Organometallic Compounds
Résultats de la recherche filtrée
1,1,1,3,3,3-Hexamethyldisilazane, 98%
CAS: 999-97-3 Formule moléculaire: C6H19NSi2 Poids moléculaire (g/mol): 161.4 Clé InChI: FFUAGWLWBBFQJT-UHFFFAOYSA-N Synonyme: hexamethyldisilazane,bis trimethylsilyl amine,hmds,1,1,1,3,3,3-hexamethyldisilazane,hexamethylsilazane,silanamine, 1,1,1-trimethyl-n-trimethylsilyl,tri-sil,1,1,1-trimethyl-n-trimethylsilyl silanamine,hexamethyldisilizane,disilazane, 1,1,1,3,3,3-hexamethyl CID PubChem: 13838 ChEBI: CHEBI:85068 Nom IUPAC: [dimethyl-(trimethylsilylamino)silyl]methane SMILES: C[Si](C)(C)N[Si](C)(C)C
| Poids moléculaire (g/mol) | 161.4 |
|---|---|
| Synonyme | hexamethyldisilazane,bis trimethylsilyl amine,hmds,1,1,1,3,3,3-hexamethyldisilazane,hexamethylsilazane,silanamine, 1,1,1-trimethyl-n-trimethylsilyl,tri-sil,1,1,1-trimethyl-n-trimethylsilyl silanamine,hexamethyldisilizane,disilazane, 1,1,1,3,3,3-hexamethyl |
| CAS | 999-97-3 |
| CID PubChem | 13838 |
| ChEBI | CHEBI:85068 |
| Nom IUPAC | [dimethyl-(trimethylsilylamino)silyl]methane |
| Clé InChI | FFUAGWLWBBFQJT-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)N[Si](C)(C)C |
| Formule moléculaire | C6H19NSi2 |
2-Nitrophenylselenocyanate, 97%
CAS: 51694-22-5 Formule moléculaire: C7H4N2O2Se Poids moléculaire (g/mol): 227.092 Numéro MDL: MFCD00043146 Clé InChI: LHBLJWULWKQRON-UHFFFAOYSA-N Synonyme: selenocyanic acid, 2-nitrophenyl ester,2-nitrophenyl selenocyanate,2-nitrophenylselenocyanate,o-nitrophenyl selenocyanate,1-nitro-2-selenocyanatobenzene,2-nitrophenyl selanyl formonitrile,2-nitrophenyl selenocyanic acid,ortho-nitrophenyl selenocyanate,acmc-20anow,o-nitrophenylselenocyanate CID PubChem: 103931 Nom IUPAC: (2-nitrophenyl) selenocyanate SMILES: C1=CC=C(C(=C1)[N+](=O)[O-])[Se]C#N
| Poids moléculaire (g/mol) | 227.092 |
|---|---|
| Synonyme | selenocyanic acid, 2-nitrophenyl ester,2-nitrophenyl selenocyanate,2-nitrophenylselenocyanate,o-nitrophenyl selenocyanate,1-nitro-2-selenocyanatobenzene,2-nitrophenyl selanyl formonitrile,2-nitrophenyl selenocyanic acid,ortho-nitrophenyl selenocyanate,acmc-20anow,o-nitrophenylselenocyanate |
| Numéro MDL | MFCD00043146 |
| CAS | 51694-22-5 |
| CID PubChem | 103931 |
| Nom IUPAC | (2-nitrophenyl) selenocyanate |
| Clé InChI | LHBLJWULWKQRON-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)[N+](=O)[O-])[Se]C#N |
| Formule moléculaire | C7H4N2O2Se |
Phenyl selenocyanate, 98%
CAS: 2179-79-5 Formule moléculaire: C7H5NSe Poids moléculaire (g/mol): 182.095 Numéro MDL: MFCD00216944 Clé InChI: NODWRXQVQYOJGN-UHFFFAOYSA-N Synonyme: phenylselenocyanate,phenylselanyl formonitrile,selenocyanic acid, phenyl ester,acmc-1cgab,phenyl selenocyanate,selenocyanic acid phenyl ester,2-phenyl-2-selenaethanenitrile CID PubChem: 555340 Nom IUPAC: phenyl selenocyanate SMILES: C1=CC=C(C=C1)[Se]C#N
| Poids moléculaire (g/mol) | 182.095 |
|---|---|
| Synonyme | phenylselenocyanate,phenylselanyl formonitrile,selenocyanic acid, phenyl ester,acmc-1cgab,phenyl selenocyanate,selenocyanic acid phenyl ester,2-phenyl-2-selenaethanenitrile |
| Numéro MDL | MFCD00216944 |
| CAS | 2179-79-5 |
| CID PubChem | 555340 |
| Nom IUPAC | phenyl selenocyanate |
| Clé InChI | NODWRXQVQYOJGN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)[Se]C#N |
| Formule moléculaire | C7H5NSe |
N,N-Diethyl-1,1,1-trimethylsilylamine, 98+%
CAS: 996-50-9 Formule moléculaire: C7H19NSi Poids moléculaire (g/mol): 145.32 Numéro MDL: MFCD00009040 Clé InChI: JOOMLFKONHCLCJ-UHFFFAOYSA-N Synonyme: n,n-diethyl-1,1,1-trimethylsilylamine,trimethylsilyldiethylamine,diethylaminotrimethylsilane,n,n-diethyltrimethylsilylamine,n,n-diethyl-1,1,1-trimethylsilanamine,n,n-diethylaminotrimethylsilane,diethyl trimethylsilyl amine,n-trimethylsilyldiethylamine,diethylamino trimethylsilane,n-trimethylsilyl diethylamine CID PubChem: 70454 ChEBI: CHEBI:85070 Nom IUPAC: N-ethyl-N-trimethylsilylethanamine SMILES: CCN(CC)[Si](C)(C)C
| Poids moléculaire (g/mol) | 145.32 |
|---|---|
| Synonyme | n,n-diethyl-1,1,1-trimethylsilylamine,trimethylsilyldiethylamine,diethylaminotrimethylsilane,n,n-diethyltrimethylsilylamine,n,n-diethyl-1,1,1-trimethylsilanamine,n,n-diethylaminotrimethylsilane,diethyl trimethylsilyl amine,n-trimethylsilyldiethylamine,diethylamino trimethylsilane,n-trimethylsilyl diethylamine |
| Numéro MDL | MFCD00009040 |
| CAS | 996-50-9 |
| CID PubChem | 70454 |
| ChEBI | CHEBI:85070 |
| Nom IUPAC | N-ethyl-N-trimethylsilylethanamine |
| Clé InChI | JOOMLFKONHCLCJ-UHFFFAOYSA-N |
| SMILES | CCN(CC)[Si](C)(C)C |
| Formule moléculaire | C7H19NSi |
Diethyl(3-pyridyl)borane, 97%, Thermo Scientific Chemicals
CAS: 89878-14-8 Formule moléculaire: C9H14BN Poids moléculaire (g/mol): 147.03 Numéro MDL: MFCD00012348 Clé InChI: OJKBCQOJVMAHDX-UHFFFAOYSA-N Synonyme: diethyl 3-pyridyl borane,3-diethylboryl pyridine,diethyl 3-pyridinyl borane,pyridine, 3-diethylboryl,3-diethylboranyl pyridine,diethyl-3-pyridylborane,dithyl 3-pyridyl borane,3-pyridyldiethylborane,diethyl 3-pyridyl bo CID PubChem: 642851 Nom IUPAC: diethyl(pyridin-3-yl)borane SMILES: CCB(CC)C1=CN=CC=C1
| Poids moléculaire (g/mol) | 147.03 |
|---|---|
| Synonyme | diethyl 3-pyridyl borane,3-diethylboryl pyridine,diethyl 3-pyridinyl borane,pyridine, 3-diethylboryl,3-diethylboranyl pyridine,diethyl-3-pyridylborane,dithyl 3-pyridyl borane,3-pyridyldiethylborane,diethyl 3-pyridyl bo |
| Numéro MDL | MFCD00012348 |
| CAS | 89878-14-8 |
| CID PubChem | 642851 |
| Nom IUPAC | diethyl(pyridin-3-yl)borane |
| Clé InChI | OJKBCQOJVMAHDX-UHFFFAOYSA-N |
| SMILES | CCB(CC)C1=CN=CC=C1 |
| Formule moléculaire | C9H14BN |
2-(Trimethylsilyl)thiophene, 97%
CAS: 18245-28-8 Formule moléculaire: C7H12SSi Poids moléculaire (g/mol): 156.318 Numéro MDL: MFCD00005415 Clé InChI: OANGLGSZPSFVDY-UHFFFAOYSA-N Synonyme: 2-thienyltrimethylsilane,2-trimethylsilylthiophene,trimethyl thiophen-2-yl silane,silane, trimethyl-2-thienyl,trimethyl-2-thienylsilane,2-trimethylsilyl thiophene,trimethyl 2-thienyl silane,amtsi021,acmc-1c71q,thien-2-yl-trimethyl-silane CID PubChem: 140360 Nom IUPAC: trimethyl(thiophen-2-yl)silane SMILES: C[Si](C)(C)C1=CC=CS1
| Poids moléculaire (g/mol) | 156.318 |
|---|---|
| Synonyme | 2-thienyltrimethylsilane,2-trimethylsilylthiophene,trimethyl thiophen-2-yl silane,silane, trimethyl-2-thienyl,trimethyl-2-thienylsilane,2-trimethylsilyl thiophene,trimethyl 2-thienyl silane,amtsi021,acmc-1c71q,thien-2-yl-trimethyl-silane |
| Numéro MDL | MFCD00005415 |
| CAS | 18245-28-8 |
| CID PubChem | 140360 |
| Nom IUPAC | trimethyl(thiophen-2-yl)silane |
| Clé InChI | OANGLGSZPSFVDY-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C1=CC=CS1 |
| Formule moléculaire | C7H12SSi |
(3-chloropropyl)trimethoxysilane, 98+%
CAS: 2530-87-2 Formule moléculaire: C6H15ClO3Si Poids moléculaire (g/mol): 198.72 Numéro MDL: MFCD00000997 Clé InChI: OXYZDRAJMHGSMW-UHFFFAOYSA-N Synonyme: 3-chloropropyl trimethoxysilane,silane, 3-chloropropyl trimethoxy,3-chloropropyltrimethyoxysilane,sila-ace s 620,cps-m,silane 3-chloropropyl tris methoxy,3-trimethoxysilyl propyl chloride,unii-t21bnl1s7f,cptmo,3-chloropropyl trimethoxysilan CID PubChem: 62449 Nom IUPAC: 3-chloropropyl(trimethoxy)silane SMILES: CO[Si](CCCCl)(OC)OC
| Poids moléculaire (g/mol) | 198.72 |
|---|---|
| Synonyme | 3-chloropropyl trimethoxysilane,silane, 3-chloropropyl trimethoxy,3-chloropropyltrimethyoxysilane,sila-ace s 620,cps-m,silane 3-chloropropyl tris methoxy,3-trimethoxysilyl propyl chloride,unii-t21bnl1s7f,cptmo,3-chloropropyl trimethoxysilan |
| Numéro MDL | MFCD00000997 |
| CAS | 2530-87-2 |
| CID PubChem | 62449 |
| Nom IUPAC | 3-chloropropyl(trimethoxy)silane |
| Clé InChI | OXYZDRAJMHGSMW-UHFFFAOYSA-N |
| SMILES | CO[Si](CCCCl)(OC)OC |
| Formule moléculaire | C6H15ClO3Si |
Triethylborane, 1M soln. in THF
CAS: 97-94-9 Formule moléculaire: C6H15B Poids moléculaire (g/mol): 98.00 Numéro MDL: MFCD00009022 Clé InChI: LALRXNPLTWZJIJ-UHFFFAOYSA-N Synonyme: triethylboron,borane, triethyl,triethylborine,boron triethyl,boron ethyl,unii-z3s980z4p3,hsdb 897,triethylboran,borethyl,triethyl borane CID PubChem: 7357 Nom IUPAC: triethylborane SMILES: CCB(CC)CC
| Poids moléculaire (g/mol) | 98.00 |
|---|---|
| Synonyme | triethylboron,borane, triethyl,triethylborine,boron triethyl,boron ethyl,unii-z3s980z4p3,hsdb 897,triethylboran,borethyl,triethyl borane |
| Numéro MDL | MFCD00009022 |
| CAS | 97-94-9 |
| CID PubChem | 7357 |
| Nom IUPAC | triethylborane |
| Clé InChI | LALRXNPLTWZJIJ-UHFFFAOYSA-N |
| SMILES | CCB(CC)CC |
| Formule moléculaire | C6H15B |
N,O-Bis(trimethylsilyl)trifluoroacetamide, with 10% TMCS
CAS: 25561-30-2 Formule moléculaire: C8H18F3NOSi2 Poids moléculaire (g/mol): 257.403 Numéro MDL: MFCD00008269 Clé InChI: XCOBLONWWXQEBS-GHXNOFRVSA-N Synonyme: bstfa,n,o-bis trimethylsilyl trifluoroacetamide,acetamide, 2,2,2-trifluoro-o,n-bis trimethylsilyl,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl acetimidate,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl ethanimidate,trimethylsilyl 1z-2,2,2-trifluoro-n-z-trimethylsilyl ethanimidoate #,n,o-bis trimethylsilyl trifluoroacetamide bstfa,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl ethanecarboximidate CID PubChem: 9601896 Nom IUPAC: trimethylsilyl (1Z)-2,2,2-trifluoro-N-trimethylsilylethanimidate SMILES: C[Si](C)(C)N=C(C(F)(F)F)O[Si](C)(C)C
| Poids moléculaire (g/mol) | 257.403 |
|---|---|
| Synonyme | bstfa,n,o-bis trimethylsilyl trifluoroacetamide,acetamide, 2,2,2-trifluoro-o,n-bis trimethylsilyl,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl acetimidate,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl ethanimidate,trimethylsilyl 1z-2,2,2-trifluoro-n-z-trimethylsilyl ethanimidoate #,n,o-bis trimethylsilyl trifluoroacetamide bstfa,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl ethanecarboximidate |
| Numéro MDL | MFCD00008269 |
| CAS | 25561-30-2 |
| CID PubChem | 9601896 |
| Nom IUPAC | trimethylsilyl (1Z)-2,2,2-trifluoro-N-trimethylsilylethanimidate |
| Clé InChI | XCOBLONWWXQEBS-GHXNOFRVSA-N |
| SMILES | C[Si](C)(C)N=C(C(F)(F)F)O[Si](C)(C)C |
| Formule moléculaire | C8H18F3NOSi2 |
(3-Bromopropoxy)-tert-butyldimethylsilane, 97%, stabilized over sodium carbonate
CAS: 89031-84-5 Formule moléculaire: C9H21BrOSi Poids moléculaire (g/mol): 253.26 Clé InChI: QGMROEZDWJTIDW-UHFFFAOYSA-N Synonyme: 3-bromopropoxy-tert-butyldimethylsilane,3-bromopropoxy tert-butyl dimethylsilane,3-bromopropoxy-t-butyldimethylsilane,3-bromopropoxy-tert-butyl-dimethyl-silane,silane, 3-bromopropoxy 1,1-dimethylethyl dimethyl,acmc-209unq,t-butyl 3-bromopropoxy dimethylsilane,bromopropoxy-tert-butyldimethyl silane CID PubChem: 607486 Nom IUPAC: 3-bromopropoxy-tert-butyl-dimethylsilane SMILES: CC(C)(C)[Si](C)(C)OCCCBr
| Poids moléculaire (g/mol) | 253.26 |
|---|---|
| Synonyme | 3-bromopropoxy-tert-butyldimethylsilane,3-bromopropoxy tert-butyl dimethylsilane,3-bromopropoxy-t-butyldimethylsilane,3-bromopropoxy-tert-butyl-dimethyl-silane,silane, 3-bromopropoxy 1,1-dimethylethyl dimethyl,acmc-209unq,t-butyl 3-bromopropoxy dimethylsilane,bromopropoxy-tert-butyldimethyl silane |
| CAS | 89031-84-5 |
| CID PubChem | 607486 |
| Nom IUPAC | 3-bromopropoxy-tert-butyl-dimethylsilane |
| Clé InChI | QGMROEZDWJTIDW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OCCCBr |
| Formule moléculaire | C9H21BrOSi |
Lithium bis(trimethylsilyl)amide, 1M solution in THF, AcroSeal™
CAS: 4039-32-1 | C6H18LiNSi2 | 167.33 g/mol
| Poids moléculaire (g/mol) | 167.33 |
|---|---|
| Danger pour la santé 3 | GHS P Statement Keep away from heat/sparks/open flames/hot surfaces. - No smoking. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with water/shower. Wear protective gloves/protective clothing/eye p |
| Formule linéaire | ((CH3)3Si)2NLi |
| Danger pour la santé 1 | GHS Signal Word: Danger |
| Danger pour la santé 2 | GHS H Statement Highly flammable liquid and vapor. Causes severe skin burns and eye damage. May cause respiratory irritation. Suspected of causing cancer. May form explosive peroxides. Reacts violently with water.<br/ |
| SMILES | [Li+].C[Si](C)(C)[N-][Si](C)(C)C |
| Point d’ébullition | 65.0°C |
| Poids de la formule | 167.33 |
| Gravité spécifique | 0.9 |
| Formule moléculaire | C6H18LiNSi2 |
| Informations sur la solubilité | Solubility in water: reacts. |
| Point d’éclair | −21°C |
| Synonyme | lithium bis trimethylsilyl amide,lithium hexamethyldisilazide,lihmds,lhmds,hexamethyldisilazane lithium salt,unii-rc4n1i108m,lithiumbis trimethylsilyl amide,lithium bis trimethylsilyl azanide,lithium hexamethyldisilazane,lithium bis-trimethylsilyl amide |
| Nom chimique ou matériau | Lithium bis(trimethylsilyl)amide |
| Fieser | 04,296; 05,393; 07,197; 12,280; 13,165; 14,194 |
| Numéro EINECS | 223-725-6 |
| CAS | 109-99-9 |
| CID PubChem | 2733832 |
| Nom IUPAC | lithium;bis(trimethylsilyl)azanide |
| Clé InChI | YNESATAKKCNGOF-UHFFFAOYSA-N |
| Densité | 0.9000g/mL |
Potassium ethyltrifluoroborate, 97%
CAS: 44248-07-9 Formule moléculaire: C2H5BF3K Poids moléculaire (g/mol): 135.97 Numéro MDL: MFCD04112713 Clé InChI: GIIPADVFWNGSKY-UHFFFAOYSA-N Synonyme: potassium ethyltrifluoroborate,potassium ethyltrifluoroboranuide,potassium ethytrifluoroborate,amtb738,ethyltrifluoroborate potassium salt,potassium ethyl trifluoro borate 1- CID PubChem: 23668491 Nom IUPAC: potassium;ethyl(trifluoro)boranuide SMILES: [K+].CC[B-](F)(F)F
| Poids moléculaire (g/mol) | 135.97 |
|---|---|
| Synonyme | potassium ethyltrifluoroborate,potassium ethyltrifluoroboranuide,potassium ethytrifluoroborate,amtb738,ethyltrifluoroborate potassium salt,potassium ethyl trifluoro borate 1- |
| Numéro MDL | MFCD04112713 |
| CAS | 44248-07-9 |
| CID PubChem | 23668491 |
| Nom IUPAC | potassium;ethyl(trifluoro)boranuide |
| Clé InChI | GIIPADVFWNGSKY-UHFFFAOYSA-N |
| SMILES | [K+].CC[B-](F)(F)F |
| Formule moléculaire | C2H5BF3K |
Trimethylsilanol
CAS: 1066-40-6 Formule moléculaire: C3H9LiOSi Poids moléculaire (g/mol): 96.13 Numéro MDL: MFCD02751657 Clé InChI: OXOZHAWWRPCVGL-UHFFFAOYSA-N Synonyme: trimethylsilanol,silanol, trimethyl,unii-z4bin3300p,trimethylhydroxysilane,ccris 1320,hydroxy trimethyl silane,silanol, 1,1,1-trimethyl,ksc504m9b,2004-14-0 lithium salt,10519-96-7 potassium salt CID PubChem: 66110 Nom IUPAC: hydroxy(trimethyl)silane SMILES: [Li+].C[Si](C)(C)[O-]
| Poids moléculaire (g/mol) | 96.13 |
|---|---|
| Synonyme | trimethylsilanol,silanol, trimethyl,unii-z4bin3300p,trimethylhydroxysilane,ccris 1320,hydroxy trimethyl silane,silanol, 1,1,1-trimethyl,ksc504m9b,2004-14-0 lithium salt,10519-96-7 potassium salt |
| Numéro MDL | MFCD02751657 |
| CAS | 1066-40-6 |
| CID PubChem | 66110 |
| Nom IUPAC | hydroxy(trimethyl)silane |
| Clé InChI | OXOZHAWWRPCVGL-UHFFFAOYSA-N |
| SMILES | [Li+].C[Si](C)(C)[O-] |
| Formule moléculaire | C3H9LiOSi |
Aluminum acrylate
CAS: 15743-20-1 Formule moléculaire: C9H12AlO6 Poids moléculaire (g/mol): 243.171 Numéro MDL: MFCD00078421 Clé InChI: UNGWYUCJMHZVEX-UHFFFAOYSA-N Synonyme: aluminum acrylate CID PubChem: 131874419 Nom IUPAC: aluminum;prop-2-enoic acid SMILES: C=CC(=O)O.C=CC(=O)O.C=CC(=O)O.[Al]
| Poids moléculaire (g/mol) | 243.171 |
|---|---|
| Synonyme | aluminum acrylate |
| Numéro MDL | MFCD00078421 |
| CAS | 15743-20-1 |
| CID PubChem | 131874419 |
| Nom IUPAC | aluminum;prop-2-enoic acid |
| Clé InChI | UNGWYUCJMHZVEX-UHFFFAOYSA-N |
| SMILES | C=CC(=O)O.C=CC(=O)O.C=CC(=O)O.[Al] |
| Formule moléculaire | C9H12AlO6 |
2-Pyridylzinc bromide, 0.5M in THF, packaged under Argon in resealable ChemSeal™ bottles
CAS: 218777-23-2 Formule moléculaire: C5H5BrNZn- Poids moléculaire (g/mol): 224.386 Numéro MDL: MFCD00671985 Clé InChI: WUTSMSLAOBVVCP-UHFFFAOYSA-M Synonyme: 2-pyridylzinc bromide CID PubChem: 76056926 Nom IUPAC: pyridine;zinc;bromide SMILES: C1=CC=NC=C1.[Zn].[Br-]
| Poids moléculaire (g/mol) | 224.386 |
|---|---|
| Synonyme | 2-pyridylzinc bromide |
| Numéro MDL | MFCD00671985 |
| CAS | 218777-23-2 |
| CID PubChem | 76056926 |
| Nom IUPAC | pyridine;zinc;bromide |
| Clé InChI | WUTSMSLAOBVVCP-UHFFFAOYSA-M |
| SMILES | C1=CC=NC=C1.[Zn].[Br-] |
| Formule moléculaire | C5H5BrNZn- |