missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Triton™ X-100, Ricca Chemical
Wetting Agent
Supplier: Ricca Chemical Company 869855
Specifications
| Triton™ X-100 Wetting Agent | |
| 9002-93-1 | |
| 0.98 | |
| 100% | |
| 20 L | |
| C16H26O2 | |
| JYCQQPHGFMYQCF-UHFFFAOYSA-N | |
| 2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethan-1-ol | |
| 5590 |
| Colorless | |
| Viscous Liquid | |
| 1.0 | |
| 6 | |
| Cubitainer | |
| MFCD00132505 | |
| CC(C)(C)CC(C)(C)C1=CC=C(OCCO)C=C1 | |
| 250.38 | |
| Laboratory |
Chemical Identifiers
| 9002-93-1 | |
| 250.38 | |
| JYCQQPHGFMYQCF-UHFFFAOYSA-N | |
| 2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethan-1-ol |
| C16H26O2 | |
| MFCD00132505 | |
| 5590 | |
| CC(C)(C)CC(C)(C)C1=CC=C(OCCO)C=C1 |
Safety and Handling
ShelfLife : 24 months
Triton is a trademark of Union Carbide Corporation, a wholly owned subsidiary of The Dow Chemical Company.