missing translation for 'onlineSavingsMsg'
Learn More
Learn More
VeriSpec™ Single Element Environmental Standard, Ricca Chemical
10 mg/L Hg /nManufactured and Tested in an ISO 17025/Guide 34 Facility
Supplier: Ricca Chemical Company RV010838100N
Description
- Manufactured and tested in an ISO 17025/Guide 34 Accredited facility
- Product accompanied with detailed Certificate of Analysis
Specifications
| Mercury Standard | |
| 10045-94-0,10045-94-0 | |
| 5.10%,0.00% | |
| Liquid | |
| MFCD00011038 | |
| Colorless | |
| AA, ICP, ICP/MS, IC, XRF, and Other Analytical Instrumentation | |
| Calibration Standard | |
| ORMNPSYMZOGSSV-UHFFFAOYSA-N | |
| mercury(2+) dinitrate | |
| 100 mL | |
| High Purity |
| Natural LDPE Bottle | |
| 4.90%,0.00% | |
| 1.03 | |
| HgN2O6 | |
| UN3264 | |
| Approximately 0°C | |
| Miscible with water | |
| ICP Single-element Standard Solution | |
| [Hg++].[O-][N+]([O-])=O.[O-][N+]([O-])=O | |
| 324.60 | |
| 24864 |
Chemical Identifiers
| 10045-94-0 | |
| 324.60 | |
| ORMNPSYMZOGSSV-UHFFFAOYSA-N | |
| mercury(2+) dinitrate |
| HgN2O6 | |
| MFCD00011038 | |
| 24864 | |
| [Hg++].[O-][N+]([O-])=O.[O-][N+]([O-])=O |