Methylene Chloride
- (36)
- (1)
- (3)
- (1)
- (6)
- (1)
- (2)
- (1)
- (1)
- (169)
- (22)
- (6)
- (4)
- (1)
- (2)
- (7)
- (4)
- (5)
- (1)
- (5)
- (8)
- (2)
- (7)
- (1)
- (3)
- (7)
Résultats de la recherche filtrée
Methylene Chloride (Stabilized/Certified ACS), Fisher Chemical™
CAS: 75-09-2 Formule moléculaire: CH2Cl2 Poids moléculaire (g/mol): 84.93 Numéro MDL: MFCD00000881 Clé InChI: YMWUJEATGCHHMB-UHFFFAOYSA-N Synonyme: methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm CID PubChem: 6344 ChEBI: CHEBI:15767 Nom IUPAC: dichloromethane SMILES: ClCCl
| Poids moléculaire (g/mol) | 84.93 |
|---|---|
| Synonyme | methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm |
| Numéro MDL | MFCD00000881 |
| CAS | 75-09-2 |
| CID PubChem | 6344 |
| ChEBI | CHEBI:15767 |
| Nom IUPAC | dichloromethane |
| Clé InChI | YMWUJEATGCHHMB-UHFFFAOYSA-N |
| SMILES | ClCCl |
| Formule moléculaire | CH2Cl2 |
Methylene Chloride (Pesticide), Fisher Chemical
Formule moléculaire: CH2Cl2 Poids moléculaire (g/mol): 84.93 Numéro MDL: MFCD00000881 Clé InChI: YMWUJEATGCHHMB-UHFFFAOYSA-N Synonyme: methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm Nom IUPAC: dichloromethane SMILES: ClCCl
| Poids moléculaire (g/mol) | 84.93 |
|---|---|
| Synonyme | methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm |
| Numéro MDL | MFCD00000881 |
| Nom IUPAC | dichloromethane |
| Clé InChI | YMWUJEATGCHHMB-UHFFFAOYSA-N |
| SMILES | ClCCl |
| Formule moléculaire | CH2Cl2 |
Methylene Chloride (HPLC), Fisher Chemical™
CAS: 75-09-2 Formule moléculaire: CH2Cl2 Poids moléculaire (g/mol): 84.93 Numéro MDL: MFCD00000881 Clé InChI: YMWUJEATGCHHMB-UHFFFAOYSA-N Synonyme: methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm CID PubChem: 6344 ChEBI: CHEBI:15767 Nom IUPAC: dichloromethane SMILES: ClCCl
| Poids moléculaire (g/mol) | 84.93 |
|---|---|
| Synonyme | methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm |
| Numéro MDL | MFCD00000881 |
| CAS | 75-09-2 |
| CID PubChem | 6344 |
| ChEBI | CHEBI:15767 |
| Nom IUPAC | dichloromethane |
| Clé InChI | YMWUJEATGCHHMB-UHFFFAOYSA-N |
| SMILES | ClCCl |
| Formule moléculaire | CH2Cl2 |
Methylene Chloride (Stabilized/Spectranalyzed™), Fisher Chemical™
CAS: 75-09-2 Formule moléculaire: CH2Cl2 Poids moléculaire (g/mol): 84.93 Numéro MDL: MFCD00000881 Clé InChI: YMWUJEATGCHHMB-UHFFFAOYSA-N Synonyme: methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm CID PubChem: 6344 ChEBI: CHEBI:15767 Nom IUPAC: dichloromethane SMILES: ClCCl
| Poids moléculaire (g/mol) | 84.93 |
|---|---|
| Synonyme | methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm |
| Numéro MDL | MFCD00000881 |
| CAS | 75-09-2 |
| CID PubChem | 6344 |
| ChEBI | CHEBI:15767 |
| Nom IUPAC | dichloromethane |
| Clé InChI | YMWUJEATGCHHMB-UHFFFAOYSA-N |
| SMILES | ClCCl |
| Formule moléculaire | CH2Cl2 |
Methylene Chloride (Not Stabilized/HPLC), Fisher Chemical™
CAS: 75-09-2 Formule moléculaire: CH2Cl2 Poids moléculaire (g/mol): 84.93 Numéro MDL: MFCD00000881 Clé InChI: YMWUJEATGCHHMB-UHFFFAOYSA-N Synonyme: methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm CID PubChem: 6344 ChEBI: CHEBI:15767 Nom IUPAC: dichloromethane SMILES: ClCCl
| Poids moléculaire (g/mol) | 84.93 |
|---|---|
| Synonyme | methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm |
| Numéro MDL | MFCD00000881 |
| CAS | 75-09-2 |
| CID PubChem | 6344 |
| ChEBI | CHEBI:15767 |
| Nom IUPAC | dichloromethane |
| Clé InChI | YMWUJEATGCHHMB-UHFFFAOYSA-N |
| SMILES | ClCCl |
| Formule moléculaire | CH2Cl2 |
Methylene Chloride (GC Resolv™), Fisher Chemical
CAS: 75-09-2 Formule moléculaire: CH2Cl2 Poids moléculaire (g/mol): 84.93 Numéro MDL: MFCD00000881 Clé InChI: YMWUJEATGCHHMB-UHFFFAOYSA-N Synonyme: methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm CID PubChem: 6344 ChEBI: CHEBI:15767 Nom IUPAC: dichloromethane SMILES: ClCCl
| Poids moléculaire (g/mol) | 84.93 |
|---|---|
| Synonyme | methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm |
| Numéro MDL | MFCD00000881 |
| CAS | 75-09-2 |
| CID PubChem | 6344 |
| ChEBI | CHEBI:15767 |
| Nom IUPAC | dichloromethane |
| Clé InChI | YMWUJEATGCHHMB-UHFFFAOYSA-N |
| SMILES | ClCCl |
| Formule moléculaire | CH2Cl2 |
Methylene Chloride, Optima™ for HPLC and GC, Fisher Chemical™
CAS: 75-09-2 Formule moléculaire: CH2Cl2 Poids moléculaire (g/mol): 84.93 Numéro MDL: MFCD00000881 Clé InChI: YMWUJEATGCHHMB-UHFFFAOYSA-N Synonyme: methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm CID PubChem: 6344 ChEBI: CHEBI:15767 Nom IUPAC: dichloromethane SMILES: ClCCl
| Poids moléculaire (g/mol) | 84.93 |
|---|---|
| Synonyme | methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm |
| Numéro MDL | MFCD00000881 |
| CAS | 75-09-2 |
| CID PubChem | 6344 |
| ChEBI | CHEBI:15767 |
| Nom IUPAC | dichloromethane |
| Clé InChI | YMWUJEATGCHHMB-UHFFFAOYSA-N |
| SMILES | ClCCl |
| Formule moléculaire | CH2Cl2 |
Dichloromethane, 99.8%, for HPLC, stabilized with amylene
CAS: 75-09-2 Formule moléculaire: CH2Cl2 Poids moléculaire (g/mol): 84.93 Numéro MDL: MFCD00000881 Clé InChI: YMWUJEATGCHHMB-UHFFFAOYSA-N Synonyme: methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm CID PubChem: 6344 ChEBI: CHEBI:15767 Nom IUPAC: dichloromethane SMILES: ClCCl
| Poids moléculaire (g/mol) | 84.93 |
|---|---|
| Synonyme | methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm |
| Numéro MDL | MFCD00000881 |
| CAS | 75-09-2 |
| CID PubChem | 6344 |
| ChEBI | CHEBI:15767 |
| Nom IUPAC | dichloromethane |
| Clé InChI | YMWUJEATGCHHMB-UHFFFAOYSA-N |
| SMILES | ClCCl |
| Formule moléculaire | CH2Cl2 |
Dichloromethane, 99.8+%, for analysis, stabilized with amylene
CAS: 75-09-2 Formule moléculaire: CH2Cl2 Poids moléculaire (g/mol): 84.93 Numéro MDL: MFCD00000881 Clé InChI: YMWUJEATGCHHMB-UHFFFAOYSA-N Synonyme: methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm CID PubChem: 6344 ChEBI: CHEBI:15767 Nom IUPAC: dichloromethane SMILES: ClCCl
| Poids moléculaire (g/mol) | 84.93 |
|---|---|
| Synonyme | methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm |
| Numéro MDL | MFCD00000881 |
| CAS | 75-09-2 |
| CID PubChem | 6344 |
| ChEBI | CHEBI:15767 |
| Nom IUPAC | dichloromethane |
| Clé InChI | YMWUJEATGCHHMB-UHFFFAOYSA-N |
| SMILES | ClCCl |
| Formule moléculaire | CH2Cl2 |
Dichloromethane, for residue and pestic. anal., stab. with amylene
CAS: 75-09-2 Formule moléculaire: CH2Cl2 Poids moléculaire (g/mol): 84.93 Numéro MDL: MFCD00000881 Clé InChI: YMWUJEATGCHHMB-UHFFFAOYSA-N Synonyme: methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm CID PubChem: 6344 ChEBI: CHEBI:15767 Nom IUPAC: dichloromethane SMILES: ClCCl
| Poids moléculaire (g/mol) | 84.93 |
|---|---|
| Synonyme | methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm |
| Numéro MDL | MFCD00000881 |
| CAS | 75-09-2 |
| CID PubChem | 6344 |
| ChEBI | CHEBI:15767 |
| Nom IUPAC | dichloromethane |
| Clé InChI | YMWUJEATGCHHMB-UHFFFAOYSA-N |
| SMILES | ClCCl |
| Formule moléculaire | CH2Cl2 |
2-{2-[(2-Bromo-6-chlorophenyl)amino]phenyl}acetic Acid, MilliporeSigma™ Supelco™
CAS: 127792-23-8 Formule moléculaire: C14H11BrClNO2 Poids moléculaire (g/mol): 340.60 Numéro MDL: MFCD19704935 Clé InChI: RABKUCPRNJPBRH-UHFFFAOYSA-N Synonyme: Diclofenac impurity D (PhEur); 2-[(2-Bromo-6-chlorophenyl)amino]benzeneacetic acid Nom IUPAC: 2-{2-[(2-bromo-6-chlorophenyl)amino]phenyl}acetic acid SMILES: OC(=O)CC1=CC=CC=C1NC1=C(Cl)C=CC=C1Br
| Poids moléculaire (g/mol) | 340.60 |
|---|---|
| Synonyme | Diclofenac impurity D (PhEur); 2-[(2-Bromo-6-chlorophenyl)amino]benzeneacetic acid |
| Numéro MDL | MFCD19704935 |
| CAS | 127792-23-8 |
| Nom IUPAC | 2-{2-[(2-bromo-6-chlorophenyl)amino]phenyl}acetic acid |
| Clé InChI | RABKUCPRNJPBRH-UHFFFAOYSA-N |
| SMILES | OC(=O)CC1=CC=CC=C1NC1=C(Cl)C=CC=C1Br |
| Formule moléculaire | C14H11BrClNO2 |
Dichloromethane, 99.9%, for residue analysis, for anal.of polyarom.hydrocarb., stab.with amylene
CAS: 75-09-2 Formule moléculaire: CH2Cl2 Poids moléculaire (g/mol): 84.93 Numéro MDL: MFCD00000881 Clé InChI: YMWUJEATGCHHMB-UHFFFAOYSA-N Synonyme: methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm CID PubChem: 6344 ChEBI: CHEBI:15767 Nom IUPAC: dichloromethane SMILES: ClCCl
| Poids moléculaire (g/mol) | 84.93 |
|---|---|
| Synonyme | methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm |
| Numéro MDL | MFCD00000881 |
| CAS | 75-09-2 |
| CID PubChem | 6344 |
| ChEBI | CHEBI:15767 |
| Nom IUPAC | dichloromethane |
| Clé InChI | YMWUJEATGCHHMB-UHFFFAOYSA-N |
| SMILES | ClCCl |
| Formule moléculaire | CH2Cl2 |
Dichloromethane, 99.9%, for peptide synthesis, stabilized with amylene
CAS: 75-09-2 Formule moléculaire: CH2Cl2 Poids moléculaire (g/mol): 84.93 Numéro MDL: MFCD00000881 Clé InChI: YMWUJEATGCHHMB-UHFFFAOYSA-N Synonyme: methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm CID PubChem: 6344 ChEBI: CHEBI:15767 Nom IUPAC: dichloromethane SMILES: ClCCl
| Poids moléculaire (g/mol) | 84.93 |
|---|---|
| Synonyme | methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm |
| Numéro MDL | MFCD00000881 |
| CAS | 75-09-2 |
| CID PubChem | 6344 |
| ChEBI | CHEBI:15767 |
| Nom IUPAC | dichloromethane |
| Clé InChI | YMWUJEATGCHHMB-UHFFFAOYSA-N |
| SMILES | ClCCl |
| Formule moléculaire | CH2Cl2 |
Dichloromethane, B&J Brand™, for HPLC, GC, pesticide residue analysis and spectrophotometry, contains amylene, >99.9%, Honeywell Burdick & Jackson
CAS: 75-09-2 Formule moléculaire: CH2Cl2 Poids moléculaire (g/mol): 84.93 Numéro MDL: MFCD00000881 Clé InChI: YMWUJEATGCHHMB-UHFFFAOYSA-N Synonyme: methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm CID PubChem: 6344 ChEBI: CHEBI:15767 Nom IUPAC: dichloromethane SMILES: ClCCl
| Poids moléculaire (g/mol) | 84.93 |
|---|---|
| Synonyme | methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm |
| Numéro MDL | MFCD00000881 |
| CAS | 75-09-2 |
| CID PubChem | 6344 |
| ChEBI | CHEBI:15767 |
| Nom IUPAC | dichloromethane |
| Clé InChI | YMWUJEATGCHHMB-UHFFFAOYSA-N |
| SMILES | ClCCl |
| Formule moléculaire | CH2Cl2 |
Dichloromethane, Puriss. p.a., ACS Reagent, Reag. ISO, ≥99.9% (GC), Honeywell Riedel-de Haën™
CAS: 75-09-2 Formule moléculaire: CH2Cl2 Poids moléculaire (g/mol): 84.93 Numéro MDL: MFCD00000881 Clé InChI: YMWUJEATGCHHMB-UHFFFAOYSA-N Synonyme: methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm CID PubChem: 6344 ChEBI: CHEBI:15767 Nom IUPAC: dichloromethane SMILES: ClCCl
| Poids moléculaire (g/mol) | 84.93 |
|---|---|
| Synonyme | methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm |
| Numéro MDL | MFCD00000881 |
| CAS | 75-09-2 |
| CID PubChem | 6344 |
| ChEBI | CHEBI:15767 |
| Nom IUPAC | dichloromethane |
| Clé InChI | YMWUJEATGCHHMB-UHFFFAOYSA-N |
| SMILES | ClCCl |
| Formule moléculaire | CH2Cl2 |