missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Triethyl methanetricarboxylate, 98%
CAS: 6279-86-3 | C10H16O6 | 232.23 g/mol
$291.33 - $291.33
Chemical Identifiers
| CAS | 6279-86-3 |
|---|---|
| Molecular Formula | C10H16O6 |
| Molecular Weight (g/mol) | 232.23 |
| InChI Key | AGZPNUZBDCYTBB-UHFFFAOYSA-N |
| Synonym | tricarbethoxymethane, triethylmethanetricarboxylate, methanetricarboxylic acid, triethyl ester, 2-ethoxycarbonyl-malonic acid diethyl ester, methanetricarboxylic acid triethyl ester, carboxymalonic acid triethyl ester, diethyl 2-ethoxycarbonyl malonate, diethyl 2-ethoxycarbonyl propane-1,3-dioate, pubchem3106, triethoxycarbonylmethane |
| PubChem CID | 80471 |
| IUPAC Name | triethyl methanetricarboxylate |
| SMILES | CCOC(=O)C(C(=O)OCC)C(=O)OCC |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC139630250
|
Thermo Scientific Chemicals
139630250 |
25 mL | Glass bottle |
Each for $291.33
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 6279-86-3 | |
| 232.23 | |
| tricarbethoxymethane, triethylmethanetricarboxylate, methanetricarboxylic acid, triethyl ester, 2-ethoxycarbonyl-malonic acid diethyl ester, methanetricarboxylic acid triethyl ester, carboxymalonic acid triethyl ester, diethyl 2-ethoxycarbonyl malonate, diethyl 2-ethoxycarbonyl propane-1,3-dioate, pubchem3106, triethoxycarbonylmethane | |
| triethyl methanetricarboxylate |
| C10H16O6 | |
| AGZPNUZBDCYTBB-UHFFFAOYSA-N | |
| 80471 | |
| CCOC(=O)C(C(=O)OCC)C(=O)OCC |
Specifications
| 6279-86-3 | |
| Colorless to Yellow | |
| 253.0°C | |
| Authentic | |
| Glass bottle | |
| 1.4240 to 1.4260 | |
| 25 mL | |
| 1.1 | |
| Solubility in water: immiscible | |
| CCOC(=O)C(C(=O)OCC)C(=O)OCC | |
| 232.23 | |
| 232.23 | |
| Liquid After Melting |
| 29.0°C | |
| 1.1000g/mL | |
| >110°C | |
| 98% | |
| C10H16O6 | |
| CH(CO2C2H5)3 | |
| 02,81 | |
| tricarbethoxymethane, triethylmethanetricarboxylate, methanetricarboxylic acid, triethyl ester, 2-ethoxycarbonyl-malonic acid diethyl ester, methanetricarboxylic acid triethyl ester, carboxymalonic acid triethyl ester, diethyl 2-ethoxycarbonyl malonate, diethyl 2-ethoxycarbonyl propane-1,3-dioate, pubchem3106, triethoxycarbonylmethane | |
| AGZPNUZBDCYTBB-UHFFFAOYSA-N | |
| triethyl methanetricarboxylate | |
| 80471 | |
| 98% | |
| Triethyl methanetricarboxylate |
Safety and Handling
EINECSNumber : 228-477-2
RUO – Research Use Only