missing translation for 'onlineSavingsMsg'
Learn More
Learn More
VeriSpec™ Cadmium Standard for ICP 10 g/L in 5% HNO3, Ricca Chemical
Manufactured and Tested in an ISO 17025/Guide 34 Accredited Facility
Supplier: Ricca Chemical Company RV010372100N
Description
- 10 g/L in 5% HNO3
- Manufactured and tested in an ISO 17025/Guide 34 Accredited facility
- Product accompanied with detailed Certificate of Analysis
Specifications
| Cadmium ICP Standard | |
| 10325-94-7,7697-37-2,7732-18-5 | |
| 94.76%,5.10%,2.14% | |
| Liquid | |
| UN3264 | |
| <2 | |
| AA, ICP, ICP/MS, IC, XRF, and Other Analytical Instrumentation | |
| Calibration Standard | |
| XIEPJMXMMWZAAV-UHFFFAOYSA-N | |
| cadmium(2+);dinitrate | |
| 100 mL | |
| CHEBI:77732 |
| Natural LDPE Bottle | |
| 91.04%,4.90%,2.06% | |
| 1 | |
| CdN2O6 | |
| Colorless | |
| Approximately 0°C | |
| Miscible with water | |
| Standard | |
| [N+](=O)([O-])[O-].[N+](=O)([O-])[O-].[Cd+2] | |
| 236.422 | |
| 25154 | |
| High Purity |