missing translation for 'onlineSavingsMsg'
Learn More
Learn More
VeriSpec™ Lead Standard for ICP 1000 ppm in 2% HNO3, Ricca Chemical
Manufactured and Tested in an ISO 17025/Guide 34 Accredited Facility
Supplier: Ricca Chemical Company RV010301250N
Description
- 1000 ppm in 2% HNO3
- Manufactured and tested in an ISO 17025/Guide 34 Accredited facility
- Product accompanied with detailed Certificate of Analysis
Specifications
| Natural Poly Bottle | |
| 95.88%,1.96%,0.16% | |
| 1 | |
| N2O6Pb | |
| Approximately 0°C | |
| RLJMLMKIBZAXJO-UHFFFAOYSA-N | |
| λ2-lead(2+) dinitrate | |
| 250 mL | |
| CHEBI:37187 |
| 10099-74-8,7697-37-2,7732-18-5 | |
| 99.80%,2.04%,0.16% | |
| Liquid | |
| MFCD00011153 | |
| Standard | |
| [Pb++].[O-][N+]([O-])=O.[O-][N+]([O-])=O | |
| 331.20 | |
| 24924 | |
| High Purity |
Chemical Identifiers
| 10099-74-8 | |
| 331.20 | |
| RLJMLMKIBZAXJO-UHFFFAOYSA-N | |
| CHEBI:37187 | |
| [Pb++].[O-][N+]([O-])=O.[O-][N+]([O-])=O |
| N2O6Pb | |
| MFCD00011153 | |
| 24924 | |
| λ2-lead(2+) dinitrate |