missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Triethyl 1,1,2-ethanetricarboxylate, 99%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 139610250
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| Triethyl 1,1,2-ethanetricarboxylate | |
| 1.0700g/mL | |
| >112°C | |
| 99% | |
| C11H18O6 | |
| 1.4280 to 1.43 | |
| 25g | |
| 1.07 | |
| TVWZLLYAJDSSCJ-UHFFFAOYSA-N | |
| triethyl ethane-1,1,2-tricarboxylate | |
| 81961 | |
| 99% |
| 7459-46-3 | |
| 99°C (0.5mmHg) | |
| Authentic | |
| Glass bottle | |
| C2H5O2CCH2CH(CO2C2H5)2 | |
| MFCD00009154 | |
| 02, 813 | |
| triethyl 1,1,2-ethanetricarboxylate, 1,1,2-ethanetricarboxylic acid, triethyl ester, 2-ethoxycarbonyl-succinic acid diethyl ester, triethyl ethane tricarboxylate, 1,1,2-triethyl ethane-1,1,2-tricarboxylate, triethyl ethane-1,2,2-tricarboxylate, ethane-1,1,2-tricarboxylic acid triethyl ester, ethane-1,1,2-tricarboxylic acid, triethyl ester, diethyl 2-ethoxycarbonyl butane-1,4-dioate, acmc-209ovd | |
| CCOC(=O)CC(C(=O)OCC)C(=O)OCC | |
| 246.26 | |
| 246.26 |
Chemical Identifiers
| 7459-46-3 | |
| 246.26 | |
| TVWZLLYAJDSSCJ-UHFFFAOYSA-N | |
| 81961 | |
| CCOC(=O)CC(C(=O)OCC)C(=O)OCC |
| C11H18O6 | |
| MFCD00009154 | |
| triethyl 1,1,2-ethanetricarboxylate, 1,1,2-ethanetricarboxylic acid, triethyl ester, 2-ethoxycarbonyl-succinic acid diethyl ester, triethyl ethane tricarboxylate, 1,1,2-triethyl ethane-1,1,2-tricarboxylate, triethyl ethane-1,2,2-tricarboxylate, ethane-1,1,2-tricarboxylic acid triethyl ester, ethane-1,1,2-tricarboxylic acid, triethyl ester, diethyl 2-ethoxycarbonyl butane-1,4-dioate, acmc-209ovd | |
| triethyl ethane-1,1,2-tricarboxylate |
Safety and Handling
EINECSNumber : 231-235-9
RUO â Research Use Only