missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Zinc phthalocyanine, 98%, ACROS Organics™
$54.50 - $54.50
Chemical Identifiers
| CAS | 14320-04-8 |
|---|---|
| Molecular Formula | C32H16N8Zn |
| Molecular Weight (g/mol) | 577.916 |
| InChI Key | PODBBOVVOGJETB-UHFFFAOYSA-N |
| Synonym | zinc phthalocyanine, znpc, phthalocyanine zinc, zinc ii phthalocyanine, phthalocyanine, zinc, zinc phthalocyanine, dye content 97 % |
| PubChem CID | 2735172 |
| ChEBI | CHEBI:51218 |
| SMILES | C1=CC=C2C(=C1)C3=NC4=NC(=NC5=C6C=CC=CC6=C([N-]5)N=C7C8=CC=CC=C8C(=N7)N=C2[N-]3)C9=CC=CC=C94.[Zn+2] |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
| AC422750050 SDS |
Acros Organics
422750050 |
5g |
Each for $54.50
|
|
AC422750250 SDS |
Acros Organics
422750250 |
25g | N/A | N/A |
| Please call Customer Service at 1-800-234-7437 or send an email to help@thermofisher.com for assistance. | |||||||||
Chemical Identifiers
| 14320-04-8 | |
| 577.916 | |
| zinc phthalocyanine, znpc, phthalocyanine zinc, zinc ii phthalocyanine, phthalocyanine, zinc, zinc phthalocyanine, dye content 97 % | |
| CHEBI:51218 |
| C32H16N8Zn | |
| PODBBOVVOGJETB-UHFFFAOYSA-N | |
| 2735172 | |
| C1=CC=C2C(=C1)C3=NC4=NC(=NC5=C6C=CC=CC6=C([N-]5)N=C7C8=CC=CC=C8C(=N7)N=C2[N-]3)C9=CC=CC=C94.[Zn+2] |
Specifications
| Authentic | |
| Glass bottle | |
| 5g | |
| 96% | |
| zinc phthalocyanine, znpc, phthalocyanine zinc, zinc ii phthalocyanine, phthalocyanine, zinc, zinc phthalocyanine, dye content 97 % | |
| C1=CC=C2C(=C1)C3=NC4=NC(=NC5=C6C=CC=CC6=C([N-]5)N=C7C8=CC=CC=C8C(=N7)N=C2[N-]3)C9=CC=CC=C94.[Zn+2] | |
| 2735172 | |
| 577.91 | |
| Zinc phthalocyanine, 98% |
| 5% max. (105°C) | |
| Purple | |
| 14320-04-8 | |
| C32H16N8Zn | |
| PODBBOVVOGJETB-UHFFFAOYSA-N | |
| 577.916 | |
| CHEBI:51218 | |
| Powder |