missing translation for 'onlineSavingsMsg'
Learn More
Learn More
trans-4-Hydroxystilbene, 98%
CAS: 6554-98-9 | C14H12O | 196.25 g/mol
$138.42 - $138.42
Chemical Identifiers
| CAS | 6554-98-9 |
|---|---|
| Molecular Formula | C14H12O |
| Molecular Weight (g/mol) | 196.25 |
| MDL Number | MFCD00002386 |
| InChI Key | QVLMUEOXQBUPAH-VOTSOKGWSA-N |
| Synonym | trans-4-hydroxystilbene, 4-hydroxystilbene, 4-styrylphenol, 4-stilbenol, e-4-stilbenol, 4-2-phenylethenyl phenol, 4-2-phenylvinyl phenol, 4-e-2-phenylethenyl phenol, e-4-hydroxystilbene, stilben-4-ol |
| PubChem CID | 5284650 |
| ChEBI | CHEBI:35101 |
| IUPAC Name | 4-[(E)-2-phenylethenyl]phenol |
| SMILES | C1=CC=C(C=C1)C=CC2=CC=C(C=C2)O |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AC121930050
|
Thermo Scientific Chemicals
121930050 |
5 g |
Each for $138.42
|
|
|||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 6554-98-9 | |
| 196.25 | |
| QVLMUEOXQBUPAH-VOTSOKGWSA-N | |
| 5284650 | |
| 4-[(E)-2-phenylethenyl]phenol |
| C14H12O | |
| MFCD00002386 | |
| trans-4-hydroxystilbene, 4-hydroxystilbene, 4-styrylphenol, 4-stilbenol, e-4-stilbenol, 4-2-phenylethenyl phenol, 4-2-phenylvinyl phenol, 4-e-2-phenylethenyl phenol, e-4-hydroxystilbene, stilben-4-ol | |
| CHEBI:35101 | |
| C1=CC=C(C=C1)C=CC2=CC=C(C=C2)O |
Specifications
| 6554-98-9 | |
| 96.5% min. (HPLC) | |
| C14H12O | |
| MFCD00002386 | |
| 06,693 | |
| Solubility in water: insoluble. Other solubilities: soluble in acetone,chloroform,benzene,,soluble in acetic acid | |
| C1=CC=C(C=C1)C=CC2=CC=C(C=C2)O | |
| 196.25 | |
| CHEBI:35101 | |
| 98% |
| 185°C to 189°C | |
| Glass Bottle | |
| C6H5CH=CHC6H4OH | |
| 5 g | |
| trans-4-hydroxystilbene, 4-hydroxystilbene, 4-styrylphenol, 4-stilbenol, e-4-stilbenol, 4-2-phenylethenyl phenol, 4-2-phenylvinyl phenol, 4-e-2-phenylethenyl phenol, e-4-hydroxystilbene, stilben-4-ol | |
| QVLMUEOXQBUPAH-VOTSOKGWSA-N | |
| 4-[(E)-2-phenylethenyl]phenol | |
| 5284650 | |
| 196.25 | |
| trans-4-Hydroxystilbene, 98% |
Safety and Handling
GHS Signal Word: Warning
EINECSNumber : 229-483-8
RUO – Research Use Only