Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Iron(Iii) Oxide, purified, Honeywell Fluka™
CAS: 1309-37-1 Molecular Formula: Fe2O3 Molecular Weight (g/mol): 159.69 MDL Number: MFCD00011008 InChI Key: JEIPFZHSYJVQDO-UHFFFAOYSA-N IUPAC Name: trioxodiiron SMILES: [Fe][Fe](=O)(=O)=O
| CAS | 1309-37-1 |
|---|---|
| Molecular Weight (g/mol) | 159.69 |
| MDL Number | MFCD00011008 |
| SMILES | [Fe][Fe](=O)(=O)=O |
| IUPAC Name | trioxodiiron |
| InChI Key | JEIPFZHSYJVQDO-UHFFFAOYSA-N |
| Molecular Formula | Fe2O3 |
Copper(I) chloride, 99%, extra pure, purified
CAS: 7758-89-6 Molecular Formula: ClCu Molecular Weight (g/mol): 99 MDL Number: MFCD00010971 InChI Key: OXBLHERUFWYNTN-UHFFFAOYSA-M Synonym: cuprous chloride,copper i chloride,copper chloride cucl,copper monochloride,dicopper dichloride,copper 1+ chloride,cucl,chlorid medny czech PubChem CID: 62652 ChEBI: CHEBI:53472 IUPAC Name: chlorocopper SMILES: Cl[Cu]
| PubChem CID | 62652 |
|---|---|
| CAS | 7758-89-6 |
| Molecular Weight (g/mol) | 99 |
| ChEBI | CHEBI:53472 |
| MDL Number | MFCD00010971 |
| SMILES | Cl[Cu] |
| Synonym | cuprous chloride,copper i chloride,copper chloride cucl,copper monochloride,dicopper dichloride,copper 1+ chloride,cucl,chlorid medny czech |
| IUPAC Name | chlorocopper |
| InChI Key | OXBLHERUFWYNTN-UHFFFAOYSA-M |
| Molecular Formula | ClCu |
Silicon diOxide, purum p.a., Acid purified, Honeywell Fluka™
CAS: 60676-86-0 Molecular Formula: O2Si Molecular Weight (g/mol): 60.083 MDL Number: MFCD00011232 InChI Key: VYPSYNLAJGMNEJ-UHFFFAOYSA-N Synonym: silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous PubChem CID: 24261 ChEBI: CHEBI:30563 IUPAC Name: dioxosilane SMILES: O=[Si]=O
| PubChem CID | 24261 |
|---|---|
| CAS | 60676-86-0 |
| Molecular Weight (g/mol) | 60.083 |
| ChEBI | CHEBI:30563 |
| MDL Number | MFCD00011232 |
| SMILES | O=[Si]=O |
| Synonym | silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous |
| IUPAC Name | dioxosilane |
| InChI Key | VYPSYNLAJGMNEJ-UHFFFAOYSA-N |
| Molecular Formula | O2Si |
Sand, Washed and Ignited, Purified, J.T. Baker™
CAS: 14808-60-7 Molecular Formula: O2Si Molecular Weight (g/mol): 60.08 MDL Number: MFCD00011232,MFCD00217788,MFCD00163736,MFCD07370733 InChI Key: VYPSYNLAJGMNEJ-UHFFFAOYSA-N Synonym: silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous PubChem CID: 24261 ChEBI: CHEBI:30563 IUPAC Name: silanedione SMILES: O=[Si]=O
| PubChem CID | 24261 |
|---|---|
| CAS | 14808-60-7 |
| Molecular Weight (g/mol) | 60.08 |
| ChEBI | CHEBI:30563 |
| MDL Number | MFCD00011232,MFCD00217788,MFCD00163736,MFCD07370733 |
| SMILES | O=[Si]=O |
| Synonym | silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous |
| IUPAC Name | silanedione |
| InChI Key | VYPSYNLAJGMNEJ-UHFFFAOYSA-N |
| Molecular Formula | O2Si |
Sand, Purified, For USP/NF analysis, J.T. Baker™
CAS: 14808-60-7 Molecular Formula: O2Si Molecular Weight (g/mol): 60.08 MDL Number: MFCD00011232,MFCD00217788,MFCD00163736,MFCD07370733 InChI Key: VYPSYNLAJGMNEJ-UHFFFAOYSA-N Synonym: silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous PubChem CID: 24261 ChEBI: CHEBI:30563 IUPAC Name: silanedione SMILES: O=[Si]=O
| PubChem CID | 24261 |
|---|---|
| CAS | 14808-60-7 |
| Molecular Weight (g/mol) | 60.08 |
| ChEBI | CHEBI:30563 |
| MDL Number | MFCD00011232,MFCD00217788,MFCD00163736,MFCD07370733 |
| SMILES | O=[Si]=O |
| Synonym | silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous |
| IUPAC Name | silanedione |
| InChI Key | VYPSYNLAJGMNEJ-UHFFFAOYSA-N |
| Molecular Formula | O2Si |
Boron trifluoride-dimethyl sulfide complex, purified, packaged under Argon in resealable ChemSeal™ bottles, Thermo Scientific Chemicals
CAS: 353-43-5 Molecular Formula: C2H6BF3S Molecular Weight (g/mol): 129.94 MDL Number: MFCD00013193 InChI Key: BRWZPVRDOUWXKE-UHFFFAOYSA-N Synonym: boron fluoride-dimethyl sulfide complex,dimethyl-??-sulfanylidene trifluoro-??-borane,trifluoroborane-methyl sulfide,dimethyl sulfide-trifluoroborane,trifluoro methylsulfanyl methane boron,boron trifluoride methyl sulfide complex,boron trifluoride-methyl sulfide complex,boron trifluoride-dimethyl sulfide complex, purified, packaged under argon in resealable chemseal bottles PubChem CID: 71311438 IUPAC Name: dimethylsulfonio(trifluoro)boranuide SMILES: CSC.FB(F)F
| PubChem CID | 71311438 |
|---|---|
| CAS | 353-43-5 |
| Molecular Weight (g/mol) | 129.94 |
| MDL Number | MFCD00013193 |
| SMILES | CSC.FB(F)F |
| Synonym | boron fluoride-dimethyl sulfide complex,dimethyl-??-sulfanylidene trifluoro-??-borane,trifluoroborane-methyl sulfide,dimethyl sulfide-trifluoroborane,trifluoro methylsulfanyl methane boron,boron trifluoride methyl sulfide complex,boron trifluoride-methyl sulfide complex,boron trifluoride-dimethyl sulfide complex, purified, packaged under argon in resealable chemseal bottles |
| IUPAC Name | dimethylsulfonio(trifluoro)boranuide |
| InChI Key | BRWZPVRDOUWXKE-UHFFFAOYSA-N |
| Molecular Formula | C2H6BF3S |
Palladium(II) Acetate (Purified) 98.0+%, TCI America™
CAS: 3375-31-3 Molecular Formula: C4H6O4Pd Molecular Weight (g/mol): 224.51 MDL Number: MFCD00012453 InChI Key: YJVFFLUZDVXJQI-UHFFFAOYSA-L Synonym: palladium ii acetate,palladium diacetate,palladium acetate,diacetoxypalladium,bis acetato palladium,bisacetylpalladium,diacetatopalladium,palladium 2+ acetate,palladous acetate PubChem CID: 167845 IUPAC Name: palladium(2+) diacetate SMILES: [Pd++].CC([O-])=O.CC([O-])=O
| PubChem CID | 167845 |
|---|---|
| CAS | 3375-31-3 |
| Molecular Weight (g/mol) | 224.51 |
| MDL Number | MFCD00012453 |
| SMILES | [Pd++].CC([O-])=O.CC([O-])=O |
| Synonym | palladium ii acetate,palladium diacetate,palladium acetate,diacetoxypalladium,bis acetato palladium,bisacetylpalladium,diacetatopalladium,palladium 2+ acetate,palladous acetate |
| IUPAC Name | palladium(2+) diacetate |
| InChI Key | YJVFFLUZDVXJQI-UHFFFAOYSA-L |
| Molecular Formula | C4H6O4Pd |
Sodium Iodide, Purified, Reagents
CAS: 7681-82-5 Molecular Formula: INa Molecular Weight (g/mol): 149.89 InChI Key: FVAUCKIRQBBSSJ-UHFFFAOYSA-M IUPAC Name: sodium iodide SMILES: [Na+].[I-]
| CAS | 7681-82-5 |
|---|---|
| Molecular Weight (g/mol) | 149.89 |
| SMILES | [Na+].[I-] |
| IUPAC Name | sodium iodide |
| InChI Key | FVAUCKIRQBBSSJ-UHFFFAOYSA-M |
| Molecular Formula | INa |
Sodium Chloride, Purified, Reagents
CAS: 7647-14-5 Molecular Formula: ClNa Molecular Weight (g/mol): 58.44 MDL Number: MFCD00003477 InChI Key: FAPWRFPIFSIZLT-UHFFFAOYSA-M Synonym: Table salt IUPAC Name: sodium chloride SMILES: [Na+].[Cl-]
| CAS | 7647-14-5 |
|---|---|
| Molecular Weight (g/mol) | 58.44 |
| MDL Number | MFCD00003477 |
| SMILES | [Na+].[Cl-] |
| Synonym | Table salt |
| IUPAC Name | sodium chloride |
| InChI Key | FAPWRFPIFSIZLT-UHFFFAOYSA-M |
| Molecular Formula | ClNa |
Ammonium Carbonate, Purified, Reagents
CAS: 506-87-6 Molecular Formula: CH8N2O3 Molecular Weight (g/mol): 96.09 InChI Key: PRKQVKDSMLBJBJ-UHFFFAOYSA-N Synonym: Smelling salts IUPAC Name: carbonic acid diamine SMILES: N.N.OC(O)=O
| CAS | 506-87-6 |
|---|---|
| Molecular Weight (g/mol) | 96.09 |
| SMILES | N.N.OC(O)=O |
| Synonym | Smelling salts |
| IUPAC Name | carbonic acid diamine |
| InChI Key | PRKQVKDSMLBJBJ-UHFFFAOYSA-N |
| Molecular Formula | CH8N2O3 |
Ammonium Chloride, Purified, Reagents
CAS: 12125-02-9 Molecular Formula: ClH4N Molecular Weight (g/mol): 53.49 MDL Number: MFCD00011420 InChI Key: NLXLAEXVIDQMFP-UHFFFAOYSA-N Synonym: Ammonium Muriate IUPAC Name: amine hydrochloride SMILES: N.Cl
| CAS | 12125-02-9 |
|---|---|
| Molecular Weight (g/mol) | 53.49 |
| MDL Number | MFCD00011420 |
| SMILES | N.Cl |
| Synonym | Ammonium Muriate |
| IUPAC Name | amine hydrochloride |
| InChI Key | NLXLAEXVIDQMFP-UHFFFAOYSA-N |
| Molecular Formula | ClH4N |
Ammonium Dichromate, Purified, Reagents
CAS: 7789-09-5 Molecular Formula: Cr2H8N2O7 Molecular Weight (g/mol): 252.06 InChI Key: JOSWYUNQBRPBDN-UHFFFAOYSA-P Synonym: Ammonium Bichromate, Diammonium Chromate IUPAC Name: diammonium [(oxidodioxochromio)oxy]chromiumoylolate SMILES: [NH4+].[NH4+].[O-][Cr](=O)(=O)O[Cr]([O-])(=O)=O
| CAS | 7789-09-5 |
|---|---|
| Molecular Weight (g/mol) | 252.06 |
| SMILES | [NH4+].[NH4+].[O-][Cr](=O)(=O)O[Cr]([O-])(=O)=O |
| Synonym | Ammonium Bichromate, Diammonium Chromate |
| IUPAC Name | diammonium [(oxidodioxochromio)oxy]chromiumoylolate |
| InChI Key | JOSWYUNQBRPBDN-UHFFFAOYSA-P |
| Molecular Formula | Cr2H8N2O7 |
Aluminum Sulfate, Purified, Reagents
CAS: 17927-65-0 Molecular Formula: Al2O12S3 Molecular Weight (g/mol): 342.13 MDL Number: MFCD00149136 InChI Key: DIZPMCHEQGEION-UHFFFAOYSA-H Synonym: Dialuminum trisulfate hydrate IUPAC Name: dialuminium(3+) trisulfate SMILES: [Al+3].[Al+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O
| CAS | 17927-65-0 |
|---|---|
| Molecular Weight (g/mol) | 342.13 |
| MDL Number | MFCD00149136 |
| SMILES | [Al+3].[Al+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O |
| Synonym | Dialuminum trisulfate hydrate |
| IUPAC Name | dialuminium(3+) trisulfate |
| InChI Key | DIZPMCHEQGEION-UHFFFAOYSA-H |
| Molecular Formula | Al2O12S3 |
Ammonium Bifluoride, Purified, Reagents
CAS: 1341-49-7 Molecular Formula: F2H5N Molecular Weight (g/mol): 57.04 MDL Number: MFCD00012018 InChI Key: KVBCYCWRDBDGBG-UHFFFAOYSA-N Synonym: Ammonium Hydrogen Difluoride, Ammonium Fluoride Hydrofluoride IUPAC Name: amine dihydrofluoride SMILES: N.F.F
| CAS | 1341-49-7 |
|---|---|
| Molecular Weight (g/mol) | 57.04 |
| MDL Number | MFCD00012018 |
| SMILES | N.F.F |
| Synonym | Ammonium Hydrogen Difluoride, Ammonium Fluoride Hydrofluoride |
| IUPAC Name | amine dihydrofluoride |
| InChI Key | KVBCYCWRDBDGBG-UHFFFAOYSA-N |
| Molecular Formula | F2H5N |
Sodium Fluoride, Purified, Reagents
CAS: 7681-49-4 Molecular Formula: FNa Molecular Weight (g/mol): 41.99 MDL Number: MFCD00003524 InChI Key: PUZPDOWCWNUUKD-UHFFFAOYSA-M IUPAC Name: sodium fluoride SMILES: [F-].[Na+]
| CAS | 7681-49-4 |
|---|---|
| Molecular Weight (g/mol) | 41.99 |
| MDL Number | MFCD00003524 |
| SMILES | [F-].[Na+] |
| IUPAC Name | sodium fluoride |
| InChI Key | PUZPDOWCWNUUKD-UHFFFAOYSA-M |
| Molecular Formula | FNa |