Learn More
trans-1,2-Diaminocyclohexane-N,N,N',N'-tetraacetic acid monohydrate, ACS, 97.5%-100.5%
CAS: 125572-95-4 | C14H20N2O8 | 344.32 g/mol
$53.48 - $1165.10
Chemical Identifiers
| CAS | 125572-95-4 |
|---|---|
| Molecular Formula | C14H20N2O8 |
| Molecular Weight (g/mol) | 344.32 |
| MDL Number | MFCD00149243,MFCD00066429,MFCD00003845 |
| InChI Key | FCKYPQBAHLOOJQ-NXEZZACHSA-L |
| Synonym | 2,2',2,2'-trans-cyclohexane-1,2-diylbis azanetriyl tetraacetic acid hydrate, dcyta, trans-1,2-diaminocyclohexane-n,n,n',n'-tetraacetic acid monohydrate, 1,2-cyclohexanedinitrilotetraacetic acid, 2,2',2,2'-1r,2r-rel-cyclohexane-1,2-diylbis azanetriyl tetraacetic acid hydrate, trans-1,2-cyclohexanediaminetetraacetic acid monohydrate, cdta monohydrate, ctda monohydrate, chel-cd, chel r-cd |
| PubChem CID | 2723844 |
| IUPAC Name | 2-[[(1R,2R)-2-[bis(carboxymethyl)amino]cyclohexyl]-(carboxymethyl)amino]acetic acid;hydrate |
| SMILES | [O-]C(=O)C[NH+](CC([O-])=O)[C@@H]1CCCC[C@H]1[NH+](CC([O-])=O)CC([O-])=O |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AA3669706
|
Thermo Scientific Chemicals
03669706 |
5 g |
Each for $53.48
|
|
|||||
|
AA3669714
|
Thermo Scientific Chemicals
03669714 |
25 g |
Each for $142.47
|
|
|||||
|
AA3669722
|
Thermo Scientific Chemicals
03669722 |
100 g |
Each for $337.18
|
|
|||||
|
AA3669736
|
Thermo Scientific Chemicals
03669736 |
500 g |
Each for $1,165.10
|
|
|||||
Description
trans-1,2-Diaminocyclohexane-N,N,N',N'-tetraacetic acid monohydrate is an analytical reagent and a complexating agent for sodium. It acts as a ligand to prepare lanthanide shift reagents. It is involved in the separation and determination of iron(III)-dimethyldithiocarbamate, manganese(II)-ethylenebisdithiocarbamate and zinc(II)-ethylenebisdithiocarbamate by sensitive capillary electrophoretic ultraviolet method.
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 125572-95-4 | |
| 344.32 | |
| FCKYPQBAHLOOJQ-NXEZZACHSA-L | |
| 2723844 | |
| [O-]C(=O)C[NH+](CC([O-])=O)[C@@H]1CCCC[C@H]1[NH+](CC([O-])=O)CC([O-])=O |
| C14H20N2O8 | |
| MFCD00149243,MFCD00066429,MFCD00003845 | |
| 2,2',2,2'-trans-cyclohexane-1,2-diylbis azanetriyl tetraacetic acid hydrate, dcyta, trans-1,2-diaminocyclohexane-n,n,n',n'-tetraacetic acid monohydrate, 1,2-cyclohexanedinitrilotetraacetic acid, 2,2',2,2'-1r,2r-rel-cyclohexane-1,2-diylbis azanetriyl tetraacetic acid hydrate, trans-1,2-cyclohexanediaminetetraacetic acid monohydrate, cdta monohydrate, ctda monohydrate, chel-cd, chel r-cd | |
| 2-[[(1R,2R)-2-[bis(carboxymethyl)amino]cyclohexyl]-(carboxymethyl)amino]acetic acid;hydrate |
Specifications
| 125572-95-4 | |
| 97.5 to 100.5% | |
| MFCD00149243,MFCD00066429,MFCD00003845 | |
| 3222748 | |
| Slightly soluble in water. Soluble in 1N sodium hydroxide and alkali solutions. Insoluble in most common organic solvents. | |
| [O-]C(=O)C[NH+](CC([O-])=O)[C@@H]1CCCC[C@H]1[NH+](CC([O-])=O)CC([O-])=O | |
| 344.32 | |
| 364.35 (346.34 Anhydrous) | |
| ACS | |
| trans-1,2-Diaminocyclohexane-N,N,N',N'-tetraacetic acid monohydrate, For analysis ACS |
| 213°C to 216°C | |
| C14H20N2O8 | |
| 5 g | |
| 2,2',2,2'-trans-cyclohexane-1,2-diylbis azanetriyl tetraacetic acid hydrate, dcyta, trans-1,2-diaminocyclohexane-n,n,n',n'-tetraacetic acid monohydrate, 1,2-cyclohexanedinitrilotetraacetic acid, 2,2',2,2'-1r,2r-rel-cyclohexane-1,2-diylbis azanetriyl tetraacetic acid hydrate, trans-1,2-cyclohexanediaminetetraacetic acid monohydrate, cdta monohydrate, ctda monohydrate, chel-cd, chel r-cd | |
| FCKYPQBAHLOOJQ-NXEZZACHSA-L | |
| 2-[[(1R,2R)-2-[bis(carboxymethyl)amino]cyclohexyl]-(carboxymethyl)amino]acetic acid;hydrate | |
| 2723844 | |
| 97.5 to 100.5% | |
| Solid |
Safety and Handling
GHS H Statement
H315-H319-H335
Causes skin irritation.
Causes serious eye irritation.
May cause respiratory irritation.
P264b-P280i-P305+P351+P338
H319
EINECSNumber : 236-308-9
TSCA : Yes
Recommended Storage : Ambient temperatures
RUO – Research Use Only