missing translation for 'onlineSavingsMsg'
Learn More
Learn More
VeriSpec™ Palladium Standard for ICP 10 g/L 5% HNO3, Ricca Chemical
Manufactured and Tested in an ISO 17025/Guide 34 Accredited Facility
Supplier: Ricca Chemical Company RV010474100N
Description
- 10 g/L 5% HNO3
- Manufactured and tested in an ISO 17025/Guide 34 Accredited facility
- Product accompanied with detailed Certificate of Analysis
Specifications
| Palladium ICP Standard | |
| 10102-05-3,7697-37-2,7732-18-5 | |
| 94.70%,5.10%,2.21% | |
| Liquid | |
| MFCD00011169 | |
| Colorless | |
| Approximately 0°C | |
| Miscible with water | |
| Standard | |
| [Pd++].[O-][N+]([O-])=O.[O-][N+]([O-])=O | |
| 230.43 | |
| 24932 |
| Natural LDPE Bottle | |
| 90.98%,4.90%,2.13% | |
| 1 | |
| N2O6Pd | |
| UN3264 | |
| <2 | |
| AA, ICP, ICP/MS, IC, XRF, and Other Analytical Instrumentation | |
| Calibration Standard | |
| GPNDARIEYHPYAY-UHFFFAOYSA-N | |
| palladium(2+) dinitrate | |
| 100 mL | |
| High Purity |