missing translation for 'onlineSavingsMsg'
Learn More
Learn More
trans-1,2-Dibenzoylethylene, 97%
CAS: 959-28-4 | C16H12O2 | 236.27 g/mol
Supplier: Thermo Scientific Chemicals 112580250
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| trans-1, 2-Dibenzoylethylene | |
| 959-28-4 | |
| Beige-Brown to White | |
| 96% min. (GC) | |
| C16H12O2 | |
| MFCD00003083 | |
| 07, IV, 2578 | |
| trans-1,2-dibenzoylethylene, dibenzoylethylene, 1,2-dibenzoylethylene, 1,4-diphenyl-2-butene-1,4-dione, trans-1,4-diphenyl-2-butene-1,4-dione, 1,2-dibenzoylethene, ethylene, 1,2-dibenzoyl, usaf nd-57, 2-butene-1,4-dione, 1,4-diphenyl, trans-diphenacylidene | |
| WYCXGQSQHAXLPK-VAWYXSNFSA-N | |
| (E)-1,4-diphenylbut-2-ene-1,4-dione | |
| 735960 | |
| 97% |
| 97% | |
| 108.0°C to 112.0°C | |
| Authentic | |
| Glass bottle | |
| C6H5COCH=CHCOC6H5 | |
| 25 g | |
| 01,195 | |
| Solubility in water: insoluble | |
| C1=CC=C(C=C1)C(=O)C=CC(=O)C2=CC=CC=C2 | |
| 236.27 | |
| 236.27 | |
| Crystals, Powder or Flakes |
Chemical Identifiers
| 959-28-4 | |
| 236.27 | |
| WYCXGQSQHAXLPK-VAWYXSNFSA-N | |
| 735960 | |
| C1=CC=C(C=C1)C(=O)C=CC(=O)C2=CC=CC=C2 |
| C16H12O2 | |
| MFCD00003083 | |
| trans-1,2-dibenzoylethylene, dibenzoylethylene, 1,2-dibenzoylethylene, 1,4-diphenyl-2-butene-1,4-dione, trans-1,4-diphenyl-2-butene-1,4-dione, 1,2-dibenzoylethene, ethylene, 1,2-dibenzoyl, usaf nd-57, 2-butene-1,4-dione, 1,4-diphenyl, trans-diphenacylidene | |
| (E)-1,4-diphenylbut-2-ene-1,4-dione |
Safety and Handling
EINECSNumber : 213-498-1
TSCA : TSCA
RUO – Research Use Only