missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Toluidine Blue, 1% Aqueous, Certified, LabChem™
Supplier: LabChem LC261652
Specifications
| Passes Test | |
| 1% Aqueous | |
| 99,1 | |
| C15H16ClN3S | |
| Soluble in water | |
| HNONEKILPDHFOL-UHFFFAOYSA-M | |
| 3-amino-7-(dimethylamino)-2-methyl-5λâ´-phenothiazin-5-ylium chloride | |
| 7083 | |
| Certified | |
| Nitrogen oxides; Carbon monoxide; Carbon dioxide; Sulfur compounds | |
| 1 L |
| Toluidine Blue | |
| 92-31-9,7732-18-5 | |
| C15H16ClN3S | |
| MFCD00011934 | |
| Passes Test | |
| [Cl-].CN(C)C1=CC=C2N=C3C=C(C)C(N)=CC3=[S+]C2=C1 | |
| 305.82 | |
| 305.82 | |
| Poly Bottle | |
| Purple | |
| Liquid |
Chemical Identifiers
| 92-31-9 | |
| 305.82 | |
| HNONEKILPDHFOL-UHFFFAOYSA-M | |
| 3-amino-7-(dimethylamino)-2-methyl-5λâ´-phenothiazin-5-ylium chloride |
| C15H16ClN3S | |
| MFCD00011934 | |
| 7083 | |
| [Cl-].CN(C)C1=CC=C2N=C3C=C(C)C(N)=CC3=[S+]C2=C1 |
Safety and Handling
GHS H Statement
Solution is not hazardous.
GHS P Statement
Wear eye protection, protective gloves.
Wash exposed skin thoroughly after handling.
If on skin: Wash with plenty of soap and water.
Take off contaminated clothing.
If skin irritation occurs: Get medical advice/attention.
If in eyes: Rinse cautiously with water for several minutes.
Remove contact lenses, if present and easy to do.
Continue rinsing.
If eye irritation persists: Get medical advice/attention.
Recommended Storage : Room Temperature