missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Tributyl citrate, 99+%
CAS: 77-94-1 | C18H32O7 | 360.45 g/mol
Supplier: Thermo Scientific Chemicals 421442500
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Tributyl citrate | |
| 0.02% max. (as citric acid) | |
| 1.0420g/mL | |
| 157°C | |
| 99% min. (GC) | |
| C18H32O7 | |
| HOCCOO(CH2)3CH3(CH2COO(CH2)3CH3)2 | |
| 250 g | |
| 15, 1565 | |
| Solubility in water: insoluble. Other solubilities: miscible with most organic liquids,soluble in ethanol and ether | |
| CCCCOC(=O)CC(O)(CC(=O)OCCCC)C(=O)OCCCC | |
| 360.45 | |
| 31.9 mPa.s (25°C) | |
| 99+% |
| 77-94-1 | |
| -20°C | |
| 325°C | |
| Authentic | |
| Glass bottle | |
| 1.4430 to 1.446 | |
| MFCD00027217 | |
| 1.042 | |
| tributyl citrate, butyl citrate, tri-n-butyl citrate, n-butyl citrate, citroflex 4, citric acid, tributyl ester, 1,2,3-propanetricarboxylic acid, 2-hydroxy-, tributyl ester, butyl citrate van, unii-827d5b1b6s, 2-hydroxy-1,2,3-propanetricarboxylic acid, tributyl ester | |
| ZFOZVQLOBQUTQQ-UHFFFAOYSA-N | |
| tributyl 2-hydroxypropane-1,2,3-tricarboxylate | |
| 6507 | |
| 360.45 | |
| Liquid |
Chemical Identifiers
| 77-94-1 | |
| 360.45 | |
| ZFOZVQLOBQUTQQ-UHFFFAOYSA-N | |
| 6507 | |
| CCCCOC(=O)CC(O)(CC(=O)OCCCC)C(=O)OCCCC |
| C18H32O7 | |
| MFCD00027217 | |
| tributyl citrate, butyl citrate, tri-n-butyl citrate, n-butyl citrate, citroflex 4, citric acid, tributyl ester, 1,2,3-propanetricarboxylic acid, 2-hydroxy-, tributyl ester, butyl citrate van, unii-827d5b1b6s, 2-hydroxy-1,2,3-propanetricarboxylic acid, tributyl ester | |
| tributyl 2-hydroxypropane-1,2,3-tricarboxylate |
Safety and Handling
EINECSNumber : 201-071-2
RUO – Research Use Only