missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Triisopropanolamine cyclic borate, 98+%
CAS: 101-00-8 | C9H18BNO3 | 199.06 g/mol
$480.40 - $480.40
Chemical Identifiers
| CAS | 101-00-8 |
|---|---|
| Molecular Formula | C9H18BNO3 |
| Molecular Weight (g/mol) | 199.06 |
| MDL Number | MFCD03791298 |
| InChI Key | IWKGJTDSJPLUCE-UHFFFAOYSA-N |
| Synonym | triisopropanolamine cyclic borate, 3,7,10-trimethyl-2,8,9-trioxa-5-aza-1-borabicyclo 3.3.3 undecane, borester 21, triisopropanolamine borate, boric acid, tris 1-amino-2-propyl ester, 2-propanol, 1,1',1-nitrilotri-, cyclic borate, 3,7,10-trimethyl-4,6,11-trioxa-1-aza-5-borabicyclo 3.3.3 undecane, 2,8,9-trioxa-5-aza-1-borabicyclo 3.3.3 undecane, 3,7,10-trimethyl, triisopropanolamineborate |
| PubChem CID | 225550 |
| IUPAC Name | 3,7,10-trimethyl-4,6,11-trioxa-1-aza-5-borabicyclo[3.3.3]undecane |
| SMILES | B12OC(CN(CC(O1)C)CC(O2)C)C |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC269241000
|
Thermo Scientific Chemicals
269241000 |
100 g | Glass bottle |
Each for $480.40
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 101-00-8 | |
| 199.06 | |
| IWKGJTDSJPLUCE-UHFFFAOYSA-N | |
| 225550 | |
| B12OC(CN(CC(O1)C)CC(O2)C)C |
| C9H18BNO3 | |
| MFCD03791298 | |
| triisopropanolamine cyclic borate, 3,7,10-trimethyl-2,8,9-trioxa-5-aza-1-borabicyclo 3.3.3 undecane, borester 21, triisopropanolamine borate, boric acid, tris 1-amino-2-propyl ester, 2-propanol, 1,1',1-nitrilotri-, cyclic borate, 3,7,10-trimethyl-4,6,11-trioxa-1-aza-5-borabicyclo 3.3.3 undecane, 2,8,9-trioxa-5-aza-1-borabicyclo 3.3.3 undecane, 3,7,10-trimethyl, triisopropanolamineborate | |
| 3,7,10-trimethyl-4,6,11-trioxa-1-aza-5-borabicyclo[3.3.3]undecane |
Specifications
| 101-00-8 | |
| White to Yellow | |
| 98% min. (GC) | |
| C9H18BNO3 | |
| 100 g | |
| IWKGJTDSJPLUCE-UHFFFAOYSA-N | |
| 3,7,10-trimethyl-4,6,11-trioxa-1-aza-5-borabicyclo[3.3.3]undecane | |
| 225550 | |
| 98+% | |
| Triisopropanolamine cyclic borate |
| 150°C to 157°C | |
| Authentic | |
| Glass bottle | |
| MFCD03791298 | |
| triisopropanolamine cyclic borate, 3,7,10-trimethyl-2,8,9-trioxa-5-aza-1-borabicyclo 3.3.3 undecane, borester 21, triisopropanolamine borate, boric acid, tris 1-amino-2-propyl ester, 2-propanol, 1,1',1-nitrilotri-, cyclic borate, 3,7,10-trimethyl-4,6,11-trioxa-1-aza-5-borabicyclo 3.3.3 undecane, 2,8,9-trioxa-5-aza-1-borabicyclo 3.3.3 undecane, 3,7,10-trimethyl, triisopropanolamineborate | |
| B12OC(CN(CC(O1)C)CC(O2)C)C | |
| 199.06 | |
| 199.06 | |
| Crystalline Chunks and Needles |
RUO – Research Use Only