Learn More
Triphenylacetic acid, 99%
CAS: 595-91-5 | C20H16O2 | 288.35 g/mol
Supplier: Thermo Scientific Chemicals 140300100
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Triphenylacetic acid | |
| 595-91-5 | |
| White to Beige | |
| 99% | |
| C20H16O2 | |
| MFCD00004185 | |
| 09, 712 | |
| DCYGAPKNVCQNOE-UHFFFAOYSA-N | |
| 2,2,2-triphenylacetic acid | |
| 68992 | |
| 99% |
| 99% | |
| 268°C to 269°C | |
| Authentic | |
| Glass bottle | |
| (C6H5)3CCO2H | |
| 10 g | |
| triphenylacetic acid, acetic acid, triphenyl, triphenyl acetic acid, benzeneacetic acid, .alpha.,.alpha.-diphenyl, nsc 61, tri phenylacetic acid, pubchem9200, alpha-toluic acid, alpha,alpha-diphenyl, acmc-1arvb, maybridge1_006927 | |
| OC(=O)C(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 | |
| 288.35 | |
| 288.34 | |
| Fine Crystalline Powder |
Chemical Identifiers
| 595-91-5 | |
| 288.35 | |
| DCYGAPKNVCQNOE-UHFFFAOYSA-N | |
| 68992 | |
| OC(=O)C(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 |
| C20H16O2 | |
| MFCD00004185 | |
| triphenylacetic acid, acetic acid, triphenyl, triphenyl acetic acid, benzeneacetic acid, .alpha.,.alpha.-diphenyl, nsc 61, tri phenylacetic acid, pubchem9200, alpha-toluic acid, alpha,alpha-diphenyl, acmc-1arvb, maybridge1_006927 | |
| 2,2,2-triphenylacetic acid |
Safety and Handling
GHS H Statement
May cause long lasting harmful effects to aquatic life.
GHS P Statement
Avoid release to the environment.
EINECSNumber : 209-873-4
RUO – Research Use Only