missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Triphenylmethanol, 97%
CAS: 76-84-6 | C19H16O | 260.34 g/mol
Supplier: Thermo Scientific Chemicals 158912500
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Triphenylmethanol | |
| 160°C to 164°C | |
| 360°C | |
| 97% | |
| C19H16O | |
| MFCD00004445,MFCD10565638 | |
| 06,713 | |
| triphenylcarbinol, trityl alcohol, tritanol, triphenylmethyl alcohol, triphenyl methanol, triphenyl carbinol, methanol, triphenyl, unii-u97q0ou9kb, triphenyl-methanol, benzenemethanol, .alpha.,.alpha.-diphenyl | |
| LZTRCELOJRDYMQ-UHFFFAOYSA-N | |
| triphenylmethanol | |
| 6457 | |
| 97% |
| 76-84-6 | |
| White to Yellow | |
| Authentic | |
| Plastic bottle | |
| (C6H5)3COH | |
| 250 g | |
| 15,9912 | |
| Solubility in water: insoluble. Other solubilities: soluble in conc. h2so4 and glacial acetic acid,soluble in alcohol,ether and benzene | |
| OC(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 | |
| 260.34 | |
| 260.32 | |
| Fine Crystalline Powder |
Chemical Identifiers
| 76-84-6 | |
| 260.34 | |
| LZTRCELOJRDYMQ-UHFFFAOYSA-N | |
| 6457 | |
| OC(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 |
| C19H16O | |
| MFCD00004445,MFCD10565638 | |
| triphenylcarbinol, trityl alcohol, tritanol, triphenylmethyl alcohol, triphenyl methanol, triphenyl carbinol, methanol, triphenyl, unii-u97q0ou9kb, triphenyl-methanol, benzenemethanol, .alpha.,.alpha.-diphenyl | |
| triphenylmethanol |
Safety and Handling
EINECSNumber : 200-988-5
RUO – Research Use Only