Learn More
Trichloroacetic anhydride, 95%
CAS: 4124-31-6 | C4Cl6O3 | 308.76 g/mol
$851.40 - $851.40
Chemical Identifiers
| CAS | 4124-31-6 |
|---|---|
| Molecular Formula | C4Cl6O3 |
| Molecular Weight (g/mol) | 308.76 |
| InChI Key | MEFKFJOEVLUFAY-UHFFFAOYSA-N |
| Synonym | trichloroacetic anhydride, acetic acid, trichloro-, anhydride, acetic acid, 2,2,2-trichloro-, 1,1'-anhydride, acmc-1aliy, perchloroacetic anhydride, bis trichloroacetic anhydride, trichloroacetic acid anhydride, 2,2,2-trichloroacetic anhydride, trichloroacetyl 2,2,2-trichloroacetate |
| PubChem CID | 20079 |
| IUPAC Name | (2,2,2-trichloroacetyl) 2,2,2-trichloroacetate |
| SMILES | C(=O)(C(Cl)(Cl)Cl)OC(=O)C(Cl)(Cl)Cl |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AC446091000
|
Thermo Scientific Chemicals
446091000 |
100 g |
Each for $851.40
|
|
|||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 4124-31-6 | |
| 308.76 | |
| trichloroacetic anhydride, acetic acid, trichloro-, anhydride, acetic acid, 2,2,2-trichloro-, 1,1'-anhydride, acmc-1aliy, perchloroacetic anhydride, bis trichloroacetic anhydride, trichloroacetic acid anhydride, 2,2,2-trichloroacetic anhydride, trichloroacetyl 2,2,2-trichloroacetate | |
| (2,2,2-trichloroacetyl) 2,2,2-trichloroacetate |
| C4Cl6O3 | |
| MEFKFJOEVLUFAY-UHFFFAOYSA-N | |
| 20079 | |
| C(=O)(C(Cl)(Cl)Cl)OC(=O)C(Cl)(Cl)Cl |
Specifications
| 4124-31-6 | |
| 139°C to 141°C (60.0 mmHg) | |
| C4Cl6O3 | |
| 100 g | |
| trichloroacetic anhydride, acetic acid, trichloro-, anhydride, acetic acid, 2,2,2-trichloro-, 1,1'-anhydride, acmc-1aliy, perchloroacetic anhydride, bis trichloroacetic anhydride, trichloroacetic acid anhydride, 2,2,2-trichloroacetic anhydride, trichloroacetyl 2,2,2-trichloroacetate | |
| MEFKFJOEVLUFAY-UHFFFAOYSA-N | |
| (2,2,2-trichloroacetyl) 2,2,2-trichloroacetate | |
| 20079 | |
| 95% |
| 1.6900g/mL | |
| 95% | |
| [CCl3C(=O)]2O | |
| 1.69 | |
| Solubility in water: reacts | |
| C(=O)(C(Cl)(Cl)Cl)OC(=O)C(Cl)(Cl)Cl | |
| 308.76 | |
| 308.76 | |
| Trichloroacetic anhydride |
Safety and Handling
GHS H Statement
Causes severe skin burns and eye damage.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES: Rinse cautiously with water for several minutes.
Remove contact lenses,if present and easy to do.
Continue rinsing.
Immediately
GHS Signal Word: Danger
EINECSNumber : 223-925-3
RUO – Research Use Only