5-dimethyl-4-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl isoxazole,3,5-dimethylisoxazole-4-boronic acid pinacol ester,3,5-dimethyl-4-4,4,5,5-tetramethyl-1,3,2-dioxaborolane-2-yl isoxazole,3,5-dimethylisoxazole-4-boronic acid, pinacol ester,3,5-dimethyl-4-tetramethyl-1,3,2-dioxaborolan-2-yl-1,2-oxazole,3,5-dimethyl-4-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl-1,2-oxazole,3,5-dimethyl-4-isoxazolyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane,2-3,5-dimethylisoxazol-4-yl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane,pubchem18439,acmc-209prk PubChem CID: 2758656 IUPAC Name: 3,5-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-oxazole SMILES: B1(OC(C(O1)(C)C)(C)C)C2=C(ON=C2C)C
| PubChem CID | 2758656 |
|---|---|
| CAS | 832114-00-8 |
| Molecular Weight (g/mol) | 223.079 |
| MDL Number | MFCD05863910 |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(ON=C2C)C |
| Synonym | 3,5-dimethyl-4-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl isoxazole,3,5-dimethylisoxazole-4-boronic acid pinacol ester,3,5-dimethyl-4-4,4,5,5-tetramethyl-1,3,2-dioxaborolane-2-yl isoxazole,3,5-dimethylisoxazole-4-boronic acid, pinacol ester,3,5-dimethyl-4-tetramethyl-1,3,2-dioxaborolan-2-yl-1,2-oxazole,3,5-dimethyl-4-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl-1,2-oxazole,3,5-dimethyl-4-isoxazolyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane,2-3,5-dimethylisoxazol-4-yl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane,pubchem18439,acmc-209prk |
| IUPAC Name | 3,5-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-oxazole |
| InChI Key | CVLHETBAROWASE-UHFFFAOYSA-N |
| Molecular Formula | C11H18BNO3 |
1-Naphthaleneboronic acid, 97%
CAS: 13922-41-3 Molecular Formula: C10H9BO2 Molecular Weight (g/mol): 171.99 MDL Number: MFCD00019722 InChI Key: HUMMCEUVDBVXTQ-UHFFFAOYSA-N Synonym: 1-naphthaleneboronic acid,1-naphthylboronic acid,naphthalene-1-boronic acid,naphthalenyl-1-boronic acid,1-naphthalene boronic acid,1-naphthaleneboronicacid,1-naphthyleneboronic acid,boronic acid, naphthalenyl,1-borononaphthalene,naphthylboronic acid PubChem CID: 254532 IUPAC Name: naphthalen-1-ylboronic acid SMILES: OB(O)C1=CC=CC2=CC=CC=C12
| PubChem CID | 254532 |
|---|---|
| CAS | 13922-41-3 |
| Molecular Weight (g/mol) | 171.99 |
| MDL Number | MFCD00019722 |
| SMILES | OB(O)C1=CC=CC2=CC=CC=C12 |
| Synonym | 1-naphthaleneboronic acid,1-naphthylboronic acid,naphthalene-1-boronic acid,naphthalenyl-1-boronic acid,1-naphthalene boronic acid,1-naphthaleneboronicacid,1-naphthyleneboronic acid,boronic acid, naphthalenyl,1-borononaphthalene,naphthylboronic acid |
| IUPAC Name | naphthalen-1-ylboronic acid |
| InChI Key | HUMMCEUVDBVXTQ-UHFFFAOYSA-N |
| Molecular Formula | C10H9BO2 |
5-Chloropyridine-2-boronic acid, 95%
CAS: 652148-91-9 Molecular Formula: C5H5BClNO2 Molecular Weight (g/mol): 157.36 MDL Number: MFCD07368862 InChI Key: JEGHCYRKSUGHJH-UHFFFAOYSA-N Synonym: 5-chloro-2-pyridineboronic acid,5-chloropyridine-2-boronic acid,5-chloropyridin-2-yl boronic acid,2-borono-5-chloropyridine,5-chloropyridine-2-boronicacid,3-chloropyridine-6-boronic acid,5-chloro-2-pyridyl boronic acid,boronic acid, 5-chloro-2-pyridinyl,pubchem13568,acmc-209npx PubChem CID: 22832086 IUPAC Name: (5-chloropyridin-2-yl)boronic acid SMILES: B(C1=NC=C(C=C1)Cl)(O)O
| PubChem CID | 22832086 |
|---|---|
| CAS | 652148-91-9 |
| Molecular Weight (g/mol) | 157.36 |
| MDL Number | MFCD07368862 |
| SMILES | B(C1=NC=C(C=C1)Cl)(O)O |
| Synonym | 5-chloro-2-pyridineboronic acid,5-chloropyridine-2-boronic acid,5-chloropyridin-2-yl boronic acid,2-borono-5-chloropyridine,5-chloropyridine-2-boronicacid,3-chloropyridine-6-boronic acid,5-chloro-2-pyridyl boronic acid,boronic acid, 5-chloro-2-pyridinyl,pubchem13568,acmc-209npx |
| IUPAC Name | (5-chloropyridin-2-yl)boronic acid |
| InChI Key | JEGHCYRKSUGHJH-UHFFFAOYSA-N |
| Molecular Formula | C5H5BClNO2 |
3,4-Dimethoxybenzeneboronic acid, 98%
CAS: 122775-35-3 Molecular Formula: C8H11BO4 Molecular Weight (g/mol): 181.98 MDL Number: MFCD01074574 InChI Key: RCVDPBFUMYUKPB-UHFFFAOYSA-N Synonym: 3,4-dimethoxyphenyl boronic acid,3,4-dimethoxybenzeneboronic acid,3,4-dimethoxyphenyl boranediol,3,4-dimethoxybenzene boronic acid,boronic acid, 3,4-dimethoxyphenyl,3,4-dimethoxyphenylboronicacid,3, 4-dimethoxyphenylboronic acid,pubchem1826,acmc-209amm,ksc174q5t PubChem CID: 2734702 IUPAC Name: (3,4-dimethoxyphenyl)boronic acid SMILES: COC1=CC=C(C=C1OC)B(O)O
| PubChem CID | 2734702 |
|---|---|
| CAS | 122775-35-3 |
| Molecular Weight (g/mol) | 181.98 |
| MDL Number | MFCD01074574 |
| SMILES | COC1=CC=C(C=C1OC)B(O)O |
| Synonym | 3,4-dimethoxyphenyl boronic acid,3,4-dimethoxybenzeneboronic acid,3,4-dimethoxyphenyl boranediol,3,4-dimethoxybenzene boronic acid,boronic acid, 3,4-dimethoxyphenyl,3,4-dimethoxyphenylboronicacid,3, 4-dimethoxyphenylboronic acid,pubchem1826,acmc-209amm,ksc174q5t |
| IUPAC Name | (3,4-dimethoxyphenyl)boronic acid |
| InChI Key | RCVDPBFUMYUKPB-UHFFFAOYSA-N |
| Molecular Formula | C8H11BO4 |
2,5-Dichlorobenzeneboronic acid, 98%
CAS: 135145-90-3 Molecular Formula: C6H5BCl2O2 Molecular Weight (g/mol): 190.814 MDL Number: MFCD01863182 InChI Key: NNTFPBXQPOQRBT-UHFFFAOYSA-N Synonym: 2,5-dichlorobenzeneboronic acid,2,5-dichlorophenyl boronic acid,2,5-dichlorophenylboronicacid,2,5-dichlorophenyl boranediol,boronic acid, 2,5-dichlorophenyl,pubchem1811,acmc-209bxy,ksc174k3h,2,5-dichloro-phenylboronic acid PubChem CID: 2773371 IUPAC Name: (2,5-dichlorophenyl)boronic acid SMILES: B(C1=C(C=CC(=C1)Cl)Cl)(O)O
| PubChem CID | 2773371 |
|---|---|
| CAS | 135145-90-3 |
| Molecular Weight (g/mol) | 190.814 |
| MDL Number | MFCD01863182 |
| SMILES | B(C1=C(C=CC(=C1)Cl)Cl)(O)O |
| Synonym | 2,5-dichlorobenzeneboronic acid,2,5-dichlorophenyl boronic acid,2,5-dichlorophenylboronicacid,2,5-dichlorophenyl boranediol,boronic acid, 2,5-dichlorophenyl,pubchem1811,acmc-209bxy,ksc174k3h,2,5-dichloro-phenylboronic acid |
| IUPAC Name | (2,5-dichlorophenyl)boronic acid |
| InChI Key | NNTFPBXQPOQRBT-UHFFFAOYSA-N |
| Molecular Formula | C6H5BCl2O2 |
5-Pyrimidinylboronic acid, 97%, may contain varying amounts of anhydride, Thermo Scientific Chemicals
CAS: 109299-78-7 Molecular Formula: C4H5BN2O2 Molecular Weight (g/mol): 123.91 MDL Number: MFCD03002366 InChI Key: HZFPPBMKGYINDF-UHFFFAOYSA-N Synonym: 5-pyrimidinylboronic acid,pyrimidine-5-boronic acid,5-pyrimidineboronic acid,5-pyrimidylboronic acid,pyrimidin-5-yl boronic acid,5-pyrimidine boronic acid,pyrimidinyl-5-boronic acid,pyrimidine-5-ylboronic acid,pyrimidin-5-yl-5-boronic acid,pyrimidin-5-boronic acid PubChem CID: 2795193 IUPAC Name: pyrimidin-5-ylboronic acid SMILES: OB(O)C1=CN=CN=C1
| PubChem CID | 2795193 |
|---|---|
| CAS | 109299-78-7 |
| Molecular Weight (g/mol) | 123.91 |
| MDL Number | MFCD03002366 |
| SMILES | OB(O)C1=CN=CN=C1 |
| Synonym | 5-pyrimidinylboronic acid,pyrimidine-5-boronic acid,5-pyrimidineboronic acid,5-pyrimidylboronic acid,pyrimidin-5-yl boronic acid,5-pyrimidine boronic acid,pyrimidinyl-5-boronic acid,pyrimidine-5-ylboronic acid,pyrimidin-5-yl-5-boronic acid,pyrimidin-5-boronic acid |
| IUPAC Name | pyrimidin-5-ylboronic acid |
| InChI Key | HZFPPBMKGYINDF-UHFFFAOYSA-N |
| Molecular Formula | C4H5BN2O2 |
5-Chloro-2-methoxybenzeneboronic acid, 97%, Thermo Scientific Chemicals
CAS: 89694-48-4 Molecular Formula: C7H8BClO3 Molecular Weight (g/mol): 186.40 MDL Number: MFCD01318966 InChI Key: FMBVAOHFMSQDGT-UHFFFAOYSA-N Synonym: 5-chloro-2-methoxyphenyl boronic acid,5-chloro-2-methoxybenzeneboronic acid,5-chloro-2-methoxyphenyl boranediol,2-methoxy-5-chlorophenylboronic acid,4-chloroanisole-2-boronic acid,boronic acid, 5-chloro-2-methoxyphenyl,5-chloro-2-methoxyphenylboronicacid,pubchem1782,5-chloro-2-methoxy-phenyl boronic acid PubChem CID: 2735751 IUPAC Name: (5-chloro-2-methoxyphenyl)boronic acid SMILES: COC1=C(C=C(Cl)C=C1)B(O)O
| PubChem CID | 2735751 |
|---|---|
| CAS | 89694-48-4 |
| Molecular Weight (g/mol) | 186.40 |
| MDL Number | MFCD01318966 |
| SMILES | COC1=C(C=C(Cl)C=C1)B(O)O |
| Synonym | 5-chloro-2-methoxyphenyl boronic acid,5-chloro-2-methoxybenzeneboronic acid,5-chloro-2-methoxyphenyl boranediol,2-methoxy-5-chlorophenylboronic acid,4-chloroanisole-2-boronic acid,boronic acid, 5-chloro-2-methoxyphenyl,5-chloro-2-methoxyphenylboronicacid,pubchem1782,5-chloro-2-methoxy-phenyl boronic acid |
| IUPAC Name | (5-chloro-2-methoxyphenyl)boronic acid |
| InChI Key | FMBVAOHFMSQDGT-UHFFFAOYSA-N |
| Molecular Formula | C7H8BClO3 |
3-Methoxycarbonylphenylboronic acid, 97%
CAS: 99769-19-4 Molecular Formula: C8H9BO4 Molecular Weight (g/mol): 179.97 MDL Number: MFCD02093046 InChI Key: ALTLCJHSJMGSLT-UHFFFAOYSA-N Synonym: 3-methoxycarbonyl phenylboronic acid,3-methoxycarbonylphenyl boronic acid,3-methoxycarbonyl phenyl boronic acid,3-methoxycarbonyl benzeneboronic acid,3-methoxycarbonylphenylbaronic acid,methyl 3-dihydroxyboranyl benzoate,m-methoxycarbonyl phenylboronic acid,3-carbomethoxy-phenylboronic acid PubChem CID: 2734714 IUPAC Name: (3-methoxycarbonylphenyl)boronic acid SMILES: COC(=O)C1=CC=CC(=C1)B(O)O
| PubChem CID | 2734714 |
|---|---|
| CAS | 99769-19-4 |
| Molecular Weight (g/mol) | 179.97 |
| MDL Number | MFCD02093046 |
| SMILES | COC(=O)C1=CC=CC(=C1)B(O)O |
| Synonym | 3-methoxycarbonyl phenylboronic acid,3-methoxycarbonylphenyl boronic acid,3-methoxycarbonyl phenyl boronic acid,3-methoxycarbonyl benzeneboronic acid,3-methoxycarbonylphenylbaronic acid,methyl 3-dihydroxyboranyl benzoate,m-methoxycarbonyl phenylboronic acid,3-carbomethoxy-phenylboronic acid |
| IUPAC Name | (3-methoxycarbonylphenyl)boronic acid |
| InChI Key | ALTLCJHSJMGSLT-UHFFFAOYSA-N |
| Molecular Formula | C8H9BO4 |
Phenylboronic acid, 98+%, may contain varying amounts of anhydride
CAS: 98-80-6 Molecular Formula: C6H7BO2 Molecular Weight (g/mol): 121.93 MDL Number: MFCD00002103 InChI Key: HXITXNWTGFUOAU-UHFFFAOYSA-N Synonym: benzeneboronic acid,boronic acid, phenyl,phenyl boronic acid,phenylboric acid,dihydroxyphenylborane,phenyldihydroxyborane,dihydroxy phenyl borane,phenylboronicacid,borophenylic acid,usaf bo-2 PubChem CID: 66827 ChEBI: CHEBI:44923 IUPAC Name: phenylboronic acid SMILES: OB(O)C1=CC=CC=C1
| PubChem CID | 66827 |
|---|---|
| CAS | 98-80-6 |
| Molecular Weight (g/mol) | 121.93 |
| ChEBI | CHEBI:44923 |
| MDL Number | MFCD00002103 |
| SMILES | OB(O)C1=CC=CC=C1 |
| Synonym | benzeneboronic acid,boronic acid, phenyl,phenyl boronic acid,phenylboric acid,dihydroxyphenylborane,phenyldihydroxyborane,dihydroxy phenyl borane,phenylboronicacid,borophenylic acid,usaf bo-2 |
| IUPAC Name | phenylboronic acid |
| InChI Key | HXITXNWTGFUOAU-UHFFFAOYSA-N |
| Molecular Formula | C6H7BO2 |
3-Methylbenzeneboronic acid, 97%
CAS: 17933-03-8 Molecular Formula: C7H9BO2 Molecular Weight (g/mol): 135.96 MDL Number: MFCD00040198 InChI Key: BJQCPCFFYBKRLM-UHFFFAOYSA-N Synonym: 3-tolylboronic acid,m-tolylboronic acid,3-methylphenyl boronic acid,3-methylbenzeneboronic acid,3-methyl phenyl boronic acid,3-tolyboronic acid,3-methylphenyl boranediol,m-methylphenylboronic acid,m-tolyl boronic acid PubChem CID: 2733950 IUPAC Name: (3-methylphenyl)boronic acid SMILES: CC1=CC=CC(=C1)B(O)O
| PubChem CID | 2733950 |
|---|---|
| CAS | 17933-03-8 |
| Molecular Weight (g/mol) | 135.96 |
| MDL Number | MFCD00040198 |
| SMILES | CC1=CC=CC(=C1)B(O)O |
| Synonym | 3-tolylboronic acid,m-tolylboronic acid,3-methylphenyl boronic acid,3-methylbenzeneboronic acid,3-methyl phenyl boronic acid,3-tolyboronic acid,3-methylphenyl boranediol,m-methylphenylboronic acid,m-tolyl boronic acid |
| IUPAC Name | (3-methylphenyl)boronic acid |
| InChI Key | BJQCPCFFYBKRLM-UHFFFAOYSA-N |
| Molecular Formula | C7H9BO2 |