Chemicals
Filtered Search Results
Thermo Scientific Chemicals Meglumine antimoniate
CAS: 133-51-7 Molecular Formula: C7H17NO5·HO3Sb Molecular Weight (g/mol): 365.97 InChI Key: YPAUTKZODZLFQM-OVHUINQISA-K PubChem CID: 131664208 IUPAC Name: antimony(3+);(2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol;trihydroxide;hydrate SMILES: CNCC(C(C(C(CO)O)O)O)O.O.[OH-].[OH-].[OH-].[Sb+3]
| PubChem CID | 131664208 |
|---|---|
| CAS | 133-51-7 |
| Molecular Weight (g/mol) | 365.97 |
| SMILES | CNCC(C(C(C(CO)O)O)O)O.O.[OH-].[OH-].[OH-].[Sb+3] |
| IUPAC Name | antimony(3+);(2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol;trihydroxide;hydrate |
| InChI Key | YPAUTKZODZLFQM-OVHUINQISA-K |
| Molecular Formula | C7H17NO5·HO3Sb |
Antimony trichloride, 99.5%
CAS: 10025-91-9 Molecular Formula: Cl3Sb Molecular Weight (g/mol): 228.11 MDL Number: MFCD00011212 InChI Key: FAPDDOBMIUGHIN-UHFFFAOYSA-K Synonym: antimony trichloride,trichlorostibine,antimony chloride,antimony iii chloride,stibine, trichloro,antimontrichlorid,antimonous chloride,butter of antimony,antimony butter,caustic antimony PubChem CID: 24814 ChEBI: CHEBI:74856 SMILES: [Cl-].[Cl-].[Cl-].[Sb+3]
| PubChem CID | 24814 |
|---|---|
| CAS | 10025-91-9 |
| Molecular Weight (g/mol) | 228.11 |
| ChEBI | CHEBI:74856 |
| MDL Number | MFCD00011212 |
| SMILES | [Cl-].[Cl-].[Cl-].[Sb+3] |
| Synonym | antimony trichloride,trichlorostibine,antimony chloride,antimony iii chloride,stibine, trichloro,antimontrichlorid,antimonous chloride,butter of antimony,antimony butter,caustic antimony |
| InChI Key | FAPDDOBMIUGHIN-UHFFFAOYSA-K |
| Molecular Formula | Cl3Sb |
Antimony trifluoride, 98%
CAS: 7783-56-4 Molecular Formula: F3Sb Molecular Weight (g/mol): 178.76 MDL Number: MFCD00011218 InChI Key: GUNJVIDCYZYFGV-UHFFFAOYSA-K Synonym: antimony trifluoride,trifluorostibine,antimony fluoride,antimony iii fluoride,stibine, trifluoro,trifluoroantimony,antimoine fluorure,antimonous fluoride,antimoine fluorure french,hsdb 438 PubChem CID: 24554 IUPAC Name: trifluorostibane SMILES: F[Sb](F)F
| PubChem CID | 24554 |
|---|---|
| CAS | 7783-56-4 |
| Molecular Weight (g/mol) | 178.76 |
| MDL Number | MFCD00011218 |
| SMILES | F[Sb](F)F |
| Synonym | antimony trifluoride,trifluorostibine,antimony fluoride,antimony iii fluoride,stibine, trifluoro,trifluoroantimony,antimoine fluorure,antimonous fluoride,antimoine fluorure french,hsdb 438 |
| IUPAC Name | trifluorostibane |
| InChI Key | GUNJVIDCYZYFGV-UHFFFAOYSA-K |
| Molecular Formula | F3Sb |
Antimony trichloride, ACS reagent
CAS: 10025-91-9 Molecular Formula: Cl3Sb Molecular Weight (g/mol): 228.11 MDL Number: MFCD00011212 InChI Key: FAPDDOBMIUGHIN-UHFFFAOYSA-K Synonym: antimony trichloride,trichlorostibine,antimony chloride,antimony iii chloride,stibine, trichloro,antimontrichlorid,antimonous chloride,butter of antimony,antimony butter,caustic antimony PubChem CID: 24814 ChEBI: CHEBI:74856 SMILES: [Cl-].[Cl-].[Cl-].[Sb+3]
| PubChem CID | 24814 |
|---|---|
| CAS | 10025-91-9 |
| Molecular Weight (g/mol) | 228.11 |
| ChEBI | CHEBI:74856 |
| MDL Number | MFCD00011212 |
| SMILES | [Cl-].[Cl-].[Cl-].[Sb+3] |
| Synonym | antimony trichloride,trichlorostibine,antimony chloride,antimony iii chloride,stibine, trichloro,antimontrichlorid,antimonous chloride,butter of antimony,antimony butter,caustic antimony |
| InChI Key | FAPDDOBMIUGHIN-UHFFFAOYSA-K |
| Molecular Formula | Cl3Sb |
Antimony tribromide, 97%, pure
CAS: 7789-61-9 Molecular Formula: Br3Sb Molecular Weight (g/mol): 361.48 InChI Key: RPJGYLSSECYURW-UHFFFAOYSA-K Synonym: antimony tribromide,antimony iii bromide,antimony bromide,tribromostibine,stibine, tribromo,antimonous bromide,antimony bromide sbbr3,unii-6pm239qd86,hsdb 441,sbbr3 PubChem CID: 24615 IUPAC Name: tribromostibane SMILES: Br[Sb](Br)Br
| PubChem CID | 24615 |
|---|---|
| CAS | 7789-61-9 |
| Molecular Weight (g/mol) | 361.48 |
| SMILES | Br[Sb](Br)Br |
| Synonym | antimony tribromide,antimony iii bromide,antimony bromide,tribromostibine,stibine, tribromo,antimonous bromide,antimony bromide sbbr3,unii-6pm239qd86,hsdb 441,sbbr3 |
| IUPAC Name | tribromostibane |
| InChI Key | RPJGYLSSECYURW-UHFFFAOYSA-K |
| Molecular Formula | Br3Sb |
Antimony(III) acetate, 97%
CAS: 6923-52-0 Molecular Formula: C6H9O6Sb Molecular Weight (g/mol): 298.892 MDL Number: MFCD00014974 InChI Key: JVLRYPRBKSMEBF-UHFFFAOYSA-K Synonym: antimony triacetate,antimony iii acetate,antimony acetate,acetic acid, antimony 3+ salt,octan antimonity czech,antimony 3+ triacetate,acetic acid, antimony 3+ salt 3:1,acetic acid, trianhydride with antimonic acid h3sbo3,acetic acid, antimony salt,octan antimonity PubChem CID: 23354 IUPAC Name: antimony(3+);triacetate SMILES: CC(=O)[O-].CC(=O)[O-].CC(=O)[O-].[Sb+3]
| PubChem CID | 23354 |
|---|---|
| CAS | 6923-52-0 |
| Molecular Weight (g/mol) | 298.892 |
| MDL Number | MFCD00014974 |
| SMILES | CC(=O)[O-].CC(=O)[O-].CC(=O)[O-].[Sb+3] |
| Synonym | antimony triacetate,antimony iii acetate,antimony acetate,acetic acid, antimony 3+ salt,octan antimonity czech,antimony 3+ triacetate,acetic acid, antimony 3+ salt 3:1,acetic acid, trianhydride with antimonic acid h3sbo3,acetic acid, antimony salt,octan antimonity |
| IUPAC Name | antimony(3+);triacetate |
| InChI Key | JVLRYPRBKSMEBF-UHFFFAOYSA-K |
| Molecular Formula | C6H9O6Sb |
Antimony(III) bromide, 99%
CAS: 7789-61-9 Molecular Formula: Br3Sb Molecular Weight (g/mol): 361.472 MDL Number: MFCD00016317 InChI Key: RPJGYLSSECYURW-UHFFFAOYSA-K Synonym: antimony tribromide,antimony iii bromide,antimony bromide,tribromostibine,stibine, tribromo,antimonous bromide,antimony bromide sbbr3,unii-6pm239qd86,hsdb 441,sbbr3 PubChem CID: 24615 IUPAC Name: tribromostibane SMILES: Br[Sb](Br)Br
| PubChem CID | 24615 |
|---|---|
| CAS | 7789-61-9 |
| Molecular Weight (g/mol) | 361.472 |
| MDL Number | MFCD00016317 |
| SMILES | Br[Sb](Br)Br |
| Synonym | antimony tribromide,antimony iii bromide,antimony bromide,tribromostibine,stibine, tribromo,antimonous bromide,antimony bromide sbbr3,unii-6pm239qd86,hsdb 441,sbbr3 |
| IUPAC Name | tribromostibane |
| InChI Key | RPJGYLSSECYURW-UHFFFAOYSA-K |
| Molecular Formula | Br3Sb |
Antimony(III) fluoride, 98%
CAS: 7783-56-4 Molecular Formula: F3Sb Molecular Weight (g/mol): 178.76 MDL Number: MFCD00011218 InChI Key: GUNJVIDCYZYFGV-UHFFFAOYSA-K Synonym: antimony trifluoride,trifluorostibine,antimony fluoride,antimony iii fluoride,stibine, trifluoro,trifluoroantimony,antimoine fluorure,antimonous fluoride,antimoine fluorure french,hsdb 438 PubChem CID: 24554 IUPAC Name: trifluorostibane SMILES: F[Sb](F)F
| PubChem CID | 24554 |
|---|---|
| CAS | 7783-56-4 |
| Molecular Weight (g/mol) | 178.76 |
| MDL Number | MFCD00011218 |
| SMILES | F[Sb](F)F |
| Synonym | antimony trifluoride,trifluorostibine,antimony fluoride,antimony iii fluoride,stibine, trifluoro,trifluoroantimony,antimoine fluorure,antimonous fluoride,antimoine fluorure french,hsdb 438 |
| IUPAC Name | trifluorostibane |
| InChI Key | GUNJVIDCYZYFGV-UHFFFAOYSA-K |
| Molecular Formula | F3Sb |
Antimony(III) oxide, 99+%
CAS: 1309-64-4 Molecular Formula: O3Sb2 Molecular Weight (g/mol): 291.52 MDL Number: MFCD00011214 InChI Key: GHPGOEFPKIHBNM-UHFFFAOYSA-N Synonym: Antimony trioxide IUPAC Name: diantimony(3+) trioxidandiide SMILES: [O--].[O--].[O--].[Sb+3].[Sb+3]
| CAS | 1309-64-4 |
|---|---|
| Molecular Weight (g/mol) | 291.52 |
| MDL Number | MFCD00011214 |
| SMILES | [O--].[O--].[O--].[Sb+3].[Sb+3] |
| Synonym | Antimony trioxide |
| IUPAC Name | diantimony(3+) trioxidandiide |
| InChI Key | GHPGOEFPKIHBNM-UHFFFAOYSA-N |
| Molecular Formula | O3Sb2 |
Antimony(III) sulfide, 98%
CAS: 1345-04-6 Molecular Formula: S3Sb2 Molecular Weight (g/mol): 339.70 MDL Number: MFCD00011217 InChI Key: NVWBARWTDVQPJD-UHFFFAOYSA-N Synonym: Antimony trisulfide IUPAC Name: diantimony(3+) trisulfanediide SMILES: [S--].[S--].[S--].[Sb+3].[Sb+3]
| CAS | 1345-04-6 |
|---|---|
| Molecular Weight (g/mol) | 339.70 |
| MDL Number | MFCD00011217 |
| SMILES | [S--].[S--].[S--].[Sb+3].[Sb+3] |
| Synonym | Antimony trisulfide |
| IUPAC Name | diantimony(3+) trisulfanediide |
| InChI Key | NVWBARWTDVQPJD-UHFFFAOYSA-N |
| Molecular Formula | S3Sb2 |
Antimony(III) chloride, 99+%
CAS: 10025-91-9 Molecular Formula: Cl3Sb Molecular Weight (g/mol): 228.11 MDL Number: MFCD00011212 InChI Key: FAPDDOBMIUGHIN-UHFFFAOYSA-K Synonym: antimony trichloride,trichlorostibine,antimony chloride,antimony iii chloride,stibine, trichloro,antimontrichlorid,antimonous chloride,butter of antimony,antimony butter,caustic antimony PubChem CID: 24814 ChEBI: CHEBI:74856 SMILES: [Cl-].[Cl-].[Cl-].[Sb+3]
| PubChem CID | 24814 |
|---|---|
| CAS | 10025-91-9 |
| Molecular Weight (g/mol) | 228.11 |
| ChEBI | CHEBI:74856 |
| MDL Number | MFCD00011212 |
| SMILES | [Cl-].[Cl-].[Cl-].[Sb+3] |
| Synonym | antimony trichloride,trichlorostibine,antimony chloride,antimony iii chloride,stibine, trichloro,antimontrichlorid,antimonous chloride,butter of antimony,antimony butter,caustic antimony |
| InChI Key | FAPDDOBMIUGHIN-UHFFFAOYSA-K |
| Molecular Formula | Cl3Sb |
Antimony(III) fluoride, 99+%
CAS: 7783-56-4 Molecular Formula: F3Sb Molecular Weight (g/mol): 178.76 MDL Number: MFCD00011218 InChI Key: GUNJVIDCYZYFGV-UHFFFAOYSA-K Synonym: antimony trifluoride,trifluorostibine,antimony fluoride,antimony iii fluoride,stibine, trifluoro,trifluoroantimony,antimoine fluorure,antimonous fluoride,antimoine fluorure french,hsdb 438 PubChem CID: 24554 IUPAC Name: trifluorostibane SMILES: F[Sb](F)F
| PubChem CID | 24554 |
|---|---|
| CAS | 7783-56-4 |
| Molecular Weight (g/mol) | 178.76 |
| MDL Number | MFCD00011218 |
| SMILES | F[Sb](F)F |
| Synonym | antimony trifluoride,trifluorostibine,antimony fluoride,antimony iii fluoride,stibine, trifluoro,trifluoroantimony,antimoine fluorure,antimonous fluoride,antimoine fluorure french,hsdb 438 |
| IUPAC Name | trifluorostibane |
| InChI Key | GUNJVIDCYZYFGV-UHFFFAOYSA-K |
| Molecular Formula | F3Sb |
Antimony(III) oxide, 99%
CAS: 1309-64-4 Molecular Formula: O3Sb2 Molecular Weight (g/mol): 291.52 MDL Number: MFCD00011214 InChI Key: GHPGOEFPKIHBNM-UHFFFAOYSA-N IUPAC Name: diantimony(3+) trioxidandiide SMILES: [O--].[O--].[O--].[Sb+3].[Sb+3]
| CAS | 1309-64-4 |
|---|---|
| Molecular Weight (g/mol) | 291.52 |
| MDL Number | MFCD00011214 |
| SMILES | [O--].[O--].[O--].[Sb+3].[Sb+3] |
| IUPAC Name | diantimony(3+) trioxidandiide |
| InChI Key | GHPGOEFPKIHBNM-UHFFFAOYSA-N |
| Molecular Formula | O3Sb2 |
Antimony(V)-chloride, 99%, anhydrous
CAS: 7647-18-9 Molecular Formula: Cl5Sb Molecular Weight (g/mol): 299.02 MDL Number: MFCD00011213 InChI Key: VMPVEPPRYRXYNP-UHFFFAOYSA-I Synonym: antimony v chloride,antimony pentachloride,pentachloroantimony,antimony perchloride,antimony chloride sbcl5,antimonpentachlorid,antimoonpentachloride,perchlorure d'antimoine,pentachlorure d'antimoine,antimonpentachlorid german PubChem CID: 24294 IUPAC Name: pentachloro-$l^{5}-stibane SMILES: Cl[Sb](Cl)(Cl)(Cl)Cl
| PubChem CID | 24294 |
|---|---|
| CAS | 7647-18-9 |
| Molecular Weight (g/mol) | 299.02 |
| MDL Number | MFCD00011213 |
| SMILES | Cl[Sb](Cl)(Cl)(Cl)Cl |
| Synonym | antimony v chloride,antimony pentachloride,pentachloroantimony,antimony perchloride,antimony chloride sbcl5,antimonpentachlorid,antimoonpentachloride,perchlorure d'antimoine,pentachlorure d'antimoine,antimonpentachlorid german |
| IUPAC Name | pentachloro-$l^{5}-stibane |
| InChI Key | VMPVEPPRYRXYNP-UHFFFAOYSA-I |
| Molecular Formula | Cl5Sb |
Antimony potassium tartrate hydrate, 98%
CAS: 331753-56-1 Molecular Formula: C8H4K2O12Sb2 Molecular Weight (g/mol): 613.83 MDL Number: MFCD00148863 InChI Key: GUJUCWZGYWASLH-UHFFFAOYNA-J Synonym: potassium antimony tartrate hydrate,potassium antimony iii tartrate hydrate,acmc-20ajv8,antimony 3+ potassium hydrate ditartrate IUPAC Name: dipotassium 5,11-dioxo-2,6,8,12,13,14-hexaoxa-1,7-distibatricyclo[8.2.1.1⁴,⁷]tetradecane-3,9-dicarboxylate SMILES: [K+].[K+].[O-]C(=O)C1O[Sb]2OC(C(O[Sb]3OC1C(=O)O3)C([O-])=O)C(=O)O2
| CAS | 331753-56-1 |
|---|---|
| Molecular Weight (g/mol) | 613.83 |
| MDL Number | MFCD00148863 |
| SMILES | [K+].[K+].[O-]C(=O)C1O[Sb]2OC(C(O[Sb]3OC1C(=O)O3)C([O-])=O)C(=O)O2 |
| Synonym | potassium antimony tartrate hydrate,potassium antimony iii tartrate hydrate,acmc-20ajv8,antimony 3+ potassium hydrate ditartrate |
| IUPAC Name | dipotassium 5,11-dioxo-2,6,8,12,13,14-hexaoxa-1,7-distibatricyclo[8.2.1.1⁴,⁷]tetradecane-3,9-dicarboxylate |
| InChI Key | GUJUCWZGYWASLH-UHFFFAOYNA-J |
| Molecular Formula | C8H4K2O12Sb2 |