Chemicals
Résultats de la recherche filtrée
Osmium(III) chloride hydrate
CAS: 14996-60-2 Formule moléculaire: Cl3H2OOs Poids moléculaire (g/mol): 314.60 Numéro MDL: MFCD00149815 Clé InChI: KHHOLOMEVBPRQY-UHFFFAOYSA-K Synonyme: osmium iii chloride hydrate,osmium chloride oscl3 , hydrate 8ci,9ci,trichloroosmium hydrate,cl3os.h2o,trichloroosmium-water 1/1 CID PubChem: 16211485 SMILES: O.Cl[Os](Cl)Cl
| Poids moléculaire (g/mol) | 314.60 |
|---|---|
| Synonyme | osmium iii chloride hydrate,osmium chloride oscl3 , hydrate 8ci,9ci,trichloroosmium hydrate,cl3os.h2o,trichloroosmium-water 1/1 |
| Numéro MDL | MFCD00149815 |
| CAS | 14996-60-2 |
| CID PubChem | 16211485 |
| Clé InChI | KHHOLOMEVBPRQY-UHFFFAOYSA-K |
| SMILES | O.Cl[Os](Cl)Cl |
| Formule moléculaire | Cl3H2OOs |
Osmium tetroxide, 99.9+%, (trace metal basis)
CAS: 20816-12-0 Formule moléculaire: O4Os Poids moléculaire (g/mol): 254.23 Numéro MDL: MFCD00011150 Clé InChI: VUVGYHUDAICLFK-UHFFFAOYSA-N Synonyme: osmium tetroxide,osmium tetraoxide,osmic acid,perosmic oxide,osmic acid anhydride,osmium viii oxide,oso4,perosmic acid anhydride,osmiumtetroxide,osmium oxide, t-4 CID PubChem: 30318 Nom IUPAC: tetraoxoosmium SMILES: O=[Os](=O)(=O)=O
| Poids moléculaire (g/mol) | 254.23 |
|---|---|
| Synonyme | osmium tetroxide,osmium tetraoxide,osmic acid,perosmic oxide,osmic acid anhydride,osmium viii oxide,oso4,perosmic acid anhydride,osmiumtetroxide,osmium oxide, t-4 |
| Numéro MDL | MFCD00011150 |
| CAS | 20816-12-0 |
| CID PubChem | 30318 |
| Nom IUPAC | tetraoxoosmium |
| Clé InChI | VUVGYHUDAICLFK-UHFFFAOYSA-N |
| SMILES | O=[Os](=O)(=O)=O |
| Formule moléculaire | O4Os |
Osmium(IV) oxide, Os 83% min
CAS: 12036-02-1 Formule moléculaire: O2Os Poids moléculaire (g/mol): 222.228 Numéro MDL: MFCD00011150 Clé InChI: XSXHWVKGUXMUQE-UHFFFAOYSA-N Synonyme: osmium iv oxide,osmium dioxide,osmium oxide oso2 6ci,7ci,8ci,9ci,osmium iv-oxid,acmc-1btxg,osmium iv oxide, os CID PubChem: 187574 Nom IUPAC: dioxoosmium SMILES: O=[Os]=O
| Poids moléculaire (g/mol) | 222.228 |
|---|---|
| Synonyme | osmium iv oxide,osmium dioxide,osmium oxide oso2 6ci,7ci,8ci,9ci,osmium iv-oxid,acmc-1btxg,osmium iv oxide, os |
| Numéro MDL | MFCD00011150 |
| CAS | 12036-02-1 |
| CID PubChem | 187574 |
| Nom IUPAC | dioxoosmium |
| Clé InChI | XSXHWVKGUXMUQE-UHFFFAOYSA-N |
| SMILES | O=[Os]=O |
| Formule moléculaire | O2Os |
Osmium(VIII) oxide, 2% aq. soln.
CAS: 20816-12-0 Formule moléculaire: O4Os Poids moléculaire (g/mol): 254.23 Numéro MDL: MFCD00011150 Clé InChI: VUVGYHUDAICLFK-UHFFFAOYSA-N Synonyme: osmium tetroxide,osmium tetraoxide,osmic acid,perosmic oxide,osmic acid anhydride,osmium viii oxide,oso4,perosmic acid anhydride,osmiumtetroxide,osmium oxide, t-4 CID PubChem: 30318 Nom IUPAC: tetraoxoosmium SMILES: O=[Os](=O)(=O)=O
| Poids moléculaire (g/mol) | 254.23 |
|---|---|
| Synonyme | osmium tetroxide,osmium tetraoxide,osmic acid,perosmic oxide,osmic acid anhydride,osmium viii oxide,oso4,perosmic acid anhydride,osmiumtetroxide,osmium oxide, t-4 |
| Numéro MDL | MFCD00011150 |
| CAS | 20816-12-0 |
| CID PubChem | 30318 |
| Nom IUPAC | tetraoxoosmium |
| Clé InChI | VUVGYHUDAICLFK-UHFFFAOYSA-N |
| SMILES | O=[Os](=O)(=O)=O |
| Formule moléculaire | O4Os |
Osmium(VIII) oxide, 4% aq. soln.
CAS: 20816-12-0 Formule moléculaire: O4Os Poids moléculaire (g/mol): 254.23 Numéro MDL: MFCD00011150 Clé InChI: VUVGYHUDAICLFK-UHFFFAOYSA-N Synonyme: osmium tetroxide,osmium tetraoxide,osmic acid,perosmic oxide,osmic acid anhydride,osmium viii oxide,oso4,perosmic acid anhydride,osmiumtetroxide,osmium oxide, t-4 CID PubChem: 30318 Nom IUPAC: tetraoxoosmium SMILES: O=[Os](=O)(=O)=O
| Poids moléculaire (g/mol) | 254.23 |
|---|---|
| Synonyme | osmium tetroxide,osmium tetraoxide,osmic acid,perosmic oxide,osmic acid anhydride,osmium viii oxide,oso4,perosmic acid anhydride,osmiumtetroxide,osmium oxide, t-4 |
| Numéro MDL | MFCD00011150 |
| CAS | 20816-12-0 |
| CID PubChem | 30318 |
| Nom IUPAC | tetraoxoosmium |
| Clé InChI | VUVGYHUDAICLFK-UHFFFAOYSA-N |
| SMILES | O=[Os](=O)(=O)=O |
| Formule moléculaire | O4Os |
Potassium osmium(VI) oxide dihydrate, 98+%
CAS: 10022-66-9 Formule moléculaire: H4K2O6Os Poids moléculaire (g/mol): 368.453 Numéro MDL: MFCD00149919 Clé InChI: DGODWNOPHMXOTR-UHFFFAOYSA-N Synonyme: potassium osmate vi dihydrate,potassium dioxidodioxoosmium dihydrate,potassium osmate dihydrate,unii-5m2bwq2tyj,5m2bwq2tyj,osmate oso42-, dipotassium, dihydrate, t-4,dipotassium tetrahydroxodioxoosmate,potassium osmate k2oso2 oh 4,potassium osmate k2oso4 , dihydrate CID PubChem: 53393272 Nom IUPAC: dipotassium;dioxido(dioxo)osmium;dihydrate SMILES: O.O.[O-][Os](=O)(=O)[O-].[K+].[K+]
| Poids moléculaire (g/mol) | 368.453 |
|---|---|
| Synonyme | potassium osmate vi dihydrate,potassium dioxidodioxoosmium dihydrate,potassium osmate dihydrate,unii-5m2bwq2tyj,5m2bwq2tyj,osmate oso42-, dipotassium, dihydrate, t-4,dipotassium tetrahydroxodioxoosmate,potassium osmate k2oso2 oh 4,potassium osmate k2oso4 , dihydrate |
| Numéro MDL | MFCD00149919 |
| CAS | 10022-66-9 |
| CID PubChem | 53393272 |
| Nom IUPAC | dipotassium;dioxido(dioxo)osmium;dihydrate |
| Clé InChI | DGODWNOPHMXOTR-UHFFFAOYSA-N |
| SMILES | O.O.[O-][Os](=O)(=O)[O-].[K+].[K+] |
| Formule moléculaire | H4K2O6Os |
| Poids moléculaire (g/mol) | 254.23 |
|---|---|
| Numéro RTECS | RN1140000 |
| Formule linéaire | OsO4 |
| Point d’ébullition | 100.0°C |
| Gravité spécifique | 1.04 |
| Forme physique | Solution |
| Nom chimique ou matériau | Osmium tetroxide |
| Fieser | 01,759; 02,301; 04,361; 05,141; 06,424; 10,290; 12,358; 13,186; 14,235; 15,240; 16,249; 17,236 |
| Nom IUPAC | tetraoxoosmium |
| Clé InChI | VUVGYHUDAICLFK-UHFFFAOYSA-N |
| Danger pour la santé 3 | GHS P Statement Wear protective gloves/protective clothing/eye protection/face protection. IF SWALLOWED: rinse mouth. Do NOT induce vomiting. Immediately call a POISON CENTER or doctor/physician. IF INHALED: Remove to fresh air a |
| Danger pour la santé 1 | GHS Signal Word: Danger |
| Danger pour la santé 2 | GHS H Statement Causes serious eye damage. Fatal in contact with skin. Harmful if swallowed. Causes skin irritation. Harmful if inhaled. May cause allergy or asthma symptoms or breathing difficulties if inhaled. |
| Conditionnement | Glass bottle |
| SMILES | O=[Os](=O)(=O)=O |
| Merck Index | 15, 6990 |
| Poids de la formule | 254.2 |
| Formule moléculaire | O4Os |
| Informations sur la solubilité | Solubility in water: soluble |
| Couleur | Yellow |
| Synonyme | osmium tetroxide,osmium tetraoxide,osmic acid,perosmic oxide,osmic acid anhydride,osmium viii oxide,oso4,perosmic acid anhydride,osmiumtetroxide,osmium oxide, t-4 |
| Numéro MDL | MFCD00011150 |
| Concentration or Composition (by Analyte or Components) | 3.92 to 4.08% |
| Numéro EINECS | 244-058-7 |
| CAS | 7732-18-5 |
| CID PubChem | 30318 |
| TSCA | TSCA |
| Densité | 1.0400g/mL |
Osmium powder, -20 mesh, 99.95% (metals basis)
CAS: 4-2-7440 CID PubChem: 23937 ChEBI: CHEBI:30687 Nom IUPAC: osmium
| CAS | 4-2-7440 |
|---|---|
| CID PubChem | 23937 |
| ChEBI | CHEBI:30687 |
| Nom IUPAC | osmium |
Osmium powder, -200 mesh, 99.8% (metals basis)
CAS: 4-2-7440 Formule moléculaire: Os Poids moléculaire (g/mol): 190.23 Numéro MDL: MFCD00011147 Clé InChI: SYQBFIAQOQZEGI-UHFFFAOYSA-N Synonyme: ion,metallic,osmium, elemental,unii-2e7m255opy,os4,osmio,hydrido,hydride,atom,powder CID PubChem: 23937 ChEBI: CHEBI:30687 Nom IUPAC: osmium SMILES: [Os]
| Poids moléculaire (g/mol) | 190.23 |
|---|---|
| Synonyme | ion,metallic,osmium, elemental,unii-2e7m255opy,os4,osmio,hydrido,hydride,atom,powder |
| Numéro MDL | MFCD00011147 |
| CAS | 4-2-7440 |
| CID PubChem | 23937 |
| ChEBI | CHEBI:30687 |
| Nom IUPAC | osmium |
| Clé InChI | SYQBFIAQOQZEGI-UHFFFAOYSA-N |
| SMILES | [Os] |
| Formule moléculaire | Os |
Osmium tetroxide, 2.5 wt.% solution in tert-Butanol, stabilized
CAS: 20816-12-0 | O4Os | 254.23 g/mol
| Poids moléculaire (g/mol) | 254.23 |
|---|---|
| Numéro RTECS | RN1140000 |
| Formule linéaire | OsO4 |
| Gravité spécifique | 0.811 |
| Forme physique | Crystals, Fused Mass or Solution |
| Nom chimique ou matériau | Osmium tetroxide |
| Fieser | 01,759; 02,301; 04,361; 05,141; 06,424; 10,290; 12,358; 13,186; 14,235; 15,240; 16,249; 17,236 |
| Nom IUPAC | tetraoxoosmium |
| Clé InChI | VUVGYHUDAICLFK-UHFFFAOYSA-N |
| Danger pour la santé 3 | GHS P Statement Wear protective gloves/protective clothing/eye protection/face protection. Keep away from heat/sparks/open flames/hot surfaces. - No smoking. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rin |
| Danger pour la santé 1 | GHS Signal Word: Danger |
| Danger pour la santé 2 | GHS H Statement Toxic if inhaled. Harmful if swallowed. Fatal in contact with skin. Causes skin irritation. Causes serious eye irritation. May cause respiratory irritation. May cause allergy or asthma symptoms o |
| Conditionnement | Glass bottle |
| SMILES | O=[Os](=O)(=O)=O |
| Merck Index | 15, 6990 |
| Poids de la formule | 254.2 |
| Formule moléculaire | O4Os |
| Point d’éclair | 4°C |
| Couleur | White to Yellow |
| Synonyme | osmium tetroxide,osmium tetraoxide,osmic acid,perosmic oxide,osmic acid anhydride,osmium viii oxide,oso4,perosmic acid anhydride,osmiumtetroxide,osmium oxide, t-4 |
| Numéro MDL | MFCD00011150 |
| Concentration or Composition (by Analyte or Components) | 2.5 wt% Min. |
| Numéro EINECS | 244-058-7 |
| CAS | 75-65-0 |
| CID PubChem | 30318 |
| TSCA | TSCA |
| Densité | 0.8110g/mL |
Osmium(VIII) oxide, 99.8% (metals basis), Os 74.4% min
CAS: 20816-12-0 Formule moléculaire: O4Os Poids moléculaire (g/mol): 254.23 Numéro MDL: MFCD00011150 Clé InChI: VUVGYHUDAICLFK-UHFFFAOYSA-N Synonyme: osmium tetroxide,osmium tetraoxide,osmic acid,perosmic oxide,osmic acid anhydride,osmium viii oxide,oso4,perosmic acid anhydride,osmiumtetroxide,osmium oxide, t-4 CID PubChem: 30318 Nom IUPAC: tetraoxoosmium SMILES: O=[Os](=O)(=O)=O
| Poids moléculaire (g/mol) | 254.23 |
|---|---|
| Synonyme | osmium tetroxide,osmium tetraoxide,osmic acid,perosmic oxide,osmic acid anhydride,osmium viii oxide,oso4,perosmic acid anhydride,osmiumtetroxide,osmium oxide, t-4 |
| Numéro MDL | MFCD00011150 |
| CAS | 20816-12-0 |
| CID PubChem | 30318 |
| Nom IUPAC | tetraoxoosmium |
| Clé InChI | VUVGYHUDAICLFK-UHFFFAOYSA-N |
| SMILES | O=[Os](=O)(=O)=O |
| Formule moléculaire | O4Os |
Osmium(III) chloride trihydrate, Premion™, 99.99% (metals basis), Os 52-56%
CAS: 135296-80-9 Formule moléculaire: Cl3H6O3Os Poids moléculaire (g/mol): 350.625 Numéro MDL: MFCD00011148 Clé InChI: UACQLNPCDXDCID-UHFFFAOYSA-K Synonyme: osmium iii chloride trihydrate,osmium trichloride trihydrate,cl3os.3h2o,acmc-20ak04,trichloroosmium-water 1/3,trichloroosmium trihydrate,osmium iii chloride trihydrate, premion CID PubChem: 57348105 Nom IUPAC: trichloroosmium;trihydrate SMILES: O.O.O.Cl[Os](Cl)Cl
| Poids moléculaire (g/mol) | 350.625 |
|---|---|
| Synonyme | osmium iii chloride trihydrate,osmium trichloride trihydrate,cl3os.3h2o,acmc-20ak04,trichloroosmium-water 1/3,trichloroosmium trihydrate,osmium iii chloride trihydrate, premion |
| Numéro MDL | MFCD00011148 |
| CAS | 135296-80-9 |
| CID PubChem | 57348105 |
| Nom IUPAC | trichloroosmium;trihydrate |
| Clé InChI | UACQLNPCDXDCID-UHFFFAOYSA-K |
| SMILES | O.O.O.Cl[Os](Cl)Cl |
| Formule moléculaire | Cl3H6O3Os |
Dodecacarbonyltriosmium, 99%
CAS: 15696-40-9 Formule moléculaire: C12O12Os3 Poids moléculaire (g/mol): 906.81 Numéro MDL: MFCD00011149 Clé InChI: VUBLMKVEIPBYME-UHFFFAOYSA-N Synonyme: osmium carbonyl,triangulo-dodecacarbonyltriosmium,triosmium dodecacarbonyl,tri-osmium dodecacarbonyl CID PubChem: 6096995 Nom IUPAC: carbon monoxide;osmium SMILES: [C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[Os].[Os].[Os]
| Poids moléculaire (g/mol) | 906.81 |
|---|---|
| Synonyme | osmium carbonyl,triangulo-dodecacarbonyltriosmium,triosmium dodecacarbonyl,tri-osmium dodecacarbonyl |
| Numéro MDL | MFCD00011149 |
| CAS | 15696-40-9 |
| CID PubChem | 6096995 |
| Nom IUPAC | carbon monoxide;osmium |
| Clé InChI | VUBLMKVEIPBYME-UHFFFAOYSA-N |
| SMILES | [C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[Os].[Os].[Os] |
| Formule moléculaire | C12O12Os3 |
Ammonium hexachloroosmate(IV), 99.99%, (trace metal basis)
CAS: 12125-08-5 Formule moléculaire: Cl6H8N2Os Poids moléculaire (g/mol): 439.00 Numéro MDL: MFCD00010883 Clé InChI: JRHMYOOMZKAPKT-UHFFFAOYSA-J Synonyme: ammonium hexachloroosmate iv,nh4 2oscl6,osmium iv-ammonium chloride,diazanium;hexachloroosmium 2-,diammonium hexachloroosmiumdiuide,ammonium hexachloroosmiate iv , premion CID PubChem: 11729867 Nom IUPAC: diammonium hexachloroosmiumtetrakis(ylium) SMILES: [NH4+].[NH4+].Cl[Os+4](Cl)(Cl)(Cl)(Cl)Cl
| Poids moléculaire (g/mol) | 439.00 |
|---|---|
| Synonyme | ammonium hexachloroosmate iv,nh4 2oscl6,osmium iv-ammonium chloride,diazanium;hexachloroosmium 2-,diammonium hexachloroosmiumdiuide,ammonium hexachloroosmiate iv , premion |
| Numéro MDL | MFCD00010883 |
| CAS | 12125-08-5 |
| CID PubChem | 11729867 |
| Nom IUPAC | diammonium hexachloroosmiumtetrakis(ylium) |
| Clé InChI | JRHMYOOMZKAPKT-UHFFFAOYSA-J |
| SMILES | [NH4+].[NH4+].Cl[Os+4](Cl)(Cl)(Cl)(Cl)Cl |
| Formule moléculaire | Cl6H8N2Os |