missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Titriplex™ II, Ethylenedinitrilotetraacetic acid, ACS, MilliporeSigma™
Supplier: Technidata 1084171000
Specifications
| Ethylenedinitrilotetraacetic Acid | |
| 600kg/m3 | |
| ≥200°C | |
| 99.4 - 100.6% | |
| MFCD00003541 | |
| edta, edetic acid, ethylenediaminetetraacetic acid, edathamil, versene, endrate, havidote, titriplex, edta acid, sequestrol | |
| KCXVZYZYPLLWCC-UHFFFAOYSA-N | |
| 2-({2-[bis(carboxymethyl)amino]ethyl}(carboxymethyl)amino)acetic acid | |
| 6049 | |
| 292.24 | |
| ACS, Reag. Ph |
| 60-00-4 | |
| 2.5 | |
| Plastic Bottle | |
| C10H16N2O8 | |
| 1 kg | |
| 0.5g/L | |
| OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O | |
| 292.24 | |
| CHEBI:42191 | |
| ≥0.013 hPa (20°C) | |
| Fine Crystalline to Crystalline Powder |
Chemical Identifiers
| 60-00-4 | |
| 292.24 | |
| KCXVZYZYPLLWCC-UHFFFAOYSA-N | |
| 6049 | |
| 2-({2-[bis(carboxymethyl)amino]ethyl}(carboxymethyl)amino)acetic acid |
| C10H16N2O8 | |
| MFCD00003541 | |
| edta, edetic acid, ethylenediaminetetraacetic acid, edathamil, versene, endrate, havidote, titriplex, edta acid, sequestrol | |
| CHEBI:42191 | |
| OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O |
Safety and Handling
P305 + P351 + P338: IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing.
H319: Causes serious eye irritation.
EINECSNumber : 200-449-4
RTECSNumber : AH4025000